Syringaresinol, (+)-
Internal ID | 2e95e2f0-51ff-4c1e-9f53-d4fea292019a |
Taxonomy | Lignans, neolignans and related compounds > Furanoid lignans |
IUPAC Name | 4-[(3S,3aR,6S,6aR)-6-(4-hydroxy-3,5-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2,6-dimethoxyphenol |
SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)C2C3COC(C3CO2)C4=CC(=C(C(=C4)OC)O)OC |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)[C@@H]2[C@H]3CO[C@@H]([C@H]3CO2)C4=CC(=C(C(=C4)OC)O)OC |
InChI | InChI=1S/C22H26O8/c1-25-15-5-11(6-16(26-2)19(15)23)21-13-9-30-22(14(13)10-29-21)12-7-17(27-3)20(24)18(8-12)28-4/h5-8,13-14,21-24H,9-10H2,1-4H3/t13-,14-,21+,22+/m0/s1 |
InChI Key | KOWMJRJXZMEZLD-HCIHMXRSSA-N |
Popularity | 117 references in papers |
Molecular Formula | C22H26O8 |
Molecular Weight | 418.40 g/mol |
Exact Mass | 418.16276778 g/mol |
Topological Polar Surface Area (TPSA) | 95.80 Ų |
XlogP | 2.20 |
21453-69-0 |
DL-Syringaresinol |
(+)-lirioresinol B |
(+/-)-Syringaresinol |
Syringaresinol, (+)- |
CHEBI:47 |
155K1084GO |
Syringaresinol, (+/-)- |
6YWP8N8R9S |
(-) Syringaresinol |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3979 | Q03181 | Peroxisome proliferator-activated receptor delta |
18110 nM |
EC50 |
PMID: 27450788
|
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B |
15010 nM |
IC50 |
PMID: 24224843
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.65% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.03% | 96.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.64% | 92.94% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.58% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.23% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.59% | 85.14% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.70% | 92.62% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.58% | 97.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.89% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 81.89% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.35% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.35% | 99.17% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.39% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 443023 |
NPASS | NPC141765 |
ChEMBL | CHEMBL361362 |
LOTUS | LTS0158868 |
wikiData | Q7663351 |