1,2,6-Trigalloyl-beta-D-glucopyranose
Internal ID | 30c232f3-974a-430a-9565-7757f68e16d0 |
Taxonomy | Phenylpropanoids and polyketides > Tannins |
IUPAC Name | [3,4-dihydroxy-5,6-bis[(3,4,5-trihydroxybenzoyl)oxy]oxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1=C(C=C(C(=C1O)O)O)C(=O)OCC2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O)O)O |
SMILES (Isomeric) | C1=C(C=C(C(=C1O)O)O)C(=O)OCC2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O)O)O |
InChI | InChI=1S/C27H24O18/c28-11-1-8(2-12(29)18(11)34)24(39)42-7-17-21(37)22(38)23(44-25(40)9-3-13(30)19(35)14(31)4-9)27(43-17)45-26(41)10-5-15(32)20(36)16(33)6-10/h1-6,17,21-23,27-38H,7H2 |
InChI Key | LLENXGNWVNSBQG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H24O18 |
Molecular Weight | 636.50 g/mol |
Exact Mass | 636.09626391 g/mol |
Topological Polar Surface Area (TPSