Isoboldine
Internal ID | 011372f0-3387-4790-86af-0ab030a79adf |
Taxonomy | Alkaloids and derivatives > Aporphines |
IUPAC Name | (6aS)-2,10-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-1,9-diol |
SMILES (Canonical) | CN1CCC2=CC(=C(C3=C2C1CC4=CC(=C(C=C43)OC)O)O)OC |
SMILES (Isomeric) | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=CC(=C(C=C43)OC)O)O)OC |
InChI | InChI=1S/C19H21NO4/c1-20-5-4-10-8-16(24-3)19(22)18-12-9-15(23-2)14(21)7-11(12)6-13(20)17(10)18/h7-9,13,21-22H,4-6H2,1-3H3/t13-/m0/s1 |
InChI Key | LINHZVMHXABQLB-ZDUSSCGKSA-N |
Popularity | 139 references in papers |
Molecular Formula | C19H21NO4 |
Molecular Weight | 327.40 g/mol |
Exact Mass | 327.14705815 g/mol |
Topological Polar Surface Area (TPSA) | 62.20 Ų |
XlogP | 2.20 |
Atomic LogP (AlogP) | 2.87 |
H-Bond Acceptor | 5 |
H-Bond Donor | 2 |
Rotatable Bonds | 2 |
(+)-Isoboldine |
d-Isoboldine |
Isoteolin |
(S)-Isoboldine |
(S)-(+)-Isoboldine |
UNII-M002E511AJ |
Isoteoline |
Izoteolin |
M002E511AJ |
NSC 113983 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.8085 | 80.85% |
Caco-2 | + | 0.7694 | 76.94% |
Blood Brain Barrier | + | 0.6750 | 67.50% |
Human oral bioavailability | - | 0.6714 | 67.14% |
Subcellular localzation | Mitochondria | 0.5804 | 58.04% |
OATP2B1 inhibitior | - | 0.8504 | 85.04% |
OATP1B1 inhibitior | + | 0.9039 | 90.39% |
OATP1B3 inhibitior | + | 0.9480 | 94.80% |
MATE1 inhibitior | - | 0.8600 | 86.00% |
OCT2 inhibitior | - | 0.5250 | 52.50% |
BSEP inhibitior | + | 0.6012 | 60.12% |
P-glycoprotein inhibitior | - | 0.9056 | 90.56% |
P-glycoprotein substrate | - | 0.6708 | 67.08% |
CYP3A4 substrate | + | 0.6059 | 60.59% |
CYP2C9 substrate | + | 0.7825 | 78.25% |
CYP2D6 substrate | + | 0.8432 | 84.32% |
CYP3A4 inhibition | - | 0.8593 | 85.93% |
CYP2C9 inhibition | - | 0.9081 | 90.81% |
CYP2C19 inhibition | - | 0.8384 | 83.84% |
CYP2D6 inhibition | + | 0.8931 | 89.31% |
CYP1A2 inhibition | + | 0.9378 | 93.78% |
CYP2C8 inhibition | - | 0.7457 | 74.57% |
CYP inhibitory promiscuity | - | 0.9213 | 92.13% |
UGT catelyzed | - | 0.5000 | 50.00% |
Carcinogenicity (binary) | - | 0.9900 | 99.00% |
Carcinogenicity (trinary) | Non-required | 0.7029 | 70.29% |
Eye corrosion | - | 0.9918 | 99.18% |
Eye irritation | - | 0.9307 | 93.07% |
Skin irritation | - | 0.7540 | 75.40% |
Skin corrosion | - | 0.9347 | 93.47% |
Ames mutagenesis | - | 0.6600 | 66.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.3855 | 38.55% |
Micronuclear | - | 0.5100 | 51.00% |
Hepatotoxicity | - | 0.8074 | 80.74% |
skin sensitisation | - | 0.8960 | 89.60% |
Respiratory toxicity | + | 0.8000 | 80.00% |
Reproductive toxicity | + | 0.8667 | 86.67% |
Mitochondrial toxicity | + | 0.6500 | 65.00% |
Nephrotoxicity | - | 0.9076 | 90.76% |
Acute Oral Toxicity (c) | III | 0.7111 | 71.11% |
Estrogen receptor binding | + | 0.6671 | 66.71% |
Androgen receptor binding | - | 0.5636 | 56.36% |
Thyroid receptor binding | + | 0.6431 | 64.31% |
Glucocorticoid receptor binding | + | 0.8184 | 81.84% |
Aromatase binding | + | 0.5403 | 54.03% |
PPAR gamma | + | 0.7281 | 72.81% |
Honey bee toxicity | - | 0.8924 | 89.24% |
Biodegradation | - | 0.9500 | 95.00% |
Crustacea aquatic toxicity | + | 0.6000 | 60.00% |
Fish aquatic toxicity | + | 0.8948 | 89.48% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
35481.3 nM |
Potency |
via CMAUP
|
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
31622.8 nM |
Potency |
via CMAUP
|
CHEMBL1293236 | P46063 | ATP-dependent DNA helicase Q1 |
25118.9 nM |
Potency |
via CMAUP
|
CHEMBL4801 | P29466 | Caspase-1 |
31622.8 nM 31622.8 nM 31622.8 nM |
Potency Potency Potency |
via CMAUP
via CMAUP via CMAUP |
CHEMBL3468 | P55210 | Caspase-7 |
31622.8 nM |
Potency |
via CMAUP
|
CHEMBL4096 | P04637 | Cellular tumor antigen p53 |
31622.8 nM |
Potency |
via CMAUP
|
CHEMBL3622 | P33261 | Cytochrome P450 2C19 |
12589.3 nM |
Potency |
via CMAUP
|
CHEMBL3397 | P11712 | Cytochrome P450 2C9 |
25118.9 nM |
Potency |
via CMAUP
|
CHEMBL289 | P10635 | Cytochrome P450 2D6 |
6309.6 nM |
Potency |
via CMAUP
|
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
19952.6 nM 19952.6 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
31622.8 nM 31622.8 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
28183.8 nM |
Potency |
via CMAUP
|
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
11220.2 nM 14125.4 nM |
Potency Potency |
via CMAUP
via CMAUP |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.20% | 96.09% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 97.53% | 95.62% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 95.61% | 91.00% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 94.98% | 91.79% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.18% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.15% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 93.83% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.35% | 95.56% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.81% | 92.94% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 90.14% | 88.48% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.13% | 85.14% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.04% | 90.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.77% | 95.89% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 88.76% | 91.03% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.97% | 86.33% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.74% | 93.40% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.67% | 89.62% |
CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 85.60% | 95.34% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.44% | 94.00% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 84.09% | 96.86% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 84.04% | 93.03% |
CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 83.49% | 95.70% |
CHEMBL5747 | Q92793 | CREB-binding protein | 82.74% | 95.12% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.21% | 90.71% |
CHEMBL2535 | P11166 | Glucose transporter | 81.00% | 98.75% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 80.72% | 82.38% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.55% | 89.00% |
CHEMBL3474 | P14555 | Phospholipase A2 group IIA | 80.55% | 94.05% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 133323 |
NPASS | NPC212794 |
ChEMBL | CHEMBL462880 |
LOTUS | LTS0035776 |
wikiData | Q15426252 |