Methyl 4-methoxybenzoate
| Internal ID | bc0daaee-36a3-4fd1-abdb-1276a2632037 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Methoxybenzoic acids and derivatives > P-methoxybenzoic acids and derivatives |
| IUPAC Name | methyl 4-methoxybenzoate |
| SMILES (Canonical) | COC1=CC=C(C=C1)C(=O)OC |
| SMILES (Isomeric) | COC1=CC=C(C=C1)C(=O)OC |
| InChI | InChI=1S/C9H10O3/c1-11-8-5-3-7(4-6-8)9(10)12-2/h3-6H,1-2H3 |
| InChI Key | DDIZAANNODHTRB-UHFFFAOYSA-N |
| Popularity | 138 references in papers |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.17 g/mol |
| Exact Mass | 166.062994177 g/mol |
| Topological Polar Surface Area (TPSA) | 35.50 Ų |
| XlogP | 2.30 |
| 121-98-2 |
| Methyl p-anisate |
| Methyl anisate |
| Methyl p-methoxybenzoate |
| Methyl 4-Anisate |
| 4-Methoxybenzoic acid methyl ester |
| Benzoic acid, 4-methoxy-, methyl ester |
| p-Anisic acid, methyl ester |
| p-Methoxybenzoic acid methyl ester |
| p-Anisic acid methyl ester |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL261 | P00915 | Carbonic anhydrase I |
3840 nM |
Ki |
PMID: 21402476
|
| CHEMBL205 | P00918 | Carbonic anhydrase II |
3530 nM |
Ki |
PMID: 21402476
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4208 | P20618 | Proteasome component C5 | 94.70% | 90.00% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 91.28% | 81.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.41% | 96.09% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 90.13% | 87.67% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.79% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.76% | 91.11% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.84% | 90.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.57% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.27% | 86.33% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.45% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 8499 |
| NPASS | NPC220540 |
| ChEMBL | CHEMBL1762668 |
| LOTUS | LTS0113372 |
| wikiData | Q6823933 |