Quercitrin
Internal ID | 9085719c-61f7-4789-addd-ce6a7eb28d2f |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC(=C(C=C4)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC(=C(C=C4)O)O)O)O)O |
InChI | InChI=1S/C21H20O11/c1-7-15(26)17(28)18(29)21(30-7)32-20-16(27)14-12(25)5-9(22)6-13(14)31-19(20)8-2-3-10(23)11(24)4-8/h2-7,15,17-18,21-26,28-29H,1H3/t7-,15-,17+,18+,21-/m0/s1 |
InChI Key | OXGUCUVFOIWWQJ-HQBVPOQASA-N |
Popularity | 409 references in papers |
Molecular Formula | C21H20O11 |
Molecular Weight | 448.40 g/mol |
Exact Mass | 448.10056145 g/mol |
Topological Polar Surface Area (TPSA) | 186.00 Ų |
XlogP | 0.90 |
Atomic LogP (AlogP) | 0.49 |
H-Bond Acceptor | 11 |
H-Bond Donor | 7 |
Rotatable Bonds | 3 |
522-12-3 |
Quercetin 3-rhamnoside |
Quercitroside |
Quercetrin |
Quercimelin |
Thujin |
Quercetin 3-O-rhamnoside |
Quercetin 3-L-rhamnoside |
Quercetin-3-L-rhamnoside |
Quercitronic acid |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.8357 | 83.57% |
Caco-2 | - | 0.7858 | 78.58% |
Blood Brain Barrier | - | 0.8500 | 85.00% |
Human oral bioavailability | - | 0.6857 | 68.57% |
Subcellular localzation | Mitochondria | 0.7163 | 71.63% |
OATP2B1 inhibitior | + | 0.5902 | 59.02% |
OATP1B1 inhibitior | + | 0.9413 | 94.13% |
OATP1B3 inhibitior | + | 0.9188 | 91.88% |
MATE1 inhibitior | - | 0.7800 | 78.00% |
OCT2 inhibitior | - | 0.9500 | 95.00% |
BSEP inhibitior | - | 0.6264 | 62.64% |
P-glycoprotein inhibitior | - | 0.5351 | 53.51% |
P-glycoprotein substrate | - | 0.6786 | 67.86% |
CYP3A4 substrate | + | 0.6264 | 62.64% |
CYP2C9 substrate | - | 0.7038 | 70.38% |
CYP2D6 substrate | - | 0.8611 | 86.11% |
CYP3A4 inhibition | - | 0.7109 | 71.09% |
CYP2C9 inhibition | - | 0.8538 | 85.38% |
CYP2C19 inhibition | - | 0.8339 | 83.39% |
CYP2D6 inhibition | - | 0.9547 | 95.47% |
CYP1A2 inhibition | - | 0.5306 | 53.06% |
CYP2C8 inhibition | + | 0.9061 | 90.61% |
CYP inhibitory promiscuity | - | 0.5648 | 56.48% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 0.9900 | 99.00% |
Carcinogenicity (trinary) | Non-required | 0.6170 | 61.70% |
Eye corrosion | - | 0.9885 | 98.85% |
Eye irritation | - | 0.7424 | 74.24% |
Skin irritation | - | 0.6220 | 62.20% |
Skin corrosion | - | 0.9360 | 93.60% |
Ames mutagenesis | + | 0.5863 | 58.63% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.6352 | 63.52% |
Micronuclear | + | 0.9100 | 91.00% |
Hepatotoxicity | + | 0.5375 | 53.75% |
skin sensitisation | - | 0.8874 | 88.74% |
Respiratory toxicity | + | 0.5556 | 55.56% |
Reproductive toxicity | + | 0.7333 | 73.33% |
Mitochondrial toxicity | + | 0.6250 | 62.50% |
Nephrotoxicity | - | 0.8191 | 81.91% |
Acute Oral Toxicity (c) | III | 0.5184 | 51.84% |
Estrogen receptor binding | + | 0.6589 | 65.89% |
Androgen receptor binding | + | 0.7443 | 74.43% |
Thyroid receptor binding | + | 0.5667 | 56.67% |
Glucocorticoid receptor binding | + | 0.7217 | 72.17% |
Aromatase binding | - | 0.5140 | 51.40% |
PPAR gamma | + | 0.6941 | 69.41% |
Honey bee toxicity | - | 0.7943 | 79.43% |
Biodegradation | - | 0.7250 | 72.50% |
Crustacea aquatic toxicity | + | 0.5050 | 50.50% |
Fish aquatic toxicity | + | 0.9457 | 94.57% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1900 | P15121 | Aldose reductase |
150 nM 2000 nM 150 nM |
IC50 IC50 IC50 |
PMID: 18165015
PMID: 22261024 via Super-PRED |
CHEMBL3729 | P22748 | Carbonic anhydrase IV |
67.3 nM |
Ki |
via Super-PRED
|
CHEMBL2326 | P43166 | Carbonic anhydrase VII |
3.9 nM |
Ki |
via Super-PRED
|
CHEMBL3242 | O43570 | Carbonic anhydrase XII |
43.5 nM |
Ki |
via Super-PRED
|
CHEMBL1287622 | Q9Y468 | Lethal(3)malignant brain tumor-like protein 1 |
19952.6 nM |
Potency |
via CMAUP
|
CHEMBL5422 | P07237 | Protein disulfide-isomerase |
2480 nM |
AC50 |
via CMAUP
|
CHEMBL4523 | Q9P1W9 | Serine/threonine-protein kinase PIM2 |
25000 nM |
IC50 |
PMID: 18163587
|
CHEMBL1929 | P47989 | Xanthine dehydrogenase |
14740 nM |
IC50 |
PMID: 12444671
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.27% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.14% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.95% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 96.65% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.47% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.04% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.01% | 94.73% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.54% | 99.15% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 90.50% | 95.64% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.82% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 87.42% | 90.71% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.11% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.55% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.06% | 96.09% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 84.30% | 95.78% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.11% | 99.23% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 83.02% | 93.65% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.43% | 90.00% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 81.26% | 80.78% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.95% | 97.36% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 5280459 |
NPASS | NPC173637 |
ChEMBL | CHEMBL82242 |
LOTUS | LTS0093095 |
wikiData | Q1649777 |