Naringenin
Internal ID | 951d9fb7-bc50-4be3-974d-1da583063cf5 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > Flavanones |
IUPAC Name | (2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one |
SMILES (Canonical) | C1C(OC2=CC(=CC(=C2C1=O)O)O)C3=CC=C(C=C3)O |
SMILES (Isomeric) | C1[C@H](OC2=CC(=CC(=C2C1=O)O)O)C3=CC=C(C=C3)O |
InChI | InChI=1S/C15H12O5/c16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13/h1-6,13,16-18H,7H2/t13-/m0/s1 |
InChI Key | FTVWIRXFELQLPI-ZDUSSCGKSA-N |
Popularity | 2,371 references in papers |
Molecular Formula | C15H12O5 |
Molecular Weight | 272.25 g/mol |
Exact Mass | 272.06847348 g/mol |
Topological Polar Surface Area (TPSA) | 87.00 Ų |
XlogP | 2.40 |
Atomic LogP (AlogP) | 2.51 |
H-Bond Acceptor | 5 |
H-Bond Donor | 3 |
Rotatable Bonds | 1 |
480-41-1 |
Salipurol |
(S)-Naringenin |
(S)-5,7-Dihydroxy-2-(4-hydroxyphenyl)chroman-4-one |
pelargidanon |
naringetol |
(2S)-Naringenin |
salipurpol |
Naringenine |
Asahina |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9450 | 94.50% |
Caco-2 | + | 0.5424 | 54.24% |
Blood Brain Barrier | - | 0.7750 | 77.50% |
Human oral bioavailability | - | 0.7429 | 74.29% |
Subcellular localzation | Mitochondria | 0.7583 | 75.83% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9413 | 94.13% |
OATP1B3 inhibitior | + | 0.9480 | 94.80% |
MATE1 inhibitior | - | 0.9200 | 92.00% |
OCT2 inhibitior | - | 0.9500 | 95.00% |
BSEP inhibitior | - | 0.8076 | 80.76% |
P-glycoprotein inhibitior | - | 0.8953 | 89.53% |
P-glycoprotein substrate | - | 0.9501 | 95.01% |
CYP3A4 substrate | - | 0.5390 | 53.90% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.7429 | 74.29% |
CYP3A4 inhibition | + | 0.8988 | 89.88% |
CYP2C9 inhibition | + | 0.8949 | 89.49% |
CYP2C19 inhibition | + | 0.8994 | 89.94% |
CYP2D6 inhibition | - | 0.7463 | 74.63% |
CYP1A2 inhibition | + | 0.9106 | 91.06% |
CYP2C8 inhibition | - | 0.6645 | 66.45% |
CYP inhibitory promiscuity | + | 0.7121 | 71.21% |
UGT catelyzed | + | 0.9000 | 90.00% |
Carcinogenicity (binary) | - | 0.9600 | 96.00% |
Carcinogenicity (trinary) | Non-required | 0.6152 | 61.52% |
Eye corrosion | - | 0.9920 | 99.20% |
Eye irritation | + | 0.9751 | 97.51% |
Skin irritation | - | 0.5127 | 51.27% |
Skin corrosion | - | 0.9616 | 96.16% |
Ames mutagenesis | - | 0.5254 | 52.54% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.8099 | 80.99% |
Micronuclear | + | 0.8059 | 80.59% |
Hepatotoxicity | - | 0.7500 | 75.00% |
skin sensitisation | - | 0.8697 | 86.97% |
Respiratory toxicity | - | 0.5222 | 52.22% |
Reproductive toxicity | + | 0.8778 | 87.78% |
Mitochondrial toxicity | + | 0.7000 | 70.00% |
Nephrotoxicity | + | 0.6478 | 64.78% |
Acute Oral Toxicity (c) | II | 0.3682 | 36.82% |
Estrogen receptor binding | + | 0.6700 | 67.00% |
Androgen receptor binding | + | 0.7721 | 77.21% |
Thyroid receptor binding | + | 0.6578 | 65.78% |
Glucocorticoid receptor binding | + | 0.7525 | 75.25% |
Aromatase binding | + | 0.7256 | 72.56% |
PPAR gamma | + | 0.7947 | 79.47% |
Honey bee toxicity | - | 0.8458 | 84.58% |
Biodegradation | - | 0.8000 | 80.00% |
Crustacea aquatic toxicity | - | 0.5100 | 51.00% |
Fish aquatic toxicity | + | 0.7714 | 77.14% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1900 | P15121 | Aldose reductase |
