Gallic Acid
| Internal ID | 29ef5a54-733f-454a-84dd-dde9084132f0 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Hydroxybenzoic acid derivatives > Gallic acid and derivatives > Gallic acids |
| IUPAC Name | 3,4,5-trihydroxybenzoic acid |
| SMILES (Canonical) | C1=C(C=C(C(=C1O)O)O)C(=O)O |
| SMILES (Isomeric) | C1=C(C=C(C(=C1O)O)O)C(=O)O |
| InChI | InChI=1S/C7H6O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,8-10H,(H,11,12) |
| InChI Key | LNTHITQWFMADLM-UHFFFAOYSA-N |
| Popularity | 26,382 references in papers |
| Molecular Formula | C7H6O5 |
| Molecular Weight | 170.12 g/mol |
| Exact Mass | 170.02152329 g/mol |
| Topological Polar Surface Area (TPSA) | 98.00 Ų |
| XlogP | 0.70 |
| Atomic LogP (AlogP) | 0.50 |
| H-Bond Acceptor | 4 |
| H-Bond Donor | 4 |
| Rotatable Bonds | 1 |
| 3,4,5-Trihydroxybenzoic acid |
| 149-91-7 |
| gallate |
| Benzoic acid, 3,4,5-trihydroxy- |
| Gallic acid, tech. |
| Kyselina gallova |
| Pyrogallol-5-carboxylic acid |
| GALOP |
| HSDB 2117 |
| CCRIS 5523 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8929 | 89.29% |
| Caco-2 | - | 0.7776 | 77.76% |
| Blood Brain Barrier | - | 0.7250 | 72.50% |
| Human oral bioavailability | + | 0.7143 | 71.43% |
| Subcellular localzation | Mitochondria | 0.7287 | 72.87% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.9414 | 94.14% |
| OATP1B3 inhibitior | + | 0.9648 | 96.48% |
| MATE1 inhibitior | - | 0.8200 | 82.00% |
| OCT2 inhibitior | - | 1.0000 | 100.00% |
| BSEP inhibitior | - | 0.9857 | 98.57% |
| P-glycoprotein inhibitior | - | 0.9766 | 97.66% |
| P-glycoprotein substrate | - | 0.9942 | 99.42% |
| CYP3A4 substrate | - | 0.8373 | 83.73% |
| CYP2C9 substrate | - | 0.8120 | 81.20% |
| CYP2D6 substrate | - | 0.8735 | 87.35% |
| CYP3A4 inhibition | - | 0.8427 | 84.27% |
| CYP2C9 inhibition | - | 0.9363 | 93.63% |
| CYP2C19 inhibition | - | 0.9782 | 97.82% |
| CYP2D6 inhibition | - | 0.9693 | 96.93% |
| CYP1A2 inhibition | - | 0.9274 | 92.74% |
| CYP2C8 inhibition | - | 0.9161 | 91.61% |
| CYP inhibitory promiscuity | - | 0.9318 | 93.18% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.7923 | 79.23% |
| Carcinogenicity (trinary) | Non-required | 0.7405 | 74.05% |
| Eye corrosion | - | 0.8617 | 86.17% |
| Eye irritation | + | 0.9904 | 99.04% |
| Skin irritation | + | 0.8623 | 86.23% |
| Skin corrosion | - | 0.8500 | 85.00% |
| Ames mutagenesis | - | 0.9200 | 92.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.8422 | 84.22% |
| Micronuclear | + | 0.8800 | 88.00% |
| Hepatotoxicity | + | 0.8750 | 87.50% |
| skin sensitisation | + | 0.8781 | 87.81% |
| Respiratory toxicity | - | 0.5111 | 51.11% |
| Reproductive toxicity | + | 0.6778 | 67.78% |
| Mitochondrial toxicity | - | 0.6000 | 60.00% |
| Nephrotoxicity | - | 0.6978 | 69.78% |
| Acute Oral Toxicity (c) | III | 0.6904 | 69.04% |
| Estrogen receptor binding | - | 0.6796 | 67.96% |
| Androgen receptor binding | + | 0.6456 | 64.56% |
| Thyroid receptor binding | - | 0.8320 | 83.20% |
| Glucocorticoid receptor binding | - | 0.6234 | 62.34% |
| Aromatase binding | - | 0.7733 | 77.33% |
| PPAR gamma | - | 0.7479 | 74.79% |
