Protopine
Internal ID | 0e40230a-4a36-46cc-8300-2e236ad1a807 |
Taxonomy | Alkaloids and derivatives > Protopine alkaloids |
IUPAC Name | 15-methyl-7,9,19,21-tetraoxa-15-azapentacyclo[15.7.0.04,12.06,10.018,22]tetracosa-1(17),4,6(10),11,18(22),23-hexaen-3-one |
SMILES (Canonical) | CN1CCC2=CC3=C(C=C2C(=O)CC4=C(C1)C5=C(C=C4)OCO5)OCO3 |
SMILES (Isomeric) | CN1CCC2=CC3=C(C=C2C(=O)CC4=C(C1)C5=C(C=C4)OCO5)OCO3 |
InChI | InChI=1S/C20H19NO5/c1-21-5-4-13-7-18-19(25-10-24-18)8-14(13)16(22)6-12-2-3-17-20(15(12)9-21)26-11-23-17/h2-3,7-8H,4-6,9-11H2,1H3 |
InChI Key | GPTFURBXHJWNHR-UHFFFAOYSA-N |
Popularity | 260 references in papers |
Molecular Formula | C20H19NO5 |
Molecular Weight | 353.40 g/mol |
Exact Mass | 353.12632271 g/mol |
Topological Polar Surface Area (TPSA) | 57.20 Ų |
XlogP | 2.80 |
Atomic LogP (AlogP) | 2.56 |
H-Bond Acceptor | 6 |
H-Bond Donor | 0 |
Rotatable Bonds | 0 |
130-86-9 |
Corydinine |
Fumarine |
Biflorine |
Macleyine |
Protopin |
Hypercorine |
7,13a-Secoberbin-13a-one, 7-methyl-2,3:9,10-bis(methylenedioxy)- |
CHEBI:16415 |
HSDB 3527 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9893 | 98.93% |
Caco-2 | + | 0.8102 | 81.02% |
Blood Brain Barrier | + | 0.8000 | 80.00% |
Human oral bioavailability | - | 0.5286 | 52.86% |
Subcellular localzation | Lysosomes | 0.5341 | 53.41% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9274 | 92.74% |
OATP1B3 inhibitior | + | 0.9506 | 95.06% |
MATE1 inhibitior | - | 0.9000 | 90.00% |
OCT2 inhibitior | - | 0.6000 | 60.00% |
BSEP inhibitior | + | 0.8151 | 81.51% |
P-glycoprotein inhibitior | - | 0.4610 | 46.10% |
P-glycoprotein substrate | - | 0.7533 | 75.33% |
CYP3A4 substrate | + | 0.5208 | 52.08% |
CYP2C9 substrate | - | 0.8236 | 82.36% |
CYP2D6 substrate | + | 0.3945 | 39.45% |
CYP3A4 inhibition | - | 0.7379 | 73.79% |
CYP2C9 inhibition | - | 0.9081 | 90.81% |
CYP2C19 inhibition | + | 0.8993 | 89.93% |
CYP2D6 inhibition | + | 0.8931 | 89.31% |
CYP1A2 inhibition | + | 0.9107 | 91.07% |
CYP2C8 inhibition | - | 0.9490 | 94.90% |
CYP inhibitory promiscuity | - | 0.8129 | 81.29% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9000 | 90.00% |
Carcinogenicity (trinary) | Non-required | 0.5416 | 54.16% |
Eye corrosion | - | 0.9885 | 98.85% |
Eye irritation | - | 0.9223 | 92.23% |
Skin irritation | - | 0.7963 | 79.63% |
Skin corrosion | - | 0.9355 | 93.55% |
Ames mutagenesis | - | 0.5500 | 55.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7512 | 75.12% |
Micronuclear | - | 0.5200 | 52.00% |
Hepatotoxicity | - | 0.5125 | 51.25% |
skin sensitisation | - | 0.8427 | 84.27% |
Respiratory toxicity | + | 0.8222 | 82.22% |
Reproductive toxicity | + | 0.8778 | 87.78% |
Mitochondrial toxicity | + | 0.8875 | 88.75% |
Nephrotoxicity | + | 0.4614 | 46.14% |
Acute Oral Toxicity (c) | III | 0.7503 | 75.03% |
Estrogen receptor binding | + | 0.6468 | 64.68% |
Androgen receptor binding | + | 0.6076 | 60.76% |
Thyroid receptor binding | - | 0.7439 | 74.39% |
Glucocorticoid receptor binding | + | 0.5705 | 57.05% |
Aromatase binding | + | 0.5401 | 54.01% |
PPAR gamma | + | 0.6455 | 64.55% |
Honey bee toxicity | - | 0.8632 | 86.32% |
Biodegradation | - | 0.7250 | 72.50% |
Crustacea aquatic toxicity | + | 0.5300 | 53.00% |
Fish aquatic toxicity | + | 0.9089 | 90.89% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3622 | P33261 | Cytochrome P450 2C19 |
10000 nM |
Potency |
via CMAUP
|
CHEMBL289 | P10635 | Cytochrome P450 2D6 |
50.1 nM |
Potency |
via CMAUP
|
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
25118.9 nM 25118.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
31622.8 nM |
Potency |
via CMAUP
|
CHEMBL1963 | P16473 | Thyroid stimulating hormone receptor |
12589.3 nM 12589.3 nM |
Potency Potency |
via CMAUP
via CMAUP |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 99.49% | 96.77% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 98.48% | 93.40% |
CHEMBL2581 | P07339 | Cathepsin D | 97.93% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.49% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.53% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 92.06% | 91.49% |
CHEMBL4208 | P20618 | Proteasome component C5 | 91.58% | 90.00% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 88.43% | 90.95% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 87.93% | 91.00% |
CHEMBL1841 | P06241 | Tyrosine-protein kinase FYN | 87.47% | 81.29% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 86.97% | 94.80% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.56% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.88% | 95.89% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.44% | 91.11% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 82.89% | 82.38% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.52% | 90.71% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 82.36% | 96.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.10% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.71% | 89.00% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.64% | 93.65% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 80.92% | 82.67% |
CHEMBL2535 | P11166 | Glucose transporter | 80.10% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 4970 |
NPASS | NPC308267 |
ChEMBL | CHEMBL453019 |
LOTUS | LTS0080245 |
wikiData | Q390706 |