4-Hydroxy-3-methoxycinnamaldehyde
| Internal ID | 856770d2-a408-4e17-b8ff-b1a48005f6d8 |
| Taxonomy | Benzenoids > Phenols > Methoxyphenols |
| IUPAC Name | (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enal |
| SMILES (Canonical) | COC1=C(C=CC(=C1)C=CC=O)O |
| SMILES (Isomeric) | COC1=C(C=CC(=C1)/C=C/C=O)O |
| InChI | InChI=1S/C10H10O3/c1-13-10-7-8(3-2-6-11)4-5-9(10)12/h2-7,12H,1H3/b3-2+ |
| InChI Key | DKZBBWMURDFHNE-NSCUHMNNSA-N |
| Popularity | 992 references in papers |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.062994177 g/mol |
| Topological Polar Surface Area (TPSA) | 46.50 Ų |
| XlogP | 1.50 |
| Coniferyl aldehyde |
| 4-HYDROXY-3-METHOXYCINNAMALDEHYDE |
| 458-36-6 |
| 20649-42-7 |
| Ferulaldehyde |
| Ferulyl aldehyde |
| 3-(4-Hydroxy-3-methoxyphenyl)acrylaldehyde |
| coniferylaldehyde |
| p-Coniferaldehyde |
| (E)-Ferulaldehyde |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.63% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.18% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.99% | 96.00% |
| CHEMBL3194 | P02766 | Transthyretin | 93.87% | 90.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.49% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.50% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.10% | 90.00% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 87.11% | 98.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 84.78% | 91.49% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 83.72% | 90.24% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.42% | 89.62% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.30% | 99.17% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 83.03% | 80.78% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.91% | 94.73% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.54% | 99.15% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.89% | 98.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.22% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 5280536 |
| NPASS | NPC39793 |
| ChEMBL | CHEMBL242529 |
| LOTUS | LTS0009773 |
| wikiData | Q53858035 |