24-Hydroxyursolic Acid
Internal ID | c0bd16d4-54c0-46c0-b760-22a8a49e9ce3 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (1S,2R,4aS,6aR,6aS,6bR,8aR,9S,10S,12aR,14bS)-10-hydroxy-9-(hydroxymethyl)-1,2,6a,6b,9,12a-hexamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid |
SMILES (Canonical) | CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)CO)O)C)C)C2C1C)C)C(=O)O |
SMILES (Isomeric) | C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H]([C@]5(C)CO)O)C)C)[C@@H]2[C@H]1C)C)C(=O)O |
InChI | InChI=1S/C30H48O4/c1-18-9-14-30(25(33)34)16-15-28(5)20(24(30)19(18)2)7-8-22-26(3)12-11-23(32)27(4,17-31)21(26)10-13-29(22,28)6/h7,18-19,21-24,31-32H,8-17H2,1-6H3,(H,33,34)/t18-,19+,21-,22-,23+,24+,26+,27-,28-,29-,30+/m1/s1 |
InChI Key | NZCULBURCGAPSF-OQCQIIONSA-N |
Popularity | 6 references in papers |
Molecular Formula | C30H48O4 |
Molecular Weight | 472.70 g/mol |
Exact Mass | 472.35526001 g/mol |
Topological Polar Surface Area (TPSA) | 77.80 Ų |
XlogP | 6.70 |
CHEMBL522373 |
D0D4SI |
BDBM50253075 |
PD180260 |
3beta,24-Dihydroxyurs-12-en-28-oic acid |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B |
12800 nM |
IC50 |
PMID: 18798681
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.45% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.43% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.53% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.20% | 91.11% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.58% | 100.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.53% | 90.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.72% | 86.33% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.58% | 93.00% |
CHEMBL2581 | P07339 | Cathepsin D | 81.43% | 98.95% |
CHEMBL5028 | O14672 | ADAM10 | 81.41% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 44568920 |
NPASS | NPC225585 |
ChEMBL | CHEMBL522373 |
LOTUS | LTS0247957 |
wikiData | Q104399948 |