Acteoside;Kusaginin;TJC160
Internal ID | 80efb79f-4b99-444a-8819-1445b31847be |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
IUPAC Name | [6-[2-(3,4-dihydroxyphenyl)ethoxy]-5-hydroxy-2-(hydroxymethyl)-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(OC(C2OC(=O)C=CC3=CC(=C(C=C3)O)O)CO)OCCC4=CC(=C(C=C4)O)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(C(OC(C2OC(=O)C=CC3=CC(=C(C=C3)O)O)CO)OCCC4=CC(=C(C=C4)O)O)O)O)O)O |
InChI | InChI=1S/C29H36O15/c1-13-22(36)23(37)24(38)29(41-13)44-27-25(39)28(40-9-8-15-3-6-17(32)19(34)11-15)42-20(12-30)26(27)43-21(35)7-4-14-2-5-16(31)18(33)10-14/h2-7,10-11,13,20,22-34,36-39H,8-9,12H2,1H3 |
InChI Key | FBSKJMQYURKNSU-UHFFFAOYSA-N |
Popularity | 176 references in papers |
Molecular Formula | C29H36O15 |
Molecular Weight | 624.60 g/mol |
Exact Mass | 624.20542044 g/mol |
Topological Polar Surface Area (TPSA) | 245.00 Ų |
XlogP | -0.50 |
acetoside |
Acteoside;Kusaginin;TJC160 |
22323-52-0 |
HMS3342B07 |
FT-0645088 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.72% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.25% | 86.33% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.58% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.60% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.49% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.96% | 94.73% |
CHEMBL3194 | P02766 | Transthyretin | 92.79% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.61% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 92.28% | 98.95% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.89% | 96.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 91.85% | 86.92% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 87.02% | 97.36% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 86.36% | 80.78% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 83.61% | 96.37% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.15% | 91.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 354009 |
LOTUS | LTS0050472 |
wikiData | Q104665494 |