Isorhamnetin 3-robinobioside
Internal ID | 6812fb16-21ca-4ee9-bb5a-419e4e5f0379 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC(=C(C=C5)O)OC)O)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC(=C(C=C5)O)OC)O)O)O)O)O)O |
InChI | InChI=1S/C28H32O16/c1-9-18(32)21(35)23(37)27(41-9)40-8-16-19(33)22(36)24(38)28(43-16)44-26-20(34)17-13(31)6-11(29)7-15(17)42-25(26)10-3-4-12(30)14(5-10)39-2/h3-7,9,16,18-19,21-24,27-33,35-38H,8H2,1-2H3 |
InChI Key | UIDGLYUNOUKLBM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H32O16 |
Molecular Weight | 624.50 g/mol |
Exact Mass | 624.16903493 g/mol |
Topological Polar Surface Area (TPSA) | 255.00 Ų |
XlogP | -1.00 |
Isorhamnetin 3-robinobioside |
i-Rha-gal |
CHEBI:139417 |
HMS3345C01 |
FT-0632510 |
Isorhamnetin-3-O-galactoside-6''-rhamnoside |
B0005-464481 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.25% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.34% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.80% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.58% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 95.92% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.40% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.55% | 99.17% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.30% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.01% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.53% | 95.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 88.31% | 91.49% |
CHEMBL3194 | P02766 | Transthyretin | 87.04% | 90.71% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 85.67% | 95.64% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 85.18% | 97.36% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.25% | 85.14% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 82.73% | 95.78% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.43% | 96.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.11% | 90.00% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 80.16% | 94.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 6223069 |
LOTUS | LTS0035886 |
wikiData | Q105273273 |