Xanthyletin
Internal ID | 5b89d849-0ab7-428f-936e-de7a1ce4d94c |
Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives > Pyranocoumarins > Linear pyranocoumarins |
IUPAC Name | 2,2-dimethylpyrano[3,2-g]chromen-8-one |
SMILES (Canonical) | CC1(C=CC2=C(O1)C=C3C(=C2)C=CC(=O)O3)C |
SMILES (Isomeric) | CC1(C=CC2=C(O1)C=C3C(=C2)C=CC(=O)O3)C |
InChI | InChI=1S/C14H12O3/c1-14(2)6-5-10-7-9-3-4-13(15)16-11(9)8-12(10)17-14/h3-8H,1-2H3 |
InChI Key | QOTBQNVNUBKJMS-UHFFFAOYSA-N |
Popularity | 145 references in papers |
Molecular Formula | C14H12O3 |
Molecular Weight | 228.24 g/mol |
Exact Mass | 228.078644241 g/mol |
Topological Polar Surface Area (TPSA) | 35.50 Ų |
XlogP | 2.80 |
Atomic LogP (AlogP) | 2.98 |
H-Bond Acceptor | 3 |
H-Bond Donor | 0 |
Rotatable Bonds | 0 |
553-19-5 |
Xanthyletine |
2,2-dimethylpyrano[3,2-g]chromen-8-one |
Spectrum_000673 |
SpecPlus_000132 |
UNII-3N789LD38N |
CHEMBL303846 |
CHEBI:10073 |
3N789LD38N |
8,8-Dimethyl-8H-pyrano[3,2-g]chromen-2-one |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9965 | 99.65% |
Caco-2 | + | 0.8773 | 87.73% |
Blood Brain Barrier | - | 0.5000 | 50.00% |
Human oral bioavailability | + | 0.5714 | 57.14% |
Subcellular localzation | Mitochondria | 0.7604 | 76.04% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9413 | 94.13% |
OATP1B3 inhibitior | + | 0.9838 | 98.38% |
MATE1 inhibitior | - | 0.9600 | 96.00% |
OCT2 inhibitior | - | 0.9500 | 95.00% |
BSEP inhibitior | - | 0.5119 | 51.19% |
P-glycoprotein inhibitior | - | 0.7533 | 75.33% |
P-glycoprotein substrate | - | 0.7872 | 78.72% |
CYP3A4 substrate | - | 0.5568 | 55.68% |
CYP2C9 substrate | - | 0.6785 | 67.85% |
CYP2D6 substrate | - | 0.8381 | 83.81% |
CYP3A4 inhibition | - | 0.7482 | 74.82% |
CYP2C9 inhibition | + | 0.6123 | 61.23% |
CYP2C19 inhibition | + | 0.6119 | 61.19% |
CYP2D6 inhibition | - | 0.8226 | 82.26% |
CYP1A2 inhibition | + | 0.5346 | 53.46% |
CYP2C8 inhibition | - | 0.7360 | 73.60% |
CYP inhibitory promiscuity | - | 0.5063 | 50.63% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9613 | 96.13% |
Carcinogenicity (trinary) | Non-required | 0.5181 | 51.81% |
Eye corrosion | - | 0.9664 | 96.64% |
Eye irritation | + | 0.7813 | 78.13% |
Skin irritation | - | 0.6029 | 60.29% |
Skin corrosion | - | 0.9578 | 95.78% |
Ames mutagenesis | - | 0.6100 | 61.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7333 | 73.33% |
Micronuclear | + | 0.6259 | 62.59% |
Hepatotoxicity | - | 0.6375 | 63.75% |
skin sensitisation | - | 0.5843 | 58.43% |
Respiratory toxicity | - | 0.5333 | 53.33% |
Reproductive toxicity | + | 0.5444 | 54.44% |
Mitochondrial toxicity | - | 0.5500 | 55.00% |
Nephrotoxicity | + | 0.5122 | 51.22% |
Acute Oral Toxicity (c) | III | 0.5679 | 56.79% |
Estrogen receptor binding | + | 0.9584 | 95.84% |
Androgen receptor binding | + | 0.6246 | 62.46% |
Thyroid receptor binding | + | 0.5453 | 54.53% |
Glucocorticoid receptor binding | + | 0.7284 | 72.84% |
Aromatase binding | + | 0.9090 | 90.90% |
PPAR gamma | + | 0.5580 | 55.80% |
Honey bee toxicity | - | 0.9271 | 92.71% |
Biodegradation | - | 0.8500 | 85.00% |
Crustacea aquatic toxicity | + | 0.5300 | 53.00% |
Fish aquatic toxicity | + | 0.9798 | 97.98% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
28183.8 nM |
Potency |
via CMAUP
|
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
31622.8 nM |
Potency |
via CMAUP
|
CHEMBL261 | P00915 | Carbonic anhydrase I |
21500 nM |
Ki |
PMID: 22892213
|
CHEMBL3594 | Q16790 | Carbonic anhydrase IX |
7510 nM |
Ki |
PMID: 22892213
|
CHEMBL2326 | P43166 | Carbonic anhydrase VII |
9180 nM |
Ki |
PMID: 22892213
|
CHEMBL3242 | O43570 | Carbonic anhydrase XII |
25700 nM |
Ki |
PMID: 22892213
|
CHEMBL3912 | Q8N1Q1 | Carbonic anhydrase XIII |
8360 nM |
Ki |
PMID: 22892213
|
CHEMBL4096 | P04637 | Cellular tumor antigen p53 |
31622.8 nM 10000 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
31622.8 nM |
Potency |
via CMAUP
|
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
28183.8 nM 31622.8 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
44668.4 nM |
Potency |
via CMAUP
|
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein |
3162.3 nM |
Potency |
via CMAUP
|
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A |
5011.9 nM |
Potency |
via CMAUP
|
CHEMBL1293232 | Q16637 | Survival motor neuron protein |
14125.4 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 94.03% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.52% | 91.11% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 93.42% | 85.30% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.94% | 94.45% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.38% | 99.23% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.18% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.08% | 94.73% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.45% | 90.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.38% | 89.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.93% | 90.71% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.45% | 96.77% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 65188 |
NPASS | NPC257188 |
ChEMBL | CHEMBL303846 |
LOTUS | LTS0016674 |
wikiData | Q27108571 |