Berberine
Internal ID | 250854e2-c8e7-47ec-847b-9ef6516b5319 |
Taxonomy | Alkaloids and derivatives > Protoberberine alkaloids and derivatives |
IUPAC Name | 16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
SMILES (Canonical) | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
SMILES (Isomeric) | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
InChI | InChI=1S/C20H18NO4/c1-22-17-4-3-12-7-16-14-9-19-18(24-11-25-19)8-13(14)5-6-21(16)10-15(12)20(17)23-2/h3-4,7-10H,5-6,11H2,1-2H3/q+1 |
InChI Key | YBHILYKTIRIUTE-UHFFFAOYSA-N |
Popularity | 4,134 references in papers |
Molecular Formula | C20H18NO4+ |
Molecular Weight | 336.40 g/mol |
Exact Mass | 336.12358306 g/mol |
Topological Polar Surface Area (TPSA) | 40.80 Ų |
XlogP | 3.60 |
Atomic LogP (AlogP) | 3.10 |
H-Bond Acceptor | 4 |
H-Bond Donor | 0 |
Rotatable Bonds | 2 |
2086-83-1 |
Umbellatine |
Berberin |
Berbericine |
Majarine |
Thalsine |
Umbellatin |
Berberone |
0I8Y3P32UF |
CHEBI:16118 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.7454 | 74.54% |
Caco-2 | + | 0.9418 | 94.18% |
Blood Brain Barrier | + | 0.5750 | 57.50% |
Human oral bioavailability | - | 0.5143 | 51.43% |
Subcellular localzation | Mitochondria | 0.4894 | 48.94% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9399 | 93.99% |
OATP1B3 inhibitior | + | 0.9458 | 94.58% |
MATE1 inhibitior | - | 0.7800 | 78.00% |
OCT2 inhibitior | - | 0.5348 | 53.48% |
BSEP inhibitior | + | 0.8318 | 83.18% |
P-glycoprotein inhibitior | + | 0.6872 | 68.72% |
P-glycoprotein substrate | - | 0.7450 | 74.50% |
CYP3A4 substrate | + | 0.5449 | 54.49% |
CYP2C9 substrate | - | 0.8153 | 81.53% |
CYP2D6 substrate | - | 0.7038 | 70.38% |
CYP3A4 inhibition | - | 0.5873 | 58.73% |
CYP2C9 inhibition | - | 0.9070 | 90.70% |
CYP2C19 inhibition | - | 0.7463 | 74.63% |
CYP2D6 inhibition | + | 0.8933 | 89.33% |
CYP1A2 inhibition | + | 0.9107 | 91.07% |
CYP2C8 inhibition | - | 0.6066 | 60.66% |
CYP inhibitory promiscuity | + | 0.9003 | 90.03% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9700 | 97.00% |
Carcinogenicity (trinary) | Non-required | 0.4717 | 47.17% |
Eye corrosion | - | 0.9871 | 98.71% |
Eye irritation | - | 0.9157 | 91.57% |
Skin irritation | - | 0.7800 | 78.00% |
Skin corrosion | - | 0.9457 | 94.57% |
Ames mutagenesis | - | 0.7300 | 73.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.7260 | 72.60% |
Micronuclear | + | 0.6300 | 63.00% |
Hepatotoxicity | + | 0.6250 | 62.50% |
skin sensitisation | - | 0.8664 | 86.64% |
Respiratory toxicity | + | 0.5667 | 56.67% |
Reproductive toxicity | + | 0.7667 | 76.67% |
Mitochondrial toxicity | + | 0.7250 | 72.50% |
Nephrotoxicity | - | 0.6482 | 64.82% |
Acute Oral Toxicity (c) | III | 0.6360 | 63.60% |
Estrogen receptor binding | + | 0.9240 | 92.40% |
Androgen receptor binding | + | 0.8697 | 86.97% |
Thyroid receptor binding | + | 0.6855 | 68.55% |
Glucocorticoid receptor binding | + | 0.8556 | 85.56% |
Aromatase binding | - | 0.6449 | 64.49% |
PPAR gamma | + | 0.6935 | 69.35% |
Honey bee toxicity | - | 0.8600 | 86.00% |
Biodegradation | - | 0.9000 | 90.00% |
Crustacea aquatic toxicity | + | 0.6800 | 68.00% |
Fish aquatic toxicity | - | 0.5793 | 57.93% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL220 | P22303 | Acetylcholinesterase |
100 nM 100 nM |
IC50 IC50 |
PMID: 26003344
via Super-PRED |
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
44668.4 nM |
Potency |
via CMAUP
|
CHEMBL1914 | P06276 | Butyrylcholinesterase |
1090 nM |
IC50 |
PMID: 26003344
|
CHEMBL3356 | P05177 | Cytochrome P450 1A2 |
5011.87 nM |
AC50 |
via CMAUP
|
CHEMBL4878 | Q16678 | Cytochrome P450 1B1 |
44 nM |
Ki |
via Super-PRED
|
CHEMBL289 | P10635 | Cytochrome P450 2D6 |
2511.89 nM |
AC50 |
via CMAUP
|
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
12589.3 nM 12589.3 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha |
2511.9 nM 2511.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
12589.3 nM |
Potency |
via CMAUP
|
CHEMBL1293232 | Q16637 | Survival motor neuron protein |
7079.5 nM |
Potency |
via CMAUP
|
CHEMBL2916 | O14746 | Telomerase reverse transcriptase |
37000 nM |
IC50 |
PMID: 22336246
|
CHEMBL1963 | P16473 | Thyroid stimulating hormone receptor |
12589.3 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 97.52% | 96.77% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 93.51% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.47% | 91.11% |
CHEMBL261 | P00915 | Carbonic anhydrase I | 92.69% | 96.76% |
CHEMBL5747 | Q92793 | CREB-binding protein | 92.67% | 95.12% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 92.43% | 91.49% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.55% | 89.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.43% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.88% | 94.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 90.20% | 92.62% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.94% | 93.99% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 88.75% | 94.80% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.27% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.03% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 85.98% | 98.95% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.30% | 95.78% |
CHEMBL2535 | P11166 | Glucose transporter | 85.19% | 98.75% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 85.19% | 82.67% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 85.13% | 94.03% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.86% | 96.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.32% | 100.00% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 82.58% | 92.38% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.97% | 96.09% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 81.93% | 83.82% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.45% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.39% | 99.17% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 80.33% | 90.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 2353 |
NPASS | NPC53069 |
ChEMBL | CHEMBL295124 |
LOTUS | LTS0101484 |
wikiData | Q176525 |