2-Methylanthraquinone
Internal ID | fd352a60-9320-4e91-a8ab-e1e29f31c0b4 |
Taxonomy | Benzenoids > Anthracenes > Anthraquinones |
IUPAC Name | 2-methylanthracene-9,10-dione |
SMILES (Canonical) | CC1=CC2=C(C=C1)C(=O)C3=CC=CC=C3C2=O |
SMILES (Isomeric) | CC1=CC2=C(C=C1)C(=O)C3=CC=CC=C3C2=O |
InChI | InChI=1S/C15H10O2/c1-9-6-7-12-13(8-9)15(17)11-5-3-2-4-10(11)14(12)16/h2-8H,1H3 |
InChI Key | NJWGQARXZDRHCD-UHFFFAOYSA-N |
Popularity | 224 references in papers |
Molecular Formula | C15H10O2 |
Molecular Weight | 222.24 g/mol |
Exact Mass | 222.068079557 g/mol |
Topological Polar Surface Area (TPSA) | 34.10 Ų |
XlogP | 3.90 |
84-54-8 |
Tectoquinone |
2-methylanthracene-9,10-dione |
2-Methyl anthraquinone |
Techtoquinone |
Tectochinon |
2-Methyl-9,10-anthraquinone |
9,10-Anthracenedione, 2-methyl- |
2-Methylanthra-9,10-quinone |
beta-Methylanthraquinone |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL248 | P08246 | Leukocyte elastase |
39000 nM |
IC50 |
PMID: 1578486
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.26% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.21% | 95.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 93.37% | 91.49% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 92.58% | 92.51% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.17% | 94.73% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 87.24% | 96.67% |
CHEMBL1907 | P15144 | Aminopeptidase N | 85.42% | 93.31% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.84% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.53% | 86.33% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.29% | 93.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 6773 |
NPASS | NPC289883 |
ChEMBL | CHEMBL21745 |
LOTUS | LTS0193690 |
wikiData | Q22984229 |