28870 nM |
IC50 |
PMID: 22261024
|
CHEMBL3729 | P22748 | Carbonic anhydrase IV |
79.5 nM 79.5 nM |
Ki Ki |
via Super-PRED
PMID: 26498393 |
CHEMBL2326 | P43166 | Carbonic anhydrase VII |
4.3 nM 4.3 nM |
Ki Ki |
via Super-PRED
PMID: 26498393 |
CHEMBL3242 | O43570 | Carbonic anhydrase XII |
44.3 nM 44.3 nM |
Ki Ki |
via Super-PRED
PMID: 26498393 |
CHEMBL5586 | P16152 | Carbonyl reductase [NADPH] 1 |
21480 nM |
IC50 |
PMID: 19097799
|
CHEMBL1978 | P11511 | Cytochrome P450 19A1 |
3300 nM 2.9 nM 1000 nM 1200 nM 1200 nM 230 nM 230 nM 230 nM 2.9 nM |
IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 |
PMID: 24074257
via Super-PRED PMID: 27155469 PMID: 24992702 PMID: 23994869 PMID: 23142320 PMID: 22115839 PMID: 21978950 PMID: 20413308 |
CHEMBL2231 | P04798 | Cytochrome P450 1A1 |
15167 nM |
IC50 |
PMID: 20696580
|
CHEMBL3356 | P05177 | Cytochrome P450 1A2 |
26339 nM |
IC50 |
PMID: 20696580
|
CHEMBL4878 | Q16678 | Cytochrome P450 1B1 |
3656 nM |
IC50 |
PMID: 20696580
|
CHEMBL3622 | P33261 | Cytochrome P450 2C19 |
7943.3 nM 3981.1 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL3397 | P11712 | Cytochrome P450 2C9 |
12589.3 nM |
Potency |
via CMAUP
|
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
5011.9 nM 5011.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV |
240 nM |
IC50 |
via Super-PRED
|
CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
19952.6 nM |
Potency |
via CMAUP
|
CHEMBL3181 | P14061 | Estradiol 17-beta-dehydrogenase 1 |
4960 nM |
IC50 |
PMID: 18533708
|
CHEMBL2789 | P37059 | Estradiol 17-beta-dehydrogenase 2 |
14400 nM |
IC50 |
PMID: 18533708
|
CHEMBL242 | Q92731 | Estrogen receptor beta |
13473 nM |
IC50 |
PMID: 17149865
|
CHEMBL262 | P49841 | Glycogen synthase kinase-3 beta |
45700 nM |
IC50 |
DOI: 10.1007/s00044-012-0353-y
|
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 |
2400 nM 20800 nM |
Ki Ki |
PMID: 19725578
PMID: 11306701 |
CHEMBL3305 | P04278 | Testis-specific androgen-binding protein |
954.99 nM |
Kd |
via Super-PRED
|
CHEMBL1075138 | Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 |
7079.5 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.47% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.91% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.59% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.54% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.09% | 94.45% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.57% | 99.23% |
CHEMBL2581 | P07339 | Cathepsin D | 88.51% | 98.95% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 88.10% | 85.11% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 87.29% | 93.40% |
CHEMBL3194 | P02766 | Transthyretin | 85.59% | 90.71% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 85.57% | 96.12% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.95% | 90.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.27% | 99.15% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.95% | 96.09% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.67% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 439246 |
NPASS | NPC32441 |
ChEMBL | CHEMBL9352 |
LOTUS | LTS0031098 |
wikiData | Q418374 |