Adenosine
Internal ID | ed27d9dd-0a27-42ea-a515-32c0cc0d13f0 |
Taxonomy | Nucleosides, nucleotides, and analogues > Purine nucleosides |
IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
SMILES (Canonical) | C1=NC(=C2C(=N1)N(C=N2)C3C(C(C(O3)CO)O)O)N |
SMILES (Isomeric) | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N |
InChI | InChI=1S/C10H13N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13)/t4-,6-,7-,10-/m1/s1 |
InChI Key | OIRDTQYFTABQOQ-KQYNXXCUSA-N |
Popularity | 88,432 references in papers |
Molecular Formula | C10H13N5O4 |
Molecular Weight | 267.24 g/mol |
Exact Mass | 267.09675391 g/mol |
Topological Polar Surface Area (TPSA) | 140.00 Ų |
XlogP | -1.10 |
Atomic LogP (AlogP) | -1.98 |
H-Bond Acceptor | 9 |
H-Bond Donor | 4 |
Rotatable Bonds | 2 |
58-61-7 |
Adenocard |
Adenoscan |
Adenine riboside |
beta-D-Adenosine |
Nucleocardyl |
Adenosin |
Sandesin |
Boniton |
Myocol |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.6454 | 64.54% |
Caco-2 | - | 0.9373 | 93.73% |
Blood Brain Barrier | + | 0.7500 | 75.00% |
Human oral bioavailability | - | 0.9429 | 94.29% |
Subcellular localzation | Nucleus | 0.4394 | 43.94% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9590 | 95.90% |
OATP1B3 inhibitior | + | 0.9512 | 95.12% |
MATE1 inhibitior | - | 1.0000 | 100.00% |
OCT2 inhibitior | - | 1.0000 | 100.00% |
BSEP inhibitior | - | 0.9555 | 95.55% |
P-glycoprotein inhibitior | - | 0.9229 | 92.29% |
P-glycoprotein substrate | - | 0.8999 | 89.99% |
CYP3A4 substrate | - | 0.6259 | 62.59% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8703 | 87.03% |
CYP3A4 inhibition | - | 0.9620 | 96.20% |
CYP2C9 inhibition | - | 0.9595 | 95.95% |
CYP2C19 inhibition | - | 0.9514 | 95.14% |
CYP2D6 inhibition | - | 0.9770 | 97.70% |
CYP1A2 inhibition | - | 0.9667 | 96.67% |
CYP2C8 inhibition | - | 0.8783 | 87.83% |
CYP inhibitory promiscuity | - | 0.9701 | 97.01% |
UGT catelyzed | + | 0.9000 | 90.00% |
Carcinogenicity (binary) | - | 0.9800 | 98.00% |
Carcinogenicity (trinary) | Non-required | 0.5680 | 56.80% |
Eye corrosion | - | 0.9904 | 99.04% |
Eye irritation | - | 0.9280 | 92.80% |
Skin irritation | - | 0.7595 | 75.95% |
Skin corrosion | - | 0.9377 | 93.77% |
Ames mutagenesis | - | 0.8491 | 84.91% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.6454 | 64.54% |
Micronuclear | + | 1.0000 | 100.00% |
Hepatotoxicity | - | 0.8235 | 82.35% |
skin sensitisation | - | 0.8606 | 86.06% |
Respiratory toxicity | + | 0.9667 | 96.67% |
Reproductive toxicity | + | 0.9889 | 98.89% |
Mitochondrial toxicity | + | 0.9750 | 97.50% |
Nephrotoxicity | - | 0.8236 | 82.36% |
Acute Oral Toxicity (c) | III | 0.7890 | 78.90% |
Estrogen receptor binding | - | 0.5890 | 58.90% |
Androgen receptor binding | + | 0.6240 | 62.40% |
Thyroid receptor binding | + | 0.5830 | 58.30% |
Glucocorticoid receptor binding | + | 0.5472 | 54.72% |
Aromatase binding | + | 0.8260 | 82.60% |
PPAR gamma | + | 0.7051 | 70.51% |
Honey bee toxicity | - | 0.9226 | 92.26% |
Biodegradation | - | 0.8250 | 82.50% |
Crustacea aquatic toxicity | - | 0.7400 | 74.00% |
Fish aquatic toxicity | - | 0.9143 | 91.43% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL226 | P30542 | Adenosine A1 receptor |
2.344 nM 2.344 nM |
IC50 IC50 |
PMID: 26756468
via Super-PRED |
CHEMBL251 | P29274 | Adenosine A2a receptor |
730 nM 700 nM 700 nM 700 nM 700 nM |
EC50 EC50 EC50 EC50 EC50 |
PMID: 26356532
PMID: 24164628 via Super-PRED PMID: 20541935 PMID: 21388809 |
CHEMBL255 | P29275 | Adenosine A2b receptor |
24000 nM 24000 nM 24000 nM |
EC50 EC50 EC50 |
PMID: 20541935
PMID: 24164628 PMID: 21388809 |
CHEMBL256 | P0DMS8 | Adenosine A3 receptor |
1.148 nM 1.148 nM |
IC50 IC50 |
via Super-PRED
PMID: 26756468 |
CHEMBL3589 | P55263 | Adenosine kinase |
0.01 nM |
ED50 |
PMID: 8230132
|
CHEMBL284 | P27487 | Dipeptidyl peptidase IV |
62 nM |
IC50 |
via Super-PRED
|
CHEMBL2284 | P04406 | Glyceraldehyde-3-phosphate dehydrogenase liver |
50000000 nM 100000000 nM 50000000 nM 35000 nM 35000000 nM 50000 nM 100000 nM |
IC50 IC50 IC50 IC50 IC50 IC50 IC50 |
PMID: 7562915
PMID: 7562915 PMID: 9822549 PMID: 7932587 PMID: 7562915 PMID: 7932587 PMID: 7932587 |
CHEMBL4040 | P28482 | MAP kinase ERK2 |
12589.3 nM |
Potency |
via CMAUP
|
CHEMBL5401 | P42226 | Signal transducer and activator of transcription 6 |
0.03162 nM 1258.9 nM 1258.9 nM |
Potency Potency Potency |
via Super-PRED
via CMAUP via CMAUP |
CHEMBL5551 | O00337 | Sodium/nucleoside cotransporter 1 |
5500 nM |
IC50 |
PMID: 23388705
|
CHEMBL5780 | O43868 | Sodium/nucleoside cotransporter 2 |
5500 nM |
IC50 |
PMID: 23388705
|
CHEMBL5707 | Q9HAS3 | Solute carrier family 28 member 3 |
3300 nM |
IC50 |
PMID: 23388705
|
CHEMBL1293232 | Q16637 | Survival motor neuron protein |
1122 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3589 | P55263 | Adenosine kinase | 98.93% | 98.05% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.71% | 96.09% |
CHEMBL3137261 | O14744 | PRMT5/MEP50 complex | 95.34% | 100.00% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 90.74% | 80.33% |
CHEMBL5524 | Q99873 | Protein-arginine N-methyltransferase 1 | 90.27% | 96.67% |
CHEMBL4523377 | Q86WV6 | Stimulator of interferon genes protein | 89.33% | 95.48% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.04% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.36% | 94.00% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 84.35% | 98.46% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.43% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.13% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.01% | 94.73% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.74% | 95.89% |
CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 80.47% | 88.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.