Yangambin
Internal ID | 6e527016-1a66-4c08-babf-2ad8856cb83f |
Taxonomy | Lignans, neolignans and related compounds > Furanoid lignans |
IUPAC Name | (3S,3aR,6S,6aR)-3,6-bis(3,4,5-trimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan |
SMILES (Canonical) | COC1=CC(=CC(=C1OC)OC)C2C3COC(C3CO2)C4=CC(=C(C(=C4)OC)OC)OC |
SMILES (Isomeric) | COC1=CC(=CC(=C1OC)OC)[C@@H]2[C@H]3CO[C@@H]([C@H]3CO2)C4=CC(=C(C(=C4)OC)OC)OC |
InChI | InChI=1S/C24H30O8/c1-25-17-7-13(8-18(26-2)23(17)29-5)21-15-11-32-22(16(15)12-31-21)14-9-19(27-3)24(30-6)20(10-14)28-4/h7-10,15-16,21-22H,11-12H2,1-6H3/t15-,16-,21+,22+/m0/s1 |
InChI Key | HRLFUIXSXUASEX-RZTYQLBFSA-N |
Popularity | 23 references in papers |
Molecular Formula | C24H30O8 |
Molecular Weight | 446.50 g/mol |
Exact Mass | 446.19406791 g/mol |
Topological Polar Surface Area (TPSA) | 73.80 Ų |
XlogP | 2.90 |
13060-14-5 |
Yangabin |
Lirioresinol B, dimethyl- |
O,O-Dimethyllirioresinol B |
(+)-Yangabin |
(+)-Yangambin |
Lirioresinol B dimethyl ether |
( )-Yangabin |
CCRIS 8944 |
Lirioresinol B, O,O-dimethyl- |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL220 | P22303 | Acetylcholinesterase |
616 nM |
IC50 |
via Super-PRED
|
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B |
16820 nM |
IC50 |
PMID: 24224843
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.90% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.80% | 91.11% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 90.81% | 92.98% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.58% | 97.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.84% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.71% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.80% | 97.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.25% | 92.62% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.26% | 94.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.05% | 92.94% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.06% | 99.17% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.03% | 89.62% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 80.84% | 94.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 443028 |
NPASS | NPC54321 |
ChEMBL | CHEMBL454592 |
LOTUS | LTS0082412 |
wikiData | Q27108576 |