Kaempferide
| Internal ID | 542b0d81-55b5-401c-813a-3ebffbe7a19a |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones > Flavonols |
| IUPAC Name | 3,5,7-trihydroxy-2-(4-methoxyphenyl)chromen-4-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H12O6/c1-21-10-4-2-8(3-5-10)16-15(20)14(19)13-11(18)6-9(17)7-12(13)22-16/h2-7,17-18,20H,1H3 |
| InChI Key | SQFSKOYWJBQGKQ-UHFFFAOYSA-N |
| Popularity | 464 references in papers |
| Molecular Formula | C16H12O6 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.06338810 g/mol |
| Topological Polar Surface Area (TPSA) | 96.20 Ų |
| XlogP | 2.20 |
| Atomic LogP (AlogP) | 2.59 |
| H-Bond Acceptor | 6 |
| H-Bond Donor | 3 |
| Rotatable Bonds | 2 |
| 491-54-3 |
| 4'-O-Methylkaempferol |
| 4'-Methylkaempferol |
| Kaempferol 4'-methyl ether |
| 3,5,7-trihydroxy-2-(4-methoxyphenyl)chromen-4-one |
| 4H-1-Benzopyran-4-one, 3,5,7-trihydroxy-2-(4-methoxyphenyl)- |
| NSC-407294 |
| 508XL61MPD |
| CHEBI:6099 |
| 3 5 7-trihydroxy-4'-methoxyflavone |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9524 | 95.24% |
| Caco-2 | - | 0.9372 | 93.72% |
| Blood Brain Barrier | - | 0.8000 | 80.00% |
| Human oral bioavailability | - | 0.5714 | 57.14% |
| Subcellular localzation | Mitochondria | 0.6494 | 64.94% |
| OATP2B1 inhibitior | - | 0.6625 | 66.25% |
| OATP1B1 inhibitior | + | 0.8524 | 85.24% |
| OATP1B3 inhibitior | + | 0.9480 | 94.80% |
| MATE1 inhibitior | + | 0.5400 | 54.00% |
| OCT2 inhibitior | - | 0.9250 | 92.50% |
| BSEP inhibitior | - | 0.5994 | 59.94% |
| P-glycoprotein inhibitior | - | 0.6721 | 67.21% |
| P-glycoprotein substrate | - | 0.7871 | 78.71% |
| CYP3A4 substrate | + | 0.5942 | 59.42% |
| CYP2C9 substrate | - | 0.6401 | 64.01% |
| CYP2D6 substrate | - | 0.8296 | 82.96% |
| CYP3A4 inhibition | + | 0.7348 | 73.48% |
| CYP2C9 inhibition | + | 0.7560 | 75.60% |
| CYP2C19 inhibition | + | 0.8648 | 86.48% |
| CYP2D6 inhibition | - | 0.6993 | 69.93% |
| CYP1A2 inhibition | + | 0.9218 | 92.18% |
| CYP2C8 inhibition | + | 0.9301 | 93.01% |
| CYP inhibitory promiscuity | + | 0.8546 | 85.46% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.9900 | 99.00% |
| Carcinogenicity (trinary) | Non-required | 0.6176 | 61.76% |
| Eye corrosion | - | 0.9767 | 97.67% |
| Eye irritation | + | 0.8647 | 86.47% |
| Skin irritation | - | 0.5841 | 58.41% |
| Skin corrosion | - | 0.9319 | 93.19% |
| Ames mutagenesis | + | 0.6600 | 66.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.7030 | 70.30% |
| Micronuclear | + | 0.9100 | 91.00% |
| Hepatotoxicity | - | 0.6750 | 67.50% |
| skin sensitisation | - | 0.9240 | 92.40% |
| Respiratory toxicity | - | 0.5667 | 56.67% |
| Reproductive toxicity | + | 0.8444 | 84.44% |
| Mitochondrial toxicity | + | 0.6500 | 65.00% |
| Nephrotoxicity | - | 0.7694 | 76.94% |
| Acute Oral Toxicity (c) | III | 0.7362 | 73.62% |
| Estrogen receptor binding | + | 0.9478 | 94.78% |
| Androgen receptor binding | + | 0.9085 | 90.85% |
| Thyroid receptor binding | + | 0.7765 | 77.65% |
| Glucocorticoid receptor binding | + | 0.9378 | 93.78% |
| Aromatase binding | + | 0.9219 | 92.19% |
| PPAR gamma | + | 0.9078 | 90.78% |
| Honey bee toxicity | - | 0.9180 | 91.80% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | + | 0.5100 | 51.00% |
| Fish aquatic toxicity | + | 0.8321 | 83.21% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL2231 | P04798 | Cytochrome P450 1A1 |
300 nM 88 nM |
IC50 IC50 |
PMID: 17544277
PMID: 20696580 |
| CHEMBL3356 | P05177 | Cytochrome P450 1A2 |
509 nM 3000 nM |
IC50 IC50 |
PMID: 20696580
PMID: 17544277 |
| CHEMBL4878 | Q16678 | Cytochrome P450 1B1 |
25 nM 25 nM 6 nM |
IC50 IC50 IC50 |
PMID: 20696580
via Super-PRED PMID: 17544277 |
| CHEMBL1951 | P21397 | Monoamine oxidase A |
190 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.08% | 91.11% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 97.71% | 96.12% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.36% | 94.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.55% | 99.15% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.83% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.81% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.20% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.74% | 89.00% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 89.16% | 95.64% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.49% | 90.00% |
| CHEMBL3194 | P02766 | Transthyretin | 87.94% | 90.71% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.87% | 94.73% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.97% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.44% | 94.45% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.27% | 93.99% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 84.59% | 93.65% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 84.27% | 93.31% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.17% | 99.23% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.54% | 86.92% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 82.42% | 94.42% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.64% | 96.09% |
| CHEMBL5408 | Q9UHD2 | Serine/threonine-protein kinase TBK1 | 81.08% | 90.48% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 80.46% | 81.11% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.22% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 5281666 |
| NPASS | NPC241838 |
| ChEMBL | CHEMBL40919 |
| LOTUS | LTS0143784 |
| wikiData | Q3116775 |