Amentoflavone
Internal ID | b4a29c1a-a584-49c6-ad58-b4c64f8938c2 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
IUPAC Name | 8-[5-(5,7-dihydroxy-4-oxochromen-2-yl)-2-hydroxyphenyl]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
SMILES (Canonical) | C1=CC(=CC=C1C2=CC(=O)C3=C(O2)C(=C(C=C3O)O)C4=C(C=CC(=C4)C5=CC(=O)C6=C(C=C(C=C6O5)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C2=CC(=O)C3=C(O2)C(=C(C=C3O)O)C4=C(C=CC(=C4)C5=CC(=O)C6=C(C=C(C=C6O5)O)O)O)O |
InChI | InChI=1S/C30H18O10/c31-15-4-1-13(2-5-15)24-12-23(38)29-21(36)10-20(35)27(30(29)40-24)17-7-14(3-6-18(17)33)25-11-22(37)28-19(34)8-16(32)9-26(28)39-25/h1-12,31-36H |
InChI Key | YUSWMAULDXZHPY-UHFFFAOYSA-N |
Popularity | 724 references in papers |
Molecular Formula | C30H18O10 |
Molecular Weight | 538.50 g/mol |
Exact Mass | 538.08999677 g/mol |
Topological Polar Surface Area (TPSA) | 174.00 Ų |
XlogP | 5.00 |
Atomic LogP (AlogP) | 5.13 |
H-Bond Acceptor | 10 |
H-Bond Donor | 6 |
Rotatable Bonds | 3 |
1617-53-4 |
Didemethyl-ginkgetin |
3',8''-Biapigenin |
Amenthoflavone |
Tridemethylsciadopitysin |
UNII-9I1VC79L77 |
MLS000574827 |
CHEBI:2631 |
9I1VC79L77 |
MFCD00017470 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9336 | 93.36% |
Caco-2 | - | 0.8774 | 87.74% |
Blood Brain Barrier | - | 0.8250 | 82.50% |
Human oral bioavailability | - | 0.7714 | 77.14% |
Subcellular localzation | Mitochondria | 0.8010 | 80.10% |
OATP2B1 inhibitior | + | 0.5792 | 57.92% |
OATP1B1 inhibitior | - | 0.3196 | 31.96% |
OATP1B3 inhibitior | - | 0.2208 | 22.08% |
MATE1 inhibitior | + | 0.6600 | 66.00% |
OCT2 inhibitior | - | 0.9500 | 95.00% |
BSEP inhibitior | + | 0.8589 | 85.89% |
P-glycoprotein inhibitior | - | 0.4467 | 44.67% |
P-glycoprotein substrate | - | 0.7248 | 72.48% |
CYP3A4 substrate | + | 0.5925 | 59.25% |
CYP2C9 substrate | - | 0.6443 | 64.43% |
CYP2D6 substrate | - | 0.8503 | 85.03% |
CYP3A4 inhibition | + | 0.6172 | 61.72% |
CYP2C9 inhibition | + | 0.8920 | 89.20% |
CYP2C19 inhibition | + | 0.6827 | 68.27% |
CYP2D6 inhibition | - | 0.9322 | 93.22% |
CYP1A2 inhibition | + | 0.6838 | 68.38% |
CYP2C8 inhibition | + | 0.8800 | 88.00% |
CYP inhibitory promiscuity | + | 0.5157 | 51.57% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 0.9600 | 96.00% |
Carcinogenicity (trinary) | Non-required | 0.7320 | 73.20% |
Eye corrosion | - | 0.9929 | 99.29% |
Eye irritation | - | 0.6819 | 68.19% |
Skin irritation | + | 0.5256 | 52.56% |
Skin corrosion | - | 0.9525 | 95.25% |
Ames mutagenesis | + | 0.5400 | 54.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.3749 | 37.49% |
Micronuclear | + | 0.9200 | 92.00% |
Hepatotoxicity | - | 0.6000 | 60.00% |
skin sensitisation | - | 0.8881 | 88.81% |
Respiratory toxicity | + | 0.5444 | 54.44% |
Reproductive toxicity | + | 0.7000 | 70.00% |
Mitochondrial toxicity | + | 0.5625 | 56.25% |
Nephrotoxicity | - | 0.5927 | 59.27% |
Acute Oral Toxicity (c) | II | 0.6295 | 62.95% |
Estrogen receptor binding | + | 0.8873 | 88.73% |
Androgen receptor binding | + | 0.9422 | 94.22% |
Thyroid receptor binding | + | 0.6141 | 61.41% |
Glucocorticoid receptor binding | + | 0.7881 | 78.81% |
Aromatase binding | + | 0.6084 | 60.84% |
PPAR gamma | + | 0.8430 | 84.30% |
Honey bee toxicity | - | 0.7521 | 75.21% |
Biodegradation | - | 0.9750 | 97.50% |
Crustacea aquatic toxicity | - | 0.5700 | 57.00% |
Fish aquatic toxicity | + | 0.9283 | 92.83% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
14125.4 nM |
Potency |
via CMAUP
|
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
39810.7 nM |
Potency |
via CMAUP
|
CHEMBL4822 | P56817 | Beta-secretase 1 |
1540 nM |
IC50 |
PMID: 20598535
|
CHEMBL236 | P41143 | Delta opioid receptor |
36.5 nM 36 nM |
Ki Ki |
PMID: 20408551
PMID: 17685652 |
CHEMBL234 | P35462 | Dopamine D3 receptor |
1241 nM |
Ki |
PMID: 12824018
|
CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 |
1634.07 nM |
IC50 |
via CMAUP
|
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
14125.4 nM 7079.5 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL3474 | P14555 | Phospholipase A2 group IIA |
23800 nM |
IC50 |
PMID: 16504502
|
CHEMBL3964 | P19174 | Phospholipase C-gamma-1 |
29000 nM |
IC50 |
PMID: 10869194
|
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B |
7400 nM |
IC50 |
PMID: 25907369
|
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor |
2555 nM |
Ki |
PMID: 12824018
|
CHEMBL1075145 | P55072 | Transitional endoplasmic reticulum ATPase |
8984 nM |
IC50 |
via CMAUP
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL242 | Q92731 | Estrogen receptor beta | 99.46% | 98.35% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.06% | 91.11% |
CHEMBL3194 | P02766 | Transthyretin | 97.48% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.61% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.21% | 91.49% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 95.98% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 95.49% | 98.95% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 92.80% | 91.38% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.92% | 94.00% |
CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 90.75% | 91.73% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 89.34% | 96.21% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.24% | 95.56% |
CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 87.63% | 91.76% |
CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 86.78% | 89.23% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 86.18% | 91.71% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.98% | 90.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.92% | 94.73% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.91% | 99.23% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 84.91% | 85.11% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 82.08% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.88% | 86.33% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 81.74% | 83.57% |
CHEMBL2208 | P49137 | MAP kinase-activated protein kinase 2 | 81.54% | 95.20% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.61% | 95.78% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.49% | 97.28% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 5281600 |
NPASS | NPC138299 |
ChEMBL | CHEMBL63354 |
LOTUS | LTS0063796 |
wikiData | Q4742425 |