| Honey bee toxicity | - | 0.9826 | 98.26% |
| Biodegradation | + | 0.9000 | 90.00% |
| Crustacea aquatic toxicity | - | 0.7900 | 79.00% |
| Fish aquatic toxicity | + | 0.9250 | 92.50% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
7079.5 nM |
Potency |
via CMAUP
|
| CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
1995.3 nM 8912.5 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL3596077 | Q11130 | Alpha-(1,3)-fucosyltransferase 7 |
60 nM 60 nM |
IC50 IC50 |
via Super-PRED
DOI: 10.1039/C4MD00086B |
| CHEMBL261 | P00915 | Carbonic anhydrase I |
3200 nM |
Ki |
PMID: 20185318
|
| CHEMBL205 | P00918 | Carbonic anhydrase II |
2250 nM |
Ki |
PMID: 20185318
|
| CHEMBL2885 | P07451 | Carbonic anhydrase III |
7490 nM |
Ki |
PMID: 20185318
|
| CHEMBL3729 | P22748 | Carbonic anhydrase IV |
9800 nM |
Ki |
PMID: 20185318
|
| CHEMBL3594 | Q16790 | Carbonic anhydrase IX |
6990 nM |
Ki |
PMID: 20185318
|
| CHEMBL4789 | P35218 | Carbonic anhydrase VA |
4080 nM |
Ki |
PMID: 20185318
|
| CHEMBL3969 | Q9Y2D0 | Carbonic anhydrase VB |
9970 nM |
Ki |
PMID: 20185318
|
| CHEMBL3025 | P23280 | Carbonic anhydrase VI |
6130 nM |
Ki |
PMID: 20185318
|
| CHEMBL2326 | P43166 | Carbonic anhydrase VII |
6070 nM |
Ki |
PMID: 20185318
|
| CHEMBL3242 | O43570 | Carbonic anhydrase XII |
7780 nM |
Ki |
PMID: 20185318
|
| CHEMBL3510 | Q9ULX7 | Carbonic anhydrase XIV |
7030 nM |
Ki |
PMID: 20185318
|
| CHEMBL4096 | P04637 | Cellular tumor antigen p53 |
10000 nM 12589.3 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
50.1 nM 19952.6 nM 50.1 nM |
Potency Potency Potency |
via Super-PRED
via CMAUP via CMAUP |
| CHEMBL2284 | P04406 | Glyceraldehyde-3-phosphate dehydrogenase liver |
25118.9 nM |
Potency |
via CMAUP
|
| CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
354.8 nM 354.8 nM |
Potency Potency |
via Super-PRED
via CMAUP |
| CHEMBL4040 | P28482 | MAP kinase ERK2 |
22387.2 nM 25118.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
1995.3 nM 1258.9 nM 3981.1 nM |
Potency Potency Potency |
via CMAUP
via CMAUP via CMAUP |
| CHEMBL3713355 | Q10471 | Polypeptide N-acetylgalactosaminyltransferase 2 |
924 nM |
Kd |
via Super-PRED
|
| CHEMBL1293235 | P02545 | Prelamin-A/C |
281.8 nM 281.8 nM |
Potency Potency |
via Super-PRED
via CMAUP |
| CHEMBL1293232 | Q16637 | Survival motor neuron protein |
15848.9 nM |
Potency |
via CMAUP
|
| CHEMBL1075138 | Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 |
1000 nM 2511.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.31% | 91.11% |
| CHEMBL3194 | P02766 | Transthyretin | 94.25% | 90.71% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 86.76% | 94.42% |
| CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 84.50% | 95.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.86% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.31% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.96% | 99.17% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 80.88% | 81.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 370 |
| NPASS | NPC225710 |
| ChEMBL | CHEMBL288114 |
| LOTUS | LTS0222857 |
| wikiData | Q375837 |