Taxifolin
Internal ID | 3649429e-bf85-446d-b9ba-920b1bd67b94 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > Flavanones > Flavanonols |
IUPAC Name | (2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | C1=CC(=C(C=C1C2C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=C(C=C1[C@@H]2[C@H](C(=O)C3=C(C=C(C=C3O2)O)O)O)O)O |
InChI | InChI=1S/C15H12O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,14-19,21H/t14-,15+/m0/s1 |
InChI Key | CXQWRCVTCMQVQX-LSDHHAIUSA-N |
Popularity | 1,568 references in papers |
Molecular Formula | C15H12O7 |
Molecular Weight | 304.25 g/mol |
Exact Mass | 304.05830272 g/mol |
Topological Polar Surface Area (TPSA) | 127.00 Ų |
XlogP | 1.50 |
Atomic LogP (AlogP) | 1.19 |
H-Bond Acceptor | 7 |
H-Bond Donor | 5 |
Rotatable Bonds | 1 |
(+)-Taxifolin |
480-18-2 |
dihydroquercetin |
Distylin |
Taxifoliol |
(+)-Dihydroquercetin |
(2R,3R)-Dihydroquercetin |
24198-97-8 |
Lavitol |
Diquertin |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9071 | 90.71% |
Caco-2 | - | 0.9372 | 93.72% |
Blood Brain Barrier | - | 0.7750 | 77.50% |
Human oral bioavailability | - | 0.7143 | 71.43% |
Subcellular localzation | Mitochondria | 0.5892 | 58.92% |
OATP2B1 inhibitior | - | 0.6726 | 67.26% |
OATP1B1 inhibitior | + | 0.9649 | 96.49% |
OATP1B3 inhibitior | + | 0.9480 | 94.80% |
MATE1 inhibitior | - | 0.8600 | 86.00% |
OCT2 inhibitior | - | 0.9750 | 97.50% |
BSEP inhibitior | - | 0.8847 | 88.47% |
P-glycoprotein inhibitior | - | 0.8944 | 89.44% |
P-glycoprotein substrate | - | 0.9736 | 97.36% |
CYP3A4 substrate | - | 0.5317 | 53.17% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.7991 | 79.91% |
CYP3A4 inhibition | + | 0.6951 | 69.51% |
CYP2C9 inhibition | - | 0.5823 | 58.23% |
CYP2C19 inhibition | - | 0.9025 | 90.25% |
CYP2D6 inhibition | - | 0.9287 | 92.87% |
CYP1A2 inhibition | + | 0.9106 | 91.06% |
CYP2C8 inhibition | - | 0.6060 | 60.60% |
CYP inhibitory promiscuity | + | 0.5822 | 58.22% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 1.0000 | 100.00% |
Carcinogenicity (trinary) | Non-required | 0.6750 | 67.50% |
Eye corrosion | - | 0.9905 | 99.05% |
Eye irritation | + | 0.9821 | 98.21% |
Skin irritation | + | 0.5835 | 58.35% |
Skin corrosion | - | 0.9397 | 93.97% |
Ames mutagenesis | + | 0.5400 | 54.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.7322 | 73.22% |
Micronuclear | + | 0.9300 | 93.00% |
Hepatotoxicity | - | 0.7000 | 70.00% |
skin sensitisation | - | 0.7447 | 74.47% |
Respiratory toxicity | + | 0.5444 | 54.44% |
Reproductive toxicity | + | 0.7667 | 76.67% |
Mitochondrial toxicity | + | 0.5875 | 58.75% |
Nephrotoxicity | + | 0.6337 | 63.37% |
Acute Oral Toxicity (c) | II | 0.7348 | 73.48% |
Estrogen receptor binding | + | 0.6059 | 60.59% |
Androgen receptor binding | + | 0.6826 | 68.26% |
Thyroid receptor binding | + | 0.6958 | 69.58% |
Glucocorticoid receptor binding | + | 0.7493 | 74.93% |
Aromatase binding | + | 0.6475 | 64.75% |
PPAR gamma | + | 0.7044 | 70.44% |
Honey bee toxicity | - | 0.8494 | 84.94% |
Biodegradation | - | 0.8000 | 80.00% |
Crustacea aquatic toxicity | + | 0.5200 | 52.00% |
Fish aquatic toxicity | + | 0.9124 | 91.24% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293236 | P46063 | ATP-dependent DNA helicase Q1 |
28183.8 nM |
Potency |
via CMAUP
|
CHEMBL2487 | P05067 | Beta amyloid A4 protein |
33000 nM |
IC50 |
PMID: 26719209
|
CHEMBL4822 | P56817 | Beta-secretase 1 |
30000 nM 35000 nM |
IC50 IC50 |
PMID: 14592472
PMID: 14592472 |
CHEMBL2326 | P43166 | Carbonic anhydrase VII |
493.1 nM |
Ki |
via Super-PRED
|
CHEMBL3242 | O43570 | Carbonic anhydrase XII |
32.5 nM |
Ki |
via Super-PRED
|
CHEMBL2392 | P06746 | DNA polymerase beta |
3162.3 nM |
Potency |
via CMAUP
|
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
19952.6 nM |
Potency |
via CMAUP
|
CHEMBL2608 | P10253 | Lysosomal alpha-glucosidase |
3548.1 nM |
Potency |
via CMAUP
|
CHEMBL4040 | P28482 | MAP kinase ERK2 |
31.6 nM |
Potency |
via Super-PRED
|
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
15848.9 nM |
Potency |
via CMAUP
|
CHEMBL1936 | P10721 | Stem cell growth factor receptor |
21900 nM 15700 nM |
IC50 IC50 |
PMID: 26807861
PMID: 26807861 |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.51% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.02% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.37% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.82% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.14% | 99.23% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.12% | 99.15% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 88.44% | 96.12% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.15% | 94.73% |
CHEMBL3194 | P02766 | Transthyretin | 86.06% | 90.71% |
CHEMBL2581 | P07339 | Cathepsin D | 83.85% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.64% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.26% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.91% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.86% | 96.09% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.72% | 93.40% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.