Nicotinic acid
| Internal ID | 08955281-82cf-4bdb-beb2-9d3a31632219 |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Pyridinecarboxylic acids and derivatives > Pyridinecarboxylic acids |
| IUPAC Name | pyridine-3-carboxylic acid |
| SMILES (Canonical) | C1=CC(=CN=C1)C(=O)O |
| SMILES (Isomeric) | C1=CC(=CN=C1)C(=O)O |
| InChI | InChI=1S/C6H5NO2/c8-6(9)5-2-1-3-7-4-5/h1-4H,(H,8,9) |
| InChI Key | PVNIIMVLHYAWGP-UHFFFAOYSA-N |
| Popularity | 43,623 references in papers |
| Molecular Formula | C6H5NO2 |
| Molecular Weight | 123.11 g/mol |
| Exact Mass | 123.032028402 g/mol |
| Topological Polar Surface Area (TPSA) | 50.20 Ų |
| XlogP | 0.40 |
| Atomic LogP (AlogP) | 0.78 |
| H-Bond Acceptor | 2 |
| H-Bond Donor | 1 |
| Rotatable Bonds | 1 |
| niacin |
| 59-67-6 |
| Pyridine-3-carboxylic acid |
| 3-pyridinecarboxylic acid |
| 3-Carboxypyridine |
| wampocap |
| vitamin B3 |
| Niaspan |
| Acidum nicotinicum |
| nicolar |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9912 | 99.12% |
| Caco-2 | + | 0.8200 | 82.00% |
| Blood Brain Barrier | + | 0.7750 | 77.50% |
| Human oral bioavailability | + | 0.8857 | 88.57% |
| Subcellular localzation | Mitochondria | 0.8256 | 82.56% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.9788 | 97.88% |
| OATP1B3 inhibitior | + | 0.9673 | 96.73% |
| MATE1 inhibitior | - | 1.0000 | 100.00% |
| OCT2 inhibitior | - | 1.0000 | 100.00% |
| BSEP inhibitior | - | 0.9261 | 92.61% |
| P-glycoprotein inhibitior | - | 0.9904 | 99.04% |
| P-glycoprotein substrate | - | 0.9908 | 99.08% |
| CYP3A4 substrate | - | 0.8757 | 87.57% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.9155 | 91.55% |
| CYP3A4 inhibition | - | 0.9120 | 91.20% |
| CYP2C9 inhibition | - | 0.9070 | 90.70% |
| CYP2C19 inhibition | - | 0.9400 | 94.00% |
| CYP2D6 inhibition | - | 0.9230 | 92.30% |
| CYP1A2 inhibition | - | 0.9045 | 90.45% |
| CYP2C8 inhibition | - | 0.6627 | 66.27% |
| CYP inhibitory promiscuity | - | 0.9875 | 98.75% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.6742 | 67.42% |
| Carcinogenicity (trinary) | Non-required | 0.6790 | 67.90% |
| Eye corrosion | - | 0.8583 | 85.83% |
| Eye irritation | + | 1.0000 | 100.00% |
| Skin irritation | + | 0.9658 | 96.58% |
| Skin corrosion | - | 0.5755 | 57.55% |
| Ames mutagenesis | - | 0.9100 | 91.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.8845 | 88.45% |
| Micronuclear | - | 0.8200 | 82.00% |
| Hepatotoxicity | + | 0.7875 | 78.75% |
| skin sensitisation | - | 0.6613 | 66.13% |
| Respiratory toxicity | + | 0.8889 | 88.89% |
| Reproductive toxicity | - | 0.6778 | 67.78% |
| Mitochondrial toxicity | + | 0.7500 | 75.00% |
| Nephrotoxicity | - | 0.6278 | 62.78% |
| Acute Oral Toxicity (c) | IV | 0.6559 | 65.59% |
| Estrogen receptor binding | - | 0.9673 | 96.73% |
| Androgen receptor binding | - | 0.9755 | 97.55% |
| Thyroid receptor binding | - | 0.8358 | 83.58% |
| Glucocorticoid receptor binding | - | 0.9254 | 92.54% |
| Aromatase binding | - | 0.8582 | 85.82% |
| PPAR gamma | - | 0.8356 | 83.56% |
| Honey bee toxicity | - | 0.9830 | 98.30% |
| Biodegradation | + | 0.9000 | 90.00% |
| Crustacea aquatic toxicity | - | 0.8600 | 86.00% |
| Fish aquatic toxicity | - | 0.8795 | 87.95% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
18029.9 nM |
Potency |
via CMAUP
|
| CHEMBL3785 | Q8TDS4 | Hydroxycarboxylic acid receptor 2 |
140 nM 140 nM 140 nM 140 nM 140 nM 140 nM 140 nM 140 nM 140 nM 8.71 nM |
IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 EC50 |
PMID: 18029181
PMID: 19307116 PMID: 19309152 PMID: 19592242 PMID: 19592242 PMID: 20444602 PMID: 20452209 PMID: 20615702 PMID: 17994679 via Super-PRED |
| CHEMBL2608 | P10253 | Lysosomal alpha-glucosidase |
3548.1 nM 3548.1 nM |
Potency Potency |
via CMAUP
via CMAUP |
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 93.72% | 81.11% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 91.45% | 87.67% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.62% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.91% | 98.75% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 83.19% | 96.47% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.97% | 94.62% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 82.40% | 89.34% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.33% | 99.23% |
| CHEMBL1835 | P24557 | Thromboxane-A synthase | 81.16% | 98.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.