Oleic Acid
| Internal ID | 1f4f0b60-91a8-47d2-a2cd-b23c86398e91 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acids and conjugates > Long-chain fatty acids |
| IUPAC Name | (Z)-octadec-9-enoic acid |
| SMILES (Canonical) | CCCCCCCCC=CCCCCCCCC(=O)O |
| SMILES (Isomeric) | CCCCCCCC/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9- |
| InChI Key | ZQPPMHVWECSIRJ-KTKRTIGZSA-N |
| Popularity | 44,476 references in papers |
| Molecular Formula | C18H34O2 |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.255880323 g/mol |
| Topological Polar Surface Area (TPSA) | 37.30 Ų |
| XlogP | 6.50 |
| Atomic LogP (AlogP) | 6.11 |
| H-Bond Acceptor | 1 |
| H-Bond Donor | 1 |
| Rotatable Bonds | 15 |
| 112-80-1 |
| cis-9-Octadecenoic acid |
| oleate |
| Elaidoic acid |
| cis-Oleic acid |
| Wecoline OO |
| (Z)-Octadec-9-enoic acid |
| Vopcolene 27 |
| Glycon wo |
| Glycon RO |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9947 | 99.47% |
| Caco-2 | + | 0.7127 | 71.27% |
| Blood Brain Barrier | + | 0.8250 | 82.50% |
| Human oral bioavailability | - | 0.6143 | 61.43% |
| Subcellular localzation | Plasma membrane | 0.5465 | 54.65% |
| OATP2B1 inhibitior | - | 0.8485 | 84.85% |
| OATP1B1 inhibitior | - | 0.3622 | 36.22% |
| OATP1B3 inhibitior | - | 0.5698 | 56.98% |
| MATE1 inhibitior | - | 0.9600 | 96.00% |
| OCT2 inhibitior | - | 0.9000 | 90.00% |
| BSEP inhibitior | - | 0.7390 | 73.90% |
| P-glycoprotein inhibitior | - | 0.8821 | 88.21% |
| P-glycoprotein substrate | - | 0.9649 | 96.49% |
| CYP3A4 substrate | - | 0.6902 | 69.02% |
| CYP2C9 substrate | + | 0.6276 | 62.76% |
| CYP2D6 substrate | - | 0.8766 | 87.66% |
| CYP3A4 inhibition | - | 0.9295 | 92.95% |
| CYP2C9 inhibition | - | 0.8972 | 89.72% |
| CYP2C19 inhibition | - | 0.9467 | 94.67% |
| CYP2D6 inhibition | - | 0.9545 | 95.45% |
| CYP1A2 inhibition | + | 0.9107 | 91.07% |
| CYP2C8 inhibition | - | 0.9384 | 93.84% |
| CYP inhibitory promiscuity | - | 0.9349 | 93.49% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.7035 | 70.35% |
| Carcinogenicity (trinary) | Non-required | 0.7021 | 70.21% |
| Eye corrosion | + | 0.9611 | 96.11% |
| Eye irritation | + | 0.9715 | 97.15% |
| Skin irritation | + | 0.8622 | 86.22% |
| Skin corrosion | + | 0.6450 | 64.50% |
| Ames mutagenesis | - | 0.9900 | 99.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.3944 | 39.44% |
| Micronuclear | - | 1.0000 | 100.00% |
| Hepatotoxicity | - | 0.7625 | 76.25% |
| skin sensitisation | + | 0.8676 | 86.76% |
| Respiratory toxicity | - | 0.7111 | 71.11% |
| Reproductive toxicity | - | 0.7866 | 78.66% |
| Mitochondrial toxicity | + | 0.5625 | 56.25% |
| Nephrotoxicity | - | 0.7161 | 71.61% |
| Acute Oral Toxicity (c) | IV | 0.8289 | 82.89% |
| Estrogen receptor binding | - | 0.7029 | 70.29% |
| Androgen receptor binding | - | 0.8205 | 82.05% |
| Thyroid receptor binding | + | 0.6250 | 62.50% |
| Glucocorticoid receptor binding | - | 0.8662 | 86.62% |
| Aromatase binding | - | 0.8709 | 87.09% |
| PPAR gamma | + | 0.8715 | 87.15% |
| Honey bee toxicity | - | 0.9960 | 99.60% |
| Biodegradation | + | 0.9750 | 97.50% |
| Crustacea aquatic toxicity | + | 0.8900 | 89.00% |
| Fish aquatic toxicity | + | 0.9649 | 96.49% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL2243 | O00519 | Anandamide amidohydrolase |
6000 nM |
Ki |
PMID: 18983142
|
| CHEMBL1293237 | P54132 | Bloom syndrome protein |
35481.3 nM |
Potency |
via CMAUP
|
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 |
32700 nM |
IC50 |
PMID: 16643058
|
| CHEMBL1781 | P11387 | DNA topoisomerase I |
31000 nM |
IC50 |
PMID: 12444712
|
| CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
19952.6 nM 15848.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL2083 | P15090 | Fatty acid binding protein adipocyte |
26100 nM |
IC50 |
PMID: 20471252
|
| CHEMBL3674 | Q01469 | Fatty acid binding protein epidermal |
248 nM |
Ki |
PMID: 17502136
|
| CHEMBL240 | Q12809 | HERG |
10410 nM |
EC50 |
via CMAUP
|
| CHEMBL1293299 | Q03164 | Histone-lysine N-methyltransferase MLL |
15848.9 nM |
Potency |
via CMAUP
|
| CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
28183.8 nM |
Potency |
via CMAUP
|
| CHEMBL239 | Q07869 | Peroxisome proliferator-activated receptor alpha |
600 nM 600 nM 600 nM |
IC50 IC50 IC50 |
via Super-PRED
DOI: 10.1007/s00044-012-0285-6 DOI: 10.1007/s00044-008-9102-7 |
| CHEMBL3979 | Q03181 | Peroxisome proliferator-activated receptor delta |
5300 nM |
IC50 |
DOI: 10.1007/s00044-012-0285-6
|
| CHEMBL235 | P37231 | Peroxisome proliferator-activated receptor gamma |
4100 nM |
IC50 |
DOI: 10.1007/s00044-012-0285-6
|
| CHEMBL2219 | P35236 | Protein-tyrosine phosphatase LC-PTP |
801 nM |
IC50 |
via Super-PRED
|
| CHEMBL3797 | Q13315 | Serine-protein kinase ATM |
15848.9 nM |
Potency |
via CMAUP
|
| CHEMBL2916 | O14746 | Telomerase reverse transcriptase |
8600 nM |
IC50 |
DOI: 10.1039/C0MD00241K
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.97% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.56% | 98.95% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 95.16% | 92.08% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 94.14% | 89.63% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 93.36% | 97.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.93% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.65% | 90.17% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.24% | 96.95% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 84.84% | 85.94% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 83.86% | 97.29% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 83.06% | 96.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.12% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 445639 |
| NPASS | NPC261831 |
| ChEMBL | CHEMBL8659 |
| LOTUS | LTS0256910 |
| wikiData | Q207688 |