Cuminaldehyde
| Internal ID | f94a58ff-7648-4724-b0f9-7b0c9bcc6d66 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Aromatic monoterpenoids |
| IUPAC Name | 4-propan-2-ylbenzaldehyde |
| SMILES (Canonical) | CC(C)C1=CC=C(C=C1)C=O |
| SMILES (Isomeric) | CC(C)C1=CC=C(C=C1)C=O |
| InChI | InChI=1S/C10H12O/c1-8(2)10-5-3-9(7-11)4-6-10/h3-8H,1-2H3 |
| InChI Key | WTWBUQJHJGUZCY-UHFFFAOYSA-N |
| Popularity | 780 references in papers |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.088815002 g/mol |
| Topological Polar Surface Area (TPSA) | 17.10 Ų |
| XlogP | 2.70 |
| cuminaldehyde |
| 122-03-2 |
| cuminic aldehyde |
| cumaldehyde |
| cuminal |
| p-cumic aldehyde |
| Cumic aldehyde |
| Cuminyl aldehyde |
| Benzaldehyde, 4-(1-methylethyl)- |
| p-Isopropylbenzenecarboxaldehyde |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL1973 | P14679 | Tyrosinase |
50000 nM |
IC50 |
PMID: 14741268
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.08% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.43% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.10% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.96% | 94.73% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.64% | 96.00% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 85.33% | 90.24% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.58% | 100.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.57% | 90.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.82% | 91.11% |
| CHEMBL1907588 | P02708 | Acetylcholine receptor; alpha1/beta1/delta/gamma | 80.58% | 98.33% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 80.36% | 85.30% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.26% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 326 |
| NPASS | NPC252067 |
| ChEMBL | CHEMBL161577 |
| LOTUS | LTS0037806 |
| wikiData | Q419952 |