5,7-Dimethoxyflavone
| Internal ID | 3958548d-80f2-4449-800e-8bd7b6db3f5c |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 7-O-methylated flavonoids |
| IUPAC Name | 5,7-dimethoxy-2-phenylchromen-4-one |
| SMILES (Canonical) | COC1=CC2=C(C(=C1)OC)C(=O)C=C(O2)C3=CC=CC=C3 |
| SMILES (Isomeric) | COC1=CC2=C(C(=C1)OC)C(=O)C=C(O2)C3=CC=CC=C3 |
| InChI | InChI=1S/C17H14O4/c1-19-12-8-15(20-2)17-13(18)10-14(21-16(17)9-12)11-6-4-3-5-7-11/h3-10H,1-2H3 |
| InChI Key | JRFZSUMZAUHNSL-UHFFFAOYSA-N |
| Popularity | 137 references in papers |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.08920892 g/mol |
| Topological Polar Surface Area (TPSA) | 44.80 Ų |
| XlogP | 2.20 |
| 21392-57-4 |
| Chrysin dimethyl ether |
| Chrysin dimethylether |
| Chrysin 5,7-dimethyl ether |
| Dimethylchrysin |
| 5,7-Dimethoxy-2-phenyl-4H-chromen-4-one |
| 5,7-dimethoxy-2-phenylchromen-4-one |
| Chrysin DME |
| 5,7-Dimethoxy-2-phenyl-chromen-4-one |
| Chrysin-Dimethylether |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
28183.8 nM |
Potency |
via CMAUP
|
| CHEMBL5393 | Q9UNQ0 | ATP-binding cassette sub-family G member 2 |
11000 nM 9200 nM |
IC50 IC50 |
PMID: 21354800
PMID: 21354800 |
| CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
25118.9 nM |
Potency |
via CMAUP
|
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein |
2238.7 nM |
Potency |
via CMAUP
|
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A |
1778.3 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.50% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.43% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.79% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.28% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.94% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.84% | 98.95% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.34% | 93.99% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.62% | 95.50% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 85.80% | 93.31% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.09% | 97.14% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 84.54% | 92.08% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.95% | 89.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.36% | 96.00% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 82.31% | 94.03% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.23% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 88881 |
| NPASS | NPC278556 |
| ChEMBL | CHEMBL275391 |
| LOTUS | LTS0096902 |
| wikiData | Q27106162 |