5-Chloro-7-hydroxy-2-(2-hydroxyethyl)-7-methyl-3-(3-methylpent-1-enyl)isoquinoline-6,8-dione
Internal ID | 9e269e70-4c46-4ec7-9516-940c8726488a |
Taxonomy | Organoheterocyclic compounds > Isoquinolines and derivatives > Isoquinolones and derivatives |
IUPAC Name | 5-chloro-7-hydroxy-2-(2-hydroxyethyl)-7-methyl-3-(3-methylpent-1-enyl)isoquinoline-6,8-dione |
SMILES (Canonical) | CCC(C)C=CC1=CC2=C(C(=O)C(C(=O)C2=CN1CCO)(C)O)Cl |
SMILES (Isomeric) | CCC(C)C=CC1=CC2=C(C(=O)C(C(=O)C2=CN1CCO)(C)O)Cl |
InChI | InChI=1S/C18H22ClNO4/c1-4-11(2)5-6-12-9-13-14(10-20(12)7-8-21)16(22)18(3,24)17(23)15(13)19/h5-6,9-11,21,24H,4,7-8H2,1-3H3 |
InChI Key | UBEZPANUWOHMOG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H22ClNO4 |
Molecular Weight | 351.80 g/mol |
Exact Mass | 351.1237359 g/mol |
Topological Polar Surface Area (TPSA) | 77.80 Ų |
XlogP | 2.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 97.46% | 98.95% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 93.09% | 92.86% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.14% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.31% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.36% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.03% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.56% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.52% | 96.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.96% | 94.45% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.27% | 86.92% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 82.94% | 85.94% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 81.05% | 96.61% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.76% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 78108622 |
LOTUS | LTS0177751 |
wikiData | Q27134233 |