Galangin
Internal ID | 6ec8aec2-2f26-49c8-9f67-70898f5c8655 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones > Flavonols |
IUPAC Name | 3,5,7-trihydroxy-2-phenylchromen-4-one |
SMILES (Canonical) | C1=CC=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O |
SMILES (Isomeric) | C1=CC=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O |
InChI | InChI=1S/C15H10O5/c16-9-6-10(17)12-11(7-9)20-15(14(19)13(12)18)8-4-2-1-3-5-8/h1-7,16-17,19H |
InChI Key | VCCRNZQBSJXYJD-UHFFFAOYSA-N |
Popularity | 1,359 references in papers |
Molecular Formula | C15H10O5 |
Molecular Weight | 270.24 g/mol |
Exact Mass | 270.05282342 g/mol |
Topological Polar Surface Area (TPSA) | 87.00 Ų |
XlogP | 2.30 |
Atomic LogP (AlogP) | 2.58 |
H-Bond Acceptor | 5 |
H-Bond Donor | 3 |
Rotatable Bonds | 1 |
548-83-4 |
Norizalpinin |
3,5,7-Trihydroxyflavone |
3,5,7-Trihydroxy-2-phenyl-4H-chromen-4-one |
3,5,7-triOH-Flavone |
4H-1-Benzopyran-4-one, 3,5,7-trihydroxy-2-phenyl- |
3,5,7-Trihydroxy-2-phenyl-4-benzopyrone |
3,5,7-trihydroxy-2-phenylchromen-4-one |
FLAVONE, 3,5,7-TRIHYDROXY- |
NSC-407229 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9499 | 94.99% |
Caco-2 | - | 0.9372 | 93.72% |
Blood Brain Barrier | - | 0.8250 | 82.50% |
Human oral bioavailability | - | 0.5000 | 50.00% |
Subcellular localzation | Mitochondria | 0.6122 | 61.22% |
OATP2B1 inhibitior | - | 0.6673 | 66.73% |
OATP1B1 inhibitior | + | 0.8464 | 84.64% |
OATP1B3 inhibitior | - | 0.5697 | 56.97% |
MATE1 inhibitior | + | 0.6600 | 66.00% |
OCT2 inhibitior | - | 0.9750 | 97.50% |
BSEP inhibitior | - | 0.7046 | 70.46% |
P-glycoprotein inhibitior | - | 0.7356 | 73.56% |
P-glycoprotein substrate | - | 0.8544 | 85.44% |
CYP3A4 substrate | - | 0.5304 | 53.04% |
CYP2C9 substrate | - | 0.6443 | 64.43% |
CYP2D6 substrate | - | 0.8503 | 85.03% |
CYP3A4 inhibition | + | 0.7241 | 72.41% |
CYP2C9 inhibition | + | 0.8948 | 89.48% |
CYP2C19 inhibition | + | 0.6434 | 64.34% |
CYP2D6 inhibition | - | 0.9083 | 90.83% |
CYP1A2 inhibition | + | 0.9108 | 91.08% |
CYP2C8 inhibition | + | 0.9221 | 92.21% |
CYP inhibitory promiscuity | + | 0.7652 | 76.52% |
UGT catelyzed | + | 0.8000 | 80.00% |
Carcinogenicity (binary) | - | 1.0000 | 100.00% |
Carcinogenicity (trinary) | Non-required | 0.6985 | 69.85% |
Eye corrosion | - | 0.9903 | 99.03% |
Eye irritation | + | 0.9645 | 96.45% |
Skin irritation | + | 0.6294 | 62.94% |
Skin corrosion | - | 0.9563 | 95.63% |
Ames mutagenesis | - | 0.7300 | 73.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.8713 | 87.13% |
Micronuclear | + | 0.9400 | 94.00% |
Hepatotoxicity | + | 0.5125 | 51.25% |
skin sensitisation | - | 0.7817 | 78.17% |
Respiratory toxicity | + | 0.5778 | 57.78% |
Reproductive toxicity | + | 0.7667 | 76.67% |
Mitochondrial toxicity | + | 0.5375 | 53.75% |
Nephrotoxicity | - | 0.7141 | 71.41% |
Acute Oral Toxicity (c) | II | 0.6238 | 62.38% |
Estrogen receptor binding | + | 0.9183 | 91.83% |
Androgen receptor binding | + | 0.8207 | 82.07% |
Thyroid receptor binding | + | 0.7095 | 70.95% |
Glucocorticoid receptor binding | + | 0.9156 | 91.56% |
