| 123-35-3 |
| beta-Myrcene |
| 1,6-Octadiene, 7-methyl-3-methylene- |
| 7-Methyl-3-methylene-1,6-octadiene |
| 7-methyl-3-methylideneocta-1,6-diene |
| beta-geraniolene |
| FEMA No. 2762 |
| 3-Methylene-7-methyl-1,6-octadiene |
| NSC-406264 |
| 3M39CZS25B |
| DTXSID6025692 |
| CHEBI:17221 |
| DTXCID205692 |
| RefChem:6044 |
| 204-622-5 |
| 2-methyl-6-methylene-1,7-octadiene |
| 7-Methyl-3-methyleneocta-1,6-diene |
| .beta.-Myrcene |
| 2-Methyl-6-methylene-2,7-octadiene |
| b-Myrcene |
| MFCD00008908 |
| .beta.-Geraniolene |
| beta -myrcene |
| 7-Methyl-3-methylene-octa-1,6-diene |
| NSC 406264 |
| b-Myrcene (>90%) |
| Myrcene (stabilized with BHT) |
| 7-Methyl-3-methyleneoctadiene-(1,6) |
| beta-Myrcene 1000 microg/mL in Isopropanol |
| Myrcene (natural) |
| CCRIS 3725 |
| HSDB 1258 |
| EINECS 204-622-5 |
| BRN 1719990 |
| UNII-3M39CZS25B |
| b-Geraniolene |
| Myrcene Natural |
| AI3-00738 |
| beta -mircene |
| Myrcene (Standard) |
| Myrcene, .beta.- |
| Myrcene - 75% |
| MYRCENE [FHFI] |
| MYRCENE [HSDB] |
| Myrcene, technical grade |
| MYRCENE [FCC] |
| Myrcene Natural ex Orange |
| Myrcene analytical standard |
| ?-Myrcene (>90%) |
| EC 204-622-5 |
| Myrcene, analytical standard |
| SCHEMBL21622 |
| 1, 7-methyl-3-methylene- |
| 4-01-00-01108 (Beilstein Handbook Reference) |
| .BETA.-MYRCENE [MI] |
| CHEMBL455491 |
| orb1301447 |
| SCHEMBL7761169 |
| .BETA.-MYRCENE [IARC] |
| SCHEMBL28148364 |
| FEMA 2762 |
| HY-N0803R |
| HY-N0803 |
| MSK40224 |
| WLN: 1Y1&U3YU1&1U1 |
| Tox21_300351 |
| BBL036906 |
| NSC406264 |
| STL477735 |
| AKOS015904015 |
| 3-Methylene-7-methyl-1, 6-octadiene |
| FM59691 |
| LMPR0102010005 |
| 7-methyl-3-methylidene-octa-1,6-diene |
| Mycrene 1000 microg/mL in Isopropanol |
| Myrcene 1000 microg/mL in Isopropanol |
| NCGC00091420-01 |
| NCGC00091420-02 |
| NCGC00254252-01 |
| CAS-123-35-3 |
| Myrcene, >=95%, stabilized, FCC, FG |
| SY050165 |
| VS-13772 |
| M0235 |
| NS00005804 |
| 7-Methyl-3-methylene-1,6-octadiene (myrcene) |
| C06074 |
| E80785 |
| EN300-187797 |
| A805060 |
| F242803 |
| Myrcene, primary pharmaceutical reference standard |
| Q424577 |
| 7-Methyl-3-methylene-1,6-octadiene (beta -myrcene) |
| InChI=1/C10H16/c1-5-10(4)8-6-7-9(2)3/h5,7H,1,4,6,8H2,2-3H |
| 29463-45-4 |
| 7-Methyl-3-methylene-1,6-octadiene;2-Methyl-6-methylene-2,7-octadiene;b-Geraniolene;3-Methylene-7-methyl-1,6-octadiene |
| N6Q |
|
There are more than 10 synonyms. If you wish to see them all click here.
|