n-cis-Feruloyltyramine
Internal ID | 819f3043-44c8-4340-b470-48081da61018 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives |
IUPAC Name | (Z)-3-(4-hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enamide |
SMILES (Canonical) | COC1=C(C=CC(=C1)C=CC(=O)NCCC2=CC=C(C=C2)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)/C=C\C(=O)NCCC2=CC=C(C=C2)O)O |
InChI | InChI=1S/C18H19NO4/c1-23-17-12-14(4-8-16(17)21)5-9-18(22)19-11-10-13-2-6-15(20)7-3-13/h2-9,12,20-21H,10-11H2,1H3,(H,19,22)/b9-5- |
InChI Key | NPNNKDMSXVRADT-UITAMQMPSA-N |
Popularity | 15 references in papers |
Molecular Formula | C18H19NO4 |
Molecular Weight | 313.30 g/mol |
Exact Mass | 313.13140809 g/mol |
Topological Polar Surface Area (TPSA) | 78.80 Ų |
XlogP | 2.10 |
cis-N-Feruloyltyramine |
80510-09-4 |
N-Cis-Feruloyl Tyramine |
(Z)-3-(4-hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enamide |
2-Propenamide, 3-(4-hydroxy-3-methoxyphenyl)-N-(2-(4-hydroxyphenyl)ethyl)-, (2Z)- |
CHEMBL451720 |
SCHEMBL17693085 |
CHEBI:185384 |
DTXSID101313914 |
AKOS025287954 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.66% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.86% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.21% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.03% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 94.73% | 98.95% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.20% | 96.00% |
CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 91.82% | 97.03% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 90.67% | 90.20% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.23% | 90.00% |
CHEMBL2535 | P11166 | Glucose transporter | 90.06% | 98.75% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.47% | 94.45% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.34% | 95.50% |
CHEMBL3194 | P02766 | Transthyretin | 88.02% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.49% | 95.56% |
CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 86.07% | 89.33% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.77% | 96.95% |
CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 85.02% | 96.67% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.61% | 89.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.65% | 90.71% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 81.62% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.12% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 6440659 |
NPASS | NPC35961 |
ChEMBL | CHEMBL451720 |
LOTUS | LTS0255533 |
wikiData | Q104251609 |