Aromatase binding | + | 0.8891 | 88.91% |
PPAR gamma | + | 0.9367 | 93.67% |
Honey bee toxicity | - | 0.9177 | 91.77% |
Biodegradation | - | 0.8500 | 85.00% |
Crustacea aquatic toxicity | + | 0.5200 | 52.00% |
Fish aquatic toxicity | + | 0.8967 | 89.67% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL220 | P22303 | Acetylcholinesterase |
12 nM |
IC50 |
DOI: 10.1007/s00044-012-0353-y
|
CHEMBL251 | P29274 | Adenosine A2a receptor |
16700 nM 18100 nM |
Ki Ki |
PMID: 9258366
PMID: 9258366 |
CHEMBL256 | P0DMS8 | Adenosine A3 receptor |
3150 nM 3150 nM |
Ki Ki |
PMID: 8691424
PMID: 8576921 |
CHEMBL1914 | P06276 | Butyrylcholinesterase |
6900 nM |
Ki |
PMID: 19879672
|
CHEMBL3729 | P22748 | Carbonic anhydrase IV |
568.3 nM 568.3 nM |
Ki Ki |
via Super-PRED
PMID: 26498393 |
CHEMBL2326 | P43166 | Carbonic anhydrase VII |
24.5 nM 24.5 nM |
Ki Ki |
via Super-PRED
PMID: 26498393 |
CHEMBL3242 | O43570 | Carbonic anhydrase XII |
41.8 nM 41.8 nM |
Ki Ki |
PMID: 26498393
via Super-PRED |
CHEMBL2231 | P04798 | Cytochrome P450 1A1 |
77 nM |
IC50 |
PMID: 20696580
|
CHEMBL3356 | P05177 | Cytochrome P450 1A2 |
40 nM |
IC50 |
PMID: 20696580
|
CHEMBL4878 | Q16678 | Cytochrome P450 1B1 |
25 nM 3 nM |
IC50 IC50 |
PMID: 20696580
via Super-PRED |
CHEMBL3622 | P33261 | Cytochrome P450 2C19 |
3981.1 nM |
Potency |
via CMAUP
|
CHEMBL3397 | P11712 | Cytochrome P450 2C9 |
3162.3 nM |
Potency |
via CMAUP
|
CHEMBL289 | P10635 | Cytochrome P450 2D6 |
19952.6 nM |
Potency |
via CMAUP
|
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
15848.9 nM 15848.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
11220.2 nM 17782.8 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1951 | P21397 | Monoamine oxidase A |
130 nM |
IC50 |
via Super-PRED
|
CHEMBL1929 | P47989 | Xanthine dehydrogenase |
1800 nM |
IC50 |
PMID: 9461655
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.03% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 95.25% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.10% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.06% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.75% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.42% | 99.23% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 88.51% | 95.64% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.03% | 99.15% |
CHEMBL2424 | Q04760 | Glyoxalase I | 85.75% | 91.67% |
CHEMBL3194 | P02766 | Transthyretin | 85.67% | 90.71% |
CHEMBL262 | P49841 | Glycogen synthase kinase-3 beta | 85.40% | 95.72% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.99% | 94.73% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 84.93% | 96.12% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.83% | 94.62% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.37% | 94.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.34% | 95.50% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.60% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 5281616 |
NPASS | NPC187432 |
ChEMBL | CHEMBL309490 |
LOTUS | LTS0210648 |
wikiData | Q2456591 |