Oxoglaucine
Internal ID | 7de4cd19-634f-4a58-b3d3-21a06033cf16 |
Taxonomy | Alkaloids and derivatives > Aporphines |
IUPAC Name | 4,5,15,16-tetramethoxy-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-8-one |
SMILES (Canonical) | COC1=C(C2=C3C(=C1)C=CN=C3C(=O)C4=CC(=C(C=C42)OC)OC)OC |
SMILES (Isomeric) | COC1=C(C2=C3C(=C1)C=CN=C3C(=O)C4=CC(=C(C=C42)OC)OC)OC |
InChI | InChI=1S/C20H17NO5/c1-23-13-8-11-12(9-14(13)24-2)19(22)18-16-10(5-6-21-18)7-15(25-3)20(26-4)17(11)16/h5-9H,1-4H3 |
InChI Key | ZYKCETVKVRJFGD-UHFFFAOYSA-N |
Popularity | 33 references in papers |
Molecular Formula | C20H17NO5 |
Molecular Weight | 351.40 g/mol |
Exact Mass | 351.11067264 g/mol |
Topological Polar Surface Area (TPSA) | 66.90 Ų |
XlogP | 3.50 |
Atomic LogP (AlogP) | 3.48 |
H-Bond Acceptor | 6 |
H-Bond Donor | 0 |
Rotatable Bonds | 4 |
5574-24-3 |
O-Methylatheroline |
ATHEROLINE, O-METHYL |
1,2,9,10-Tetramethoxy-7H-dibenzo[de,g]quinolin-7-one |
MLS000574946 |
4,5,15,16-tetramethoxy-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-8-one |
SMR000156317 |
7H-Dibenzo[de,g]quinolin-7-one, 1,2,9,10-tetramethoxy- |
Noraporphin-7-one, 4,5,6,6a-tetradehydro-1,2,9,10-tetramethoxy- |
1,2,9,10-Tetramethoxy-7H-Dibenzo(de,g)quinolin-7-one |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9925 | 99.25% |
Caco-2 | + | 0.8691 | 86.91% |
Blood Brain Barrier | - | 0.5250 | 52.50% |
Human oral bioavailability | + | 0.6143 | 61.43% |
Subcellular localzation | Mitochondria | 0.5927 | 59.27% |
OATP2B1 inhibitior | - | 0.8605 | 86.05% |
OATP1B1 inhibitior | + | 0.9456 | 94.56% |
OATP1B3 inhibitior | + | 0.9788 | 97.88% |
MATE1 inhibitior | - | 0.9000 | 90.00% |
OCT2 inhibitior | - | 0.9750 | 97.50% |
BSEP inhibitior | + | 0.6277 | 62.77% |
P-glycoprotein inhibitior | - | 0.4290 | 42.90% |
P-glycoprotein substrate | - | 0.8287 | 82.87% |
CYP3A4 substrate | + | 0.5423 | 54.23% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.7304 | 73.04% |
CYP3A4 inhibition | + | 0.7897 | 78.97% |
CYP2C9 inhibition | - | 0.9146 | 91.46% |
CYP2C19 inhibition | + | 0.5231 | 52.31% |
CYP2D6 inhibition | - | 0.8268 | 82.68% |
CYP1A2 inhibition | + | 0.9106 | 91.06% |
CYP2C8 inhibition | + | 0.6803 | 68.03% |
CYP inhibitory promiscuity | + | 0.7384 | 73.84% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9610 | 96.10% |
Carcinogenicity (trinary) | Non-required | 0.6235 | 62.35% |
Eye corrosion | - | 0.9912 | 99.12% |
Eye irritation | + | 0.6061 | 60.61% |
Skin irritation | - | 0.8235 | 82.35% |
Skin corrosion | - | 0.9833 | 98.33% |
Ames mutagenesis | + | 0.7800 | 78.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.5121 | 51.21% |
Micronuclear | + | 0.6759 | 67.59% |
Hepatotoxicity | + | 0.7907 | 79.07% |
skin sensitisation | - | 0.9563 | 95.63% |
Respiratory toxicity | - | 0.5444 | 54.44% |
Reproductive toxicity | + | 0.6333 | 63.33% |
Mitochondrial toxicity | + | 0.5125 | 51.25% |
Nephrotoxicity | + | 0.4780 | 47.80% |
Acute Oral Toxicity (c) | II | 0.4618 | 46.18% |
Estrogen receptor binding | + | 0.9261 | 92.61% |
Androgen receptor binding | - | 0.5612 | 56.12% |
Thyroid receptor binding | + | 0.8157 | 81.57% |
Glucocorticoid receptor binding | + | 0.9100 | 91.00% |
Aromatase binding | + | 0.7550 | 75.50% |
PPAR gamma | + | 0.7807 | 78.07% |
