Methylumbelliferone
| Internal ID | 0f749083-6c3b-401d-bf54-974725dcb432 |
| Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives |
| IUPAC Name | 7-methoxychromen-2-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C10H8O3/c1-12-8-4-2-7-3-5-10(11)13-9(7)6-8/h2-6H,1H3 |
| InChI Key | LIIALPBMIOVAHH-UHFFFAOYSA-N |
| Popularity | 681 references in papers |
| Molecular Formula | C10H8O3 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.047344113 g/mol |
| Topological Polar Surface Area (TPSA) | 35.50 Ų |
| XlogP | 1.90 |
| Atomic LogP (AlogP) | 1.80 |
| H-Bond Acceptor | 3 |
| H-Bond Donor | 0 |
| Rotatable Bonds | 1 |
| Herniarin |
| 531-59-9 |
| 7-Methoxy-2H-chromen-2-one |
| Ayapanin |
| Methylumbelliferone |
| 7-methoxychromen-2-one |
| Herniarine |
| 7-Methoxy-2H-1-benzopyran-2-one |
| 2H-1-BENZOPYRAN-2-ONE, 7-METHOXY- |
| CHEBI:5679 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9956 | 99.56% |
| Caco-2 | + | 0.9228 | 92.28% |
| Blood Brain Barrier | - | 0.6250 | 62.50% |
| Human oral bioavailability | + | 0.6429 | 64.29% |
| Subcellular localzation | Mitochondria | 0.6150 | 61.50% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8705 | 87.05% |
| OATP1B3 inhibitior | + | 0.9947 | 99.47% |
| MATE1 inhibitior | - | 0.9200 | 92.00% |
| OCT2 inhibitior | - | 0.9750 | 97.50% |
| BSEP inhibitior | - | 0.7836 | 78.36% |
| P-glycoprotein inhibitior | - | 0.9367 | 93.67% |
| P-glycoprotein substrate | - | 0.9578 | 95.78% |
| CYP3A4 substrate | - | 0.6658 | 66.58% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8151 | 81.51% |
| CYP3A4 inhibition | - | 0.8309 | 83.09% |
| CYP2C9 inhibition | + | 0.5000 | 50.00% |
| CYP2C19 inhibition | + | 0.7471 | 74.71% |
| CYP2D6 inhibition | - | 0.8988 | 89.88% |
| CYP1A2 inhibition | + | 0.9923 | 99.23% |
| CYP2C8 inhibition | - | 0.9259 | 92.59% |
| CYP inhibitory promiscuity | - | 0.5348 | 53.48% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.9313 | 93.13% |
| Carcinogenicity (trinary) | Warning | 0.4614 | 46.14% |
| Eye corrosion | + | 0.5202 | 52.02% |
| Eye irritation | + | 0.9882 | 98.82% |
| Skin irritation | + | 0.5362 | 53.62% |
| Skin corrosion | - | 0.9842 | 98.42% |
| Ames mutagenesis | - | 0.6800 | 68.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.6635 | 66.35% |
| Micronuclear | + | 0.7800 | 78.00% |
| Hepatotoxicity | - | 0.6475 | 64.75% |
| skin sensitisation | - | 0.9244 | 92.44% |
| Respiratory toxicity | - | 0.7444 | 74.44% |
| Reproductive toxicity | + | 0.6889 | 68.89% |
| Mitochondrial toxicity | - | 0.6250 | 62.50% |
| Nephrotoxicity | - | 0.5625 | 56.25% |
| Acute Oral Toxicity (c) | III | 0.8038 | 80.38% |
| Estrogen receptor binding | - | 0.6195 | 61.95% |
| Androgen receptor binding | + | 0.7896 | 78.96% |
| Thyroid receptor binding | - | 0.7919 | 79.19% |
| Glucocorticoid receptor binding | + | 0.5516 | 55.16% |
| Aromatase binding | + | 0.7359 | 73.59% |
| PPAR gamma | - | 0.5914 | 59.14% |
| Honey bee toxicity | - | 0.9313 | 93.13% |
| Biodegradation | - | 0.5250 | 52.50% |
| Crustacea aquatic toxicity | + | 0.5700 | 57.00% |
| Fish aquatic toxicity | + | 0.8334 | 83.34% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
31622.8 nM 28183.8 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
28183.8 nM 31622.8 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL261 | P00915 | Carbonic anhydrase I |
5900 nM |
Ki |
PMID: 19911821
|
| CHEMBL3729 | P22748 | Carbonic anhydrase IV |
8300 nM |
Ki |
PMID: 19911821
|
| CHEMBL3594 | Q16790 | Carbonic anhydrase IX |
9800 nM |
Ki |
PMID: 19911821
|
| CHEMBL4789 | P35218 | Carbonic anhydrase VA |
5100 nM |
Ki |
PMID: 19911821
|
| CHEMBL3025 | P23280 | Carbonic anhydrase VI |
5500 nM |
Ki |
PMID: 19911821
|
| CHEMBL2326 | P43166 | Carbonic anhydrase VII |
2400 nM |
Ki |
PMID: 19911821
|
| CHEMBL3242 | O43570 | Carbonic anhydrase XII |
9700 nM |
Ki |
PMID: 19911821
|
| CHEMBL3510 | Q9ULX7 | Carbonic anhydrase XIV |
9000 nM |
Ki |
PMID: 19911821
|
| CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
25118.9 nM |
Potency |
via CMAUP
|
| CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
31622.8 nM 28183.8 nM |
Potency Potency |
via CMAUP
via CMAUP |
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.47% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.31% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.41% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.07% | 98.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.25% | 90.00% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 86.00% | 85.30% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 83.83% | 92.51% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.80% | 94.73% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 82.52% | 93.31% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.76% | 99.23% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.14% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 10748 |
| NPASS | NPC265547 |
| ChEMBL | CHEMBL49732 |
| LOTUS | LTS0005886 |
| wikiData | Q3408685 |