4-Hydroxybenzoic acid
Internal ID | a5509820-31e8-4db9-a7ad-458769a607e4 |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Hydroxybenzoic acid derivatives |
IUPAC Name | 4-hydroxybenzoic acid |
SMILES (Canonical) | C1=CC(=CC=C1C(=O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C(=O)O)O |
InChI | InChI=1S/C7H6O3/c8-6-3-1-5(2-4-6)7(9)10/h1-4,8H,(H,9,10) |
InChI Key | FJKROLUGYXJWQN-UHFFFAOYSA-N |
Popularity | 8,249 references in papers |
Molecular Formula | C7H6O3 |
Molecular Weight | 138.12 g/mol |
Exact Mass | 138.031694049 g/mol |
Topological Polar Surface Area (TPSA) | 57.50 Ų |
XlogP | 1.60 |
Atomic LogP (AlogP) | 1.09 |
H-Bond Acceptor | 2 |
H-Bond Donor | 2 |
Rotatable Bonds | 1 |
99-96-7 |
p-Hydroxybenzoic acid |
4-Carboxyphenol |
p-Salicylic acid |
Benzoic acid, 4-hydroxy- |
para-Hydroxybenzoic acid |
Benzoic acid, p-hydroxy- |
p-carboxyphenol |
Paraben-acid |
4-Hydroxybenzoesaeure |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9941 | 99.41% |
Caco-2 | + | 0.9235 | 92.35% |
Blood Brain Barrier | - | 0.8000 | 80.00% |
Human oral bioavailability | + | 0.5143 | 51.43% |
Subcellular localzation | Mitochondria | 0.9063 | 90.63% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9268 | 92.68% |
OATP1B3 inhibitior | + | 0.9421 | 94.21% |
MATE1 inhibitior | - | 0.8600 | 86.00% |
OCT2 inhibitior | - | 1.0000 | 100.00% |
BSEP inhibitior | - | 0.9819 | 98.19% |
P-glycoprotein inhibitior | - | 0.9862 | 98.62% |
P-glycoprotein substrate | - | 0.9907 | 99.07% |
CYP3A4 substrate | - | 0.8263 | 82.63% |
CYP2C9 substrate | - | 0.8151 | 81.51% |
CYP2D6 substrate | - | 0.8731 | 87.31% |
CYP3A4 inhibition | - | 0.9493 | 94.93% |
CYP2C9 inhibition | - | 0.9697 | 96.97% |
CYP2C19 inhibition | - | 0.9651 | 96.51% |
CYP2D6 inhibition | - | 0.9827 | 98.27% |
CYP1A2 inhibition | - | 0.9752 | 97.52% |
CYP2C8 inhibition | - | 0.5749 | 57.49% |
CYP inhibitory promiscuity | - | 0.9554 | 95.54% |
UGT catelyzed | + | 0.9000 | 90.00% |
Carcinogenicity (binary) | - | 0.6078 | 60.78% |
Carcinogenicity (trinary) | Non-required | 0.6300 | 63.00% |
Eye corrosion | + | 0.7399 | 73.99% |
Eye irritation | + | 1.0000 | 100.00% |
Skin irritation | + | 0.9501 | 95.01% |
Skin corrosion | - | 0.7599 | 75.99% |
Ames mutagenesis | - | 1.0000 | 100.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.9364 | 93.64% |
Micronuclear | + | 0.5500 | 55.00% |
Hepatotoxicity | - | 0.6000 | 60.00% |
skin sensitisation | + | 0.7208 | 72.08% |
Respiratory toxicity | - | 0.9444 | 94.44% |
Reproductive toxicity | + | 0.5556 | 55.56% |
Mitochondrial toxicity | - | 0.8500 | 85.00% |
Nephrotoxicity | + | 0.6805 | 68.05% |
Acute Oral Toxicity (c) | III | 0.5472 | 54.72% |
Estrogen receptor binding | - | 0.8215 | 82.15% |
Androgen receptor binding | - | 0.6715 | 67.15% |
Thyroid receptor binding | - | 0.8439 | 84.39% |
Glucocorticoid receptor binding | - | 0.8585 | 85.85% |
Aromatase binding | - | 0.8217 | 82.17% |
PPAR gamma | - | 0.8111 | 81.11% |
Honey bee toxicity | - | 0.9837 | 98.37% |
Biodegradation | + | 0.9750 | 97.50% |
Crustacea aquatic toxicity | - | 0.9300 | 93.00% |
Fish aquatic toxicity | + | 0.8576 | 85.76% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL261 | P00915 | Carbonic anhydrase I |
920 nM 9800 nM 9800 nM |
Ki Ki Ki |
via Super-PRED
PMID: 18501600 PMID: 18579385 |
CHEMBL205 | P00918 | Carbonic anhydrase II |
10600 nM 870 nM 10600 nM |
Ki Ki Ki |
PMID: 18501600
via Super-PRED PMID: 18579385 |
CHEMBL2885 | P07451 | Carbonic anhydrase III |
6610 nM 696000 nM |
Ki Ki |
PMID: 20185318
PMID: 18579385 |
CHEMBL3729 | P22748 | Carbonic anhydrase IV |
809000 nM 7780 nM |
Ki Ki |
PMID: 18579385
PMID: 20185318 |
CHEMBL3594 | Q16790 | Carbonic anhydrase IX |
3730 nM 118000 nM |
Ki Ki |
PMID: 20185318
PMID: 18579385 |
CHEMBL4789 | P35218 | Carbonic anhydrase VA |
9200 nM 3670 nM |
Ki Ki |
PMID: 18579385
PMID: 20185318 |
CHEMBL3969 | Q9Y2D0 | Carbonic anhydrase VB |
10500 nM 7130 nM |
Ki Ki |
PMID: 18579385
PMID: 20185318 |
CHEMBL3025 | P23280 | Carbonic anhydrase VI |
11400 nM 5700 nM |
Ki Ki |
PMID: 18579385
PMID: 20185318 |
CHEMBL2326 | P43166 | Carbonic anhydrase VII |
4080 nM 716000 nM |
Ki Ki |
PMID: 20185318
PMID: 18579385 |
CHEMBL3242 | O43570 | Carbonic anhydrase XII |
6270 nM 4800 nM |
Ki Ki |
PMID: 20185318
PMID: 18579385 |
CHEMBL3510 | Q9ULX7 | Carbonic anhydrase XIV |
6160 nM 34300 nM |
Ki Ki |
PMID: 20185318
PMID: 18579385 |
CHEMBL2056 | P21728 | Dopamine D1 receptor |
1.11 nM |
EC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3194 | P02766 | Transthyretin | 91.46% | 90.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.47% | 90.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.18% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.00% | 86.33% |
CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 82.02% | 95.71% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 80.08% | 87.67% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.05% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 135 |
NPASS | NPC29883 |
ChEMBL | CHEMBL441343 |
LOTUS | LTS0263634 |
wikiData | Q229970 |