chrysoplenol D
Internal ID | 6ad404d7-3779-4a33-af8d-affc2923795a |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 7-O-methylated flavonoids |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-3,6,7-trimethoxychromen-4-one |
SMILES (Canonical) | COC1=C(C(=C2C(=C1)OC(=C(C2=O)OC)C3=CC(=C(C=C3)O)O)O)OC |
SMILES (Isomeric) | COC1=C(C(=C2C(=C1)OC(=C(C2=O)OC)C3=CC(=C(C=C3)O)O)O)OC |
InChI | InChI=1S/C18H16O8/c1-23-12-7-11-13(14(21)17(12)24-2)15(22)18(25-3)16(26-11)8-4-5-9(19)10(20)6-8/h4-7,19-21H,1-3H3 |
InChI Key | BYWLLSQTJBXAPV-UHFFFAOYSA-N |
Popularity | 21 references in papers |
Molecular Formula | C18H16O8 |
Molecular Weight | 360.30 g/mol |
Exact Mass | 360.08451746 g/mol |
Topological Polar Surface Area (TPSA) | 115.00 Ų |
XlogP | 2.80 |
14965-20-9 |
Quercetagetin 3,6,7-Trimethyl ether |
CHRYSOSPLENOLD |
Chrysoplenol D |
5,3',4'-Trihydroxy-3,6,7-trimethoxyflavone |
GV8SR5RV6Z |
3,6,7-trimethylquercetagetin |
2-(3,4-dihydroxyphenyl)-5-hydroxy-3,6,7-trimethoxychromen-4-one |
7-METHYLAXILLARIN |
3',4',5-Trihydroxy-3,6,7-trimethoxyflavone |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.00% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.77% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.72% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.35% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.32% | 85.14% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.49% | 99.15% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.49% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 90.26% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.58% | 95.56% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 87.34% | 98.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.30% | 99.17% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 86.45% | 80.78% |
CHEMBL3194 | P02766 | Transthyretin | 84.94% | 90.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.60% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.84% | 94.73% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.42% | 90.71% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 80.39% | 95.64% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.22% | 94.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 5280699 |
NPASS | NPC18772 |
ChEMBL | CHEMBL491366 |
LOTUS | LTS0188255 |
wikiData | Q27102769 |