Honey bee toxicity | - | 0.8813 | 88.13% |
Biodegradation | - | 0.9250 | 92.50% |
Crustacea aquatic toxicity | + | 0.5400 | 54.00% |
Fish aquatic toxicity | - | 0.4891 | 48.91% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
3162.3 nM 8912.5 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL4801 | P29466 | Caspase-1 |
39810.7 nM |
Potency |
via CMAUP
|
CHEMBL5747 | Q92793 | CREB-binding protein |
158.5 nM 1000 nM 158.5 nM 3162.3 nM |
Potency Potency Potency Potency |
via Super-PRED
via CMAUP via CMAUP via CMAUP |
CHEMBL3622 | P33261 | Cytochrome P450 2C19 |
12589.3 nM |
Potency |
via CMAUP
|
CHEMBL3397 | P11712 | Cytochrome P450 2C9 |
39810.7 nM |
Potency |
via CMAUP
|
CHEMBL289 | P10635 | Cytochrome P450 2D6 |
10000 nM |
Potency |
via CMAUP
|
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
2511.9 nM 2511.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL2392 | P06746 | DNA polymerase beta |
12589.3 nM |
Potency |
via CMAUP
|
CHEMBL1293299 | Q03164 | Histone-lysine N-methyltransferase MLL |
15848.9 nM |
Potency |
via CMAUP
|
CHEMBL5514 | P42858 | Huntingtin |
1778.3 nM |
Potency |
via CMAUP
|
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
15848.9 nM 22387.2 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL4040 | P28482 | MAP kinase ERK2 |
31622.8 nM |
Potency |
via CMAUP
|
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
8912.5 nM 7079.5 nM 6309.6 nM |
Potency Potency Potency |
via CMAUP
via CMAUP via CMAUP |
CHEMBL1293235 | P02545 | Prelamin-A/C |
3548.1 nM |
Potency |
via CMAUP
|
CHEMBL1075138 | Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 |
1000 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.51% | 94.00% |
CHEMBL5014 | O43353 | Serine/threonine-protein kinase RIPK2 | 93.90% | 86.79% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.77% | 86.33% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 92.21% | 96.67% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.62% | 96.00% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 89.29% | 94.03% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.21% | 89.00% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 87.87% | 92.98% |
CHEMBL2535 | P11166 | Glucose transporter | 87.06% | 98.75% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 86.96% | 94.42% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.59% | 94.75% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 85.56% | 92.38% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.42% | 96.09% |
CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 85.23% | 96.47% |
CHEMBL2581 | P07339 | Cathepsin D | 84.49% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.15% | 99.23% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 82.43% | 96.09% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 82.21% | 96.00% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.95% | 100.00% |
CHEMBL2708 | Q16584 | Mitogen-activated protein kinase kinase kinase 11 | 81.76% | 81.14% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.13% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.89% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.70% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 97662 |
NPASS | NPC24019 |
ChEMBL | CHEMBL470881 |
LOTUS | LTS0164098 |
wikiData | Q63396633 |