Procyanidin trimer T2
Internal ID | 348194c3-ec53-4a5f-aae3-d8204e7806c1 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-8-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-4-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-8-yl]-3,4-dihydro-2H-chromene-3,5,7-triol |
SMILES (Canonical) | C1C(C(OC2=C1C(=CC(=C2C3C(C(OC4=C(C(=CC(=C34)O)O)C5C(C(OC6=CC(=CC(=C56)O)O)C7=CC(=C(C=C7)O)O)O)C8=CC(=C(C=C8)O)O)O)O)O)C9=CC(=C(C=C9)O)O)O |
SMILES (Isomeric) | C1C(C(OC2=C1C(=CC(=C2C3C(C(OC4=C(C(=CC(=C34)O)O)C5C(C(OC6=CC(=CC(=C56)O)O)C7=CC(=C(C=C7)O)O)O)C8=CC(=C(C=C8)O)O)O)O)O)C9=CC(=C(C=C9)O)O)O |
InChI | InChI=1S/C45H38O18/c46-18-10-27(54)33-32(11-18)61-42(16-2-5-21(48)25(52)8-16)39(59)37(33)35-29(56)14-30(57)36-38(40(60)43(63-45(35)36)17-3-6-22(49)26(53)9-17)34-28(55)13-23(50)19-12-31(58)41(62-44(19)34)15-1-4-20(47)24(51)7-15/h1-11,13-14,31,37-43,46-60H,12H2 |
InChI Key | MOJZMWJRUKIQGL-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C45H38O18 |
Molecular Weight | 866.80 g/mol |
Exact Mass | 866.20581436 g/mol |
Topological Polar Surface Area (TPSA) | 331.00 Ų |
XlogP | 3.30 |
Procyanidin trimer T2 |
SCHEMBL1700872 |
SCHEMBL9999841 |
CHEBI:181036 |
DTXSID401341558 |
AKOS037514799 |
FT-0775636 |
2-(3,4-dihydroxyphenyl)-8-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-4-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-8-yl]-3,4-dihydro-2H-chromene-3,5,7-triol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.52% | 91.11% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.15% | 83.82% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.88% | 91.49% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.80% | 96.09% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 93.59% | 96.12% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.66% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.86% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.73% | 99.15% |
CHEMBL2535 | P11166 | Glucose transporter | 86.62% | 98.75% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.17% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.92% | 90.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.40% | 94.73% |
CHEMBL3194 | P02766 | Transthyretin | 83.39% | 90.71% |
CHEMBL236 | P41143 | Delta opioid receptor | 82.54% | 99.35% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.46% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 13751990 |
LOTUS | LTS0226053 |
wikiData | Q105168956 |