Phlorizin
Internal ID | 6ee8743b-dc88-4869-a56e-42d61933a928 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides |
IUPAC Name | 1-[2,4-dihydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-3-(4-hydroxyphenyl)propan-1-one |
SMILES (Canonical) | C1=CC(=CC=C1CCC(=O)C2=C(C=C(C=C2OC3C(C(C(C(O3)CO)O)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1CCC(=O)C2=C(C=C(C=C2O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)O)O |
InChI | InChI=1S/C21H24O10/c22-9-16-18(27)19(28)20(29)21(31-16)30-15-8-12(24)7-14(26)17(15)13(25)6-3-10-1-4-11(23)5-2-10/h1-2,4-5,7-8,16,18-24,26-29H,3,6,9H2/t16-,18-,19+,20-,21-/m1/s1 |
InChI Key | IOUVKUPGCMBWBT-QNDFHXLGSA-N |
Popularity | 3,234 references in papers |
Molecular Formula | C21H24O10 |
Molecular Weight | 436.40 g/mol |
Exact Mass | 436.13694696 g/mol |
Topological Polar Surface Area (TPSA) | 177.00 Ų |
XlogP | 1.20 |
Atomic LogP (AlogP) | -0.20 |
H-Bond Acceptor | 10 |
H-Bond Donor | 7 |
Rotatable Bonds | 7 |
Phloridzin |
60-81-1 |
Phlorhizin |
Phlorizoside |
Floridzin |
Phlorrhizin |
Phloretin 2'-glucoside |
Phloridzosid |
Phlorrhizen |
Phlorizine |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | - | 0.7510 | 75.10% |
Caco-2 | - | 0.8979 | 89.79% |
Blood Brain Barrier | - | 0.5750 | 57.50% |
Human oral bioavailability | - | 0.8429 | 84.29% |
Subcellular localzation | Mitochondria | 0.7630 | 76.30% |
OATP2B1 inhibitior | - | 0.5582 | 55.82% |
OATP1B1 inhibitior | + | 0.9017 | 90.17% |
OATP1B3 inhibitior | + | 0.9011 | 90.11% |
MATE1 inhibitior | - | 0.9200 | 92.00% |
OCT2 inhibitior | - | 0.8000 | 80.00% |
BSEP inhibitior | + | 0.5619 | 56.19% |
P-glycoprotein inhibitior | - | 0.6035 | 60.35% |
P-glycoprotein substrate | - | 0.8331 | 83.31% |
CYP3A4 substrate | + | 0.5601 | 56.01% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8501 | 85.01% |
CYP3A4 inhibition | - | 0.8751 | 87.51% |
CYP2C9 inhibition | + | 0.5454 | 54.54% |
CYP2C19 inhibition | - | 0.8258 | 82.58% |
CYP2D6 inhibition | - | 0.9235 | 92.35% |
CYP1A2 inhibition | - | 0.9046 | 90.46% |
CYP2C8 inhibition | + | 0.7505 | 75.05% |
CYP inhibitory promiscuity | - | 0.7838 | 78.38% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 0.9500 | 95.00% |
Carcinogenicity (trinary) | Non-required | 0.7465 | 74.65% |
Eye corrosion | - | 0.9922 | 99.22% |
Eye irritation | - | 0.8117 | 81.17% |
Skin irritation | - | 0.8164 | 81.64% |
Skin corrosion | - | 0.9629 | 96.29% |
Ames mutagenesis | - | 0.6100 | 61.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.4454 | 44.54% |
Micronuclear | - | 0.6067 | 60.67% |
Hepatotoxicity | - | 0.8301 | 83.01% |
skin sensitisation | - | 0.8315 | 83.15% |
Respiratory toxicity | - | 0.6667 | 66.67% |
Reproductive toxicity | + | 0.5444 | 54.44% |
Mitochondrial toxicity | - | 0.6125 | 61.25% |
Nephrotoxicity | - | 0.7793 | 77.93% |
Acute Oral Toxicity (c) | III | 0.7398 | 73.98% |
Estrogen receptor binding | + | 0.7219 | 72.19% |
Androgen receptor binding | + | 0.5416 | 54.16% |
Thyroid receptor binding | - | 0.5352 | 53.52% |
Glucocorticoid receptor binding | - | 0.5465 | 54.65% |
Aromatase binding | + | 0.5628 | 56.28% |
PPAR gamma | + | 0.6841 | 68.41% |
Honey bee toxicity | - | 0.7546 | 75.46% |
Biodegradation | - | 0.8000 | 80.00% |
Crustacea aquatic toxicity | - | 0.5855 | 58.55% |
Fish aquatic toxicity | + | 0.6914 | 69.14% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
35481.3 nM |
Potency |
via CMAUP
|
CHEMBL2409 | P34913 | Epoxide hydratase |
41720 nM |
IC50 |
PMID: 24679441
|
CHEMBL1770047 | Q9NY91 | Low affinity sodium-glucose cotransporter |
16 nM 16 nM |
IC50 IC50 |
PMID: 21873071
via Super-PRED |
CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 |
185 nM 190 nM 190 nM 246 nM 210 nM 200 nM |
IC50 IC50 IC50 IC50 IC50 IC50 |
PMID: 22889351
PMID: 22652255 PMID: 21873071 PMID: 20302302 PMID: 19785435 PMID: 17374486 |
CHEMBL3884 | P31639 | Sodium/glucose cotransporter 2 |
100 nM 58.6 nM 38 nM 16.4 nM 16 nM 36 nM 27.8 nM |
IC50 IC50 IC50 IC50 IC50 IC50 IC50 |
PMID: 17374486
PMID: 24556379 PMID: 23062824 PMID: 22889351 PMID: 22652255 PMID: 21398124 PMID: 20302302 |
CHEMBL5707 | Q9HAS3 | Solute carrier family 28 member 3 |
16000 nM |
Ki |
PMID: 19097778
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.22% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.77% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.28% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 91.33% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.90% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.46% | 94.73% |
CHEMBL3194 | P02766 | Transthyretin | 89.02% | 90.71% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 87.08% | 86.92% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.06% | 96.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.53% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.50% | 89.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.39% | 90.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.91% | 95.50% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 85.69% | 85.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.55% | 86.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.66% | 95.89% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 84.45% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.26% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 6072 |
NPASS | NPC259182 |
ChEMBL | CHEMBL245067 |
LOTUS | LTS0207095 |
wikiData | Q105346485 |