Lanuginosine
Internal ID | 0726fd04-92fc-401b-9548-12636c6b0518 |
Taxonomy | Alkaloids and derivatives > Aporphines |
IUPAC Name | 16-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,9,11,14(19),15,17-octaen-13-one |
SMILES (Canonical) | COC1=CC2=C(C=C1)C3=C4C(=CC5=C3OCO5)C=CN=C4C2=O |
SMILES (Isomeric) | COC1=CC2=C(C=C1)C3=C4C(=CC5=C3OCO5)C=CN=C4C2=O |
InChI | InChI=1S/C18H11NO4/c1-21-10-2-3-11-12(7-10)17(20)16-14-9(4-5-19-16)6-13-18(15(11)14)23-8-22-13/h2-7H,8H2,1H3 |
InChI Key | WLXLLQQGGGHOMA-UHFFFAOYSA-N |
Popularity | 7 references in papers |
Molecular Formula | C18H11NO4 |
Molecular Weight | 305.30 g/mol |
Exact Mass | 305.06880783 g/mol |
Topological Polar Surface Area (TPSA) | 57.60 Ų |
XlogP | 3.40 |
Atomic LogP (AlogP) | 3.18 |
H-Bond Acceptor | 5 |
H-Bond Donor | 0 |
Rotatable Bonds | 1 |
Oxoxylopine |
23740-25-2 |
Oxoxylopin |
L7DSM4NF0P |
CCRIS 3814 |
NSC 137553 |
NSC-137553 |
BRN 0624123 |
8H-Benzo(g)-1,3-benzodioxolo(6,5,4-de)quinolin-8-one, 10-methoxy- |
Noraporphin-7-one, 4,5,6,6a-tetradehydro-9-methoxy-1,2-(methylenedioxy)- |
There are more than 10 synonyms. If you wish to see them all click here. |
![2D Structure of Lanuginosine 2D Structure of Lanuginosine](https://plantaedb.com/storage/docs/compounds/2023/07/lanuginosine.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9935 | 99.35% |
Caco-2 | + | 0.8803 | 88.03% |
Blood Brain Barrier | + | 0.6250 | 62.50% |
Human oral bioavailability | - | 0.5000 | 50.00% |
Subcellular localzation | Mitochondria | 0.6511 | 65.11% |
OATP2B1 inhibitior | - | 0.8567 | 85.67% |
OATP1B1 inhibitior | + | 0.9410 | 94.10% |
OATP1B3 inhibitior | + | 0.9647 | 96.47% |
MATE1 inhibitior | - | 0.8200 | 82.00% |
OCT2 inhibitior | - | 1.0000 | 100.00% |
BSEP inhibitior | + | 0.7290 | 72.90% |
P-glycoprotein inhibitior | - | 0.5551 | 55.51% |
P-glycoprotein substrate | - | 0.8195 | 81.95% |
CYP3A4 substrate | + | 0.5880 | 58.80% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.7812 | 78.12% |
CYP3A4 inhibition | + | 0.9173 | 91.73% |
CYP2C9 inhibition | + | 0.5571 | 55.71% |
CYP2C19 inhibition | + | 0.8011 | 80.11% |
CYP2D6 inhibition | - | 0.5634 | 56.34% |
CYP1A2 inhibition | + | 0.9571 | 95.71% |
CYP2C8 inhibition | + | 0.4670 | 46.70% |
CYP inhibitory promiscuity | + | 0.9186 | 91.86% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9900 | 99.00% |
Carcinogenicity (trinary) | Non-required | 0.5056 | 50.56% |
Eye corrosion | - | 0.9832 | 98.32% |
Eye irritation | - | 0.6097 | 60.97% |
Skin irritation | - | 0.7758 | 77.58% |
Skin corrosion | - | 0.9633 | 96.33% |
Ames mutagenesis | + | 0.9600 | 96.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.3722 | 37.22% |
Micronuclear | + | 0.7374 | 73.74% |
Hepatotoxicity | + | 0.5375 | 53.75% |
skin sensitisation | - | 0.7997 | 79.97% |
Respiratory toxicity | + | 0.6778 | 67.78% |
Reproductive toxicity | + | 0.7667 | 76.67% |
Mitochondrial toxicity | + | 0.5875 | 58.75% |
Nephrotoxicity | + | 0.6885 | 68.85% |
Acute Oral Toxicity (c) | III | 0.7621 | 76.21% |
Estrogen receptor binding | + | 0.9116 | 91.16% |
Androgen receptor binding | + | 0.7709 | 77.09% |
Thyroid receptor binding | + | 0.8257 | 82.57% |
Glucocorticoid receptor binding | + | 0.9050 | 90.50% |
Aromatase binding | + | 0.7502 | 75.02% |
PPAR gamma | + | 0.7719 | 77.19% |
Honey bee toxicity | - | 0.8112 | 81.12% |
Biodegradation | - | 0.8750 | 87.50% |
Crustacea aquatic toxicity | + | 0.5200 | 52.00% |
Fish aquatic toxicity | - | 0.5083 | 50.83% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.50% | 94.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 97.45% | 96.77% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.54% | 91.11% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 93.78% | 96.67% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.63% | 86.33% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 93.22% | 96.09% |
CHEMBL5747 | Q92793 | CREB-binding protein | 92.43% | 95.12% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 90.51% | 82.67% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.44% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.29% | 96.09% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 89.45% | 85.30% |
CHEMBL2581 | P07339 | Cathepsin D | 89.11% | 98.95% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.11% | 96.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 88.74% | 94.80% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.68% | 95.56% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 88.41% | 96.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.79% | 92.62% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 87.41% | 80.96% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.26% | 99.23% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.09% | 90.00% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 86.87% | 94.42% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 86.63% | 93.10% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.41% | 99.15% |
CHEMBL1907 | P15144 | Aminopeptidase N | 85.57% | 93.31% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 85.25% | 91.49% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 83.47% | 97.53% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.47% | 94.73% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.45% | 100.00% |
CHEMBL6175 | Q9H3R0 | Lysine-specific demethylase 4C | 83.05% | 96.69% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 82.52% | 92.51% |
CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 81.62% | 93.24% |
CHEMBL2535 | P11166 | Glucose transporter | 81.60% | 98.75% |
CHEMBL2717 | Q9HCR9 | Phosphodiesterase 11A | 80.42% | 85.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 97622 |
NPASS | NPC22481 |
ChEMBL | CHEMBL389400 |
LOTUS | LTS0271247 |
wikiData | Q27282808 |