Arachidonic Acid
| Internal ID | 28547294-72d5-404e-8891-7a0faec295e1 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acids and conjugates > Long-chain fatty acids |
| IUPAC Name | (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C20H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-19H2,1H3,(H,21,22)/b7-6-,10-9-,13-12-,16-15- |
| InChI Key | YZXBAPSDXZZRGB-DOFZRALJSA-N |
| Popularity | 54,705 references in papers |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.240230259 g/mol |
| Topological Polar Surface Area (TPSA) | 37.30 Ų |
| XlogP | 6.30 |
| Atomic LogP (AlogP) | 6.22 |
| H-Bond Acceptor | 1 |
| H-Bond Donor | 1 |
| Rotatable Bonds | 14 |
| 506-32-1 |
| (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoic acid |
| (all-Z)-5,8,11,14-Eicosatetraenoic acid |
| cis-5,8,11,14-Eicosatetraenoic acid |
| 5Z,8Z,11Z,14Z-eicosatetraenoic acid |
| 5,8,11,14-Eicosatetraenoic acid, (all-Z)- |
| all-cis-5,8,11,14-eicosatetraenoic acid |
| 27YG812J1I |
| C20:4 |
| DTXSID4040420 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9947 | 99.47% |
| Caco-2 | + | 0.5561 | 55.61% |
| Blood Brain Barrier | + | 0.8250 | 82.50% |
| Human oral bioavailability | + | 0.5429 | 54.29% |
| Subcellular localzation | Plasma membrane | 0.5465 | 54.65% |
| OATP2B1 inhibitior | - | 0.8539 | 85.39% |
| OATP1B1 inhibitior | - | 0.7739 | 77.39% |
| OATP1B3 inhibitior | - | 0.5698 | 56.98% |
| MATE1 inhibitior | - | 0.9600 | 96.00% |
| OCT2 inhibitior | - | 0.9000 | 90.00% |
| BSEP inhibitior | + | 0.6943 | 69.43% |
| P-glycoprotein inhibitior | - | 0.6917 | 69.17% |
| P-glycoprotein substrate | - | 0.9609 | 96.09% |
| CYP3A4 substrate | - | 0.6718 | 67.18% |
| CYP2C9 substrate | + | 0.6276 | 62.76% |
| CYP2D6 substrate | - | 0.8766 | 87.66% |
| CYP3A4 inhibition | - | 0.9295 | 92.95% |
| CYP2C9 inhibition | - | 0.8972 | 89.72% |
| CYP2C19 inhibition | - | 0.9467 | 94.67% |
| CYP2D6 inhibition | - | 0.9545 | 95.45% |
| CYP1A2 inhibition | + | 0.9107 | 91.07% |
| CYP2C8 inhibition | - | 0.8993 | 89.93% |
| CYP inhibitory promiscuity | - | 0.9349 | 93.49% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.7035 | 70.35% |
| Carcinogenicity (trinary) | Non-required | 0.7021 | 70.21% |
| Eye corrosion | + | 0.9611 | 96.11% |
| Eye irritation | + | 0.6907 | 69.07% |
| Skin irritation | + | 0.8622 | 86.22% |
| Skin corrosion | + | 0.6450 | 64.50% |
| Ames mutagenesis | - | 0.8800 | 88.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.4166 | 41.66% |
| Micronuclear | - | 1.0000 | 100.00% |
| Hepatotoxicity | - | 0.6301 | 63.01% |
| skin sensitisation | + | 0.8676 | 86.76% |
| Respiratory toxicity | - | 0.5667 | 56.67% |
| Reproductive toxicity | - | 0.7866 | 78.66% |
| Mitochondrial toxicity | + | 0.5625 | 56.25% |
| Nephrotoxicity | - | 0.7683 | 76.83% |
| Acute Oral Toxicity (c) | IV | 0.8289 | 82.89% |
| Estrogen receptor binding | + | 0.6731 | 67.31% |
| Androgen receptor binding | - | 0.8729 | 87.29% |
| Thyroid receptor binding | + | 0.6278 | 62.78% |
| Glucocorticoid receptor binding | + | 0.6112 | 61.12% |
| Aromatase binding | - | 0.6084 | 60.84% |
| PPAR gamma | + | 0.8968 | 89.68% |
| Honey bee toxicity | - | 0.9963 | 99.63% |
| Biodegradation | + | 0.5250 | 52.50% |
| Crustacea aquatic toxicity | + | 0.6400 | 64.00% |
| Fish aquatic toxicity | + | 0.9649 | 96.49% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
19952.6 nM 15848.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
2818.4 nM 7943.3 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL2903 | P16050 | Arachidonate 15-lipoxygenase |
79.4 nM 316.2 nM 79.4 nM |
Potency Potency Potency |
via Super-PRED
via CMAUP via CMAUP |
| CHEMBL1293236 | P46063 | ATP-dependent DNA helicase Q1 |
44668.4 nM 2238.7 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL1293237 | P54132 | Bloom syndrome protein |
25118.9 nM |
Potency |
via CMAUP
|
| CHEMBL4801 | P29466 | Caspase-1 |
31622.8 nM |
Potency |
via CMAUP
|
| CHEMBL4096 | P04637 | Cellular tumor antigen p53 |
31622.8 nM |
Potency |
via CMAUP
|
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 |
28200 nM |
IC50 |
PMID: 16643058
|
| CHEMBL340 | P08684 | Cytochrome P450 3A4 |
7943.3 nM 39810.7 nM 7943.3 nM 39810.7 nM |
Potency Potency Potency Potency |
via CMAUP
via CMAUP via CMAUP via CMAUP |
| CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
1995.3 nM 3981.1 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL1287622 | Q9Y468 | Lethal(3)malignant brain tumor-like protein 1 |
39810.7 nM |
Potency |
via CMAUP
|
| CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
25118.9 nM 28183.8 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
14125.4 nM 12589.3 nM 10000 nM |
Potency Potency Potency |
via CMAUP
via CMAUP via CMAUP |
| CHEMBL239 | Q07869 | Peroxisome proliferator-activated receptor alpha |
1200 nM 1200 nM |
IC50 IC50 |
DOI: 10.1007/s00044-012-0285-6
DOI: 10.1007/s00044-008-9102-7 |
| CHEMBL3979 | Q03181 | Peroxisome proliferator-activated receptor delta |
3100 nM |
IC50 |
DOI: 10.1007/s00044-012-0285-6
|
| CHEMBL235 | P37231 | Peroxisome proliferator-activated receptor gamma |
1600 nM |
IC50 |
DOI: 10.1007/s00044-012-0285-6
|
| CHEMBL1293235 | P02545 | Prelamin-A/C |
15848.9 nM |
Potency |
via CMAUP
|
| CHEMBL1697668 | Q9Y6L6 | Solute carrier organic anion transporter family member 1B1 |
602.56 nM |
IC50 |
PMID: 23571415
|
| CHEMBL1743121 | Q9NPD5 | Solute carrier organic anion transporter family member 1B3 |
1071.52 nM |
IC50 |
PMID: 23571415
|
| CHEMBL1075138 | Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 |
17782.8 nM |
Potency |
via CMAUP
|
| CHEMBL1293227 | O75604 | Ubiquitin carboxyl-terminal hydrolase 2 |
3162.3 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.94% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.77% | 98.95% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 93.41% | 97.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.44% | 96.09% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 92.05% | 89.63% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 91.97% | 92.08% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.59% | 90.17% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.87% | 96.95% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.54% | 93.56% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 80.44% | 85.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 444899 |
| NPASS | NPC91495 |
| ChEMBL | CHEMBL15594 |
| LOTUS | LTS0241153 |
| wikiData | Q407699 |