Syringic acid
Internal ID | 39a068c5-2109-4c16-bce8-1c2f56d9b5ac |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Hydroxybenzoic acid derivatives > Gallic acid and derivatives |
IUPAC Name | 4-hydroxy-3,5-dimethoxybenzoic acid |
SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)C(=O)O |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)C(=O)O |
InChI | InChI=1S/C9H10O5/c1-13-6-3-5(9(11)12)4-7(14-2)8(6)10/h3-4,10H,1-2H3,(H,11,12) |
InChI Key | JMSVCTWVEWCHDZ-UHFFFAOYSA-N |
Popularity | 3,637 references in papers |
Molecular Formula | C9H10O5 |
Molecular Weight | 198.17 g/mol |
Exact Mass | 198.05282342 g/mol |
Topological Polar Surface Area (TPSA) | 76.00 Ų |
XlogP | 1.00 |
530-57-4 |
4-Hydroxy-3,5-dimethoxybenzoic acid |
3,5-Dimethoxy-4-hydroxybenzoic acid |
Cedar acid |
Gallic acid 3,5-dimethyl ether |
Benzoic acid, 4-hydroxy-3,5-dimethoxy- |
NSC 2129 |
3,5-Dimethoxy-4-hydroxybenzyl acid |
EINECS 208-486-8 |
BRN 2115262 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL261 | P00915 | Carbonic anhydrase I |
4150 nM |
Ki |
PMID: 20185318
|
CHEMBL205 | P00918 | Carbonic anhydrase II |
3190 nM |
Ki |
PMID: 20185318
|
CHEMBL2885 | P07451 | Carbonic anhydrase III |
8580 nM |
Ki |
PMID: 20185318
|
CHEMBL3729 | P22748 | Carbonic anhydrase IV |
10600 nM |
Ki |
PMID: 20185318
|
CHEMBL3594 | Q16790 | Carbonic anhydrase IX |
8200 nM |
Ki |
PMID: 20185318
|
CHEMBL4789 | P35218 | Carbonic anhydrase VA |
6340 nM |
Ki |
PMID: 20185318
|
CHEMBL3969 | Q9Y2D0 | Carbonic anhydrase VB |
35400 nM |
Ki |
PMID: 20185318
|
CHEMBL3025 | P23280 | Carbonic anhydrase VI |
7550 nM |
Ki |
PMID: 20185318
|
CHEMBL2326 | P43166 | Carbonic anhydrase VII |
7810 nM |
Ki |
PMID: 20185318
|
CHEMBL3242 | O43570 | Carbonic anhydrase XII |
9010 nM |
Ki |
PMID: 20185318
|
CHEMBL3510 | Q9ULX7 | Carbonic anhydrase XIV |
9140 nM |
Ki |
PMID: 20185318
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.36% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.15% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.45% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 89.27% | 90.71% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.75% | 91.11% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 87.84% | 90.20% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.74% | 95.56% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 86.72% | 94.42% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.92% | 90.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.88% | 96.00% |
CHEMBL2535 | P11166 | Glucose transporter | 83.56% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 10742 |
NPASS | NPC110899 |
ChEMBL | CHEMBL1414 |
LOTUS | LTS0210036 |
wikiData | Q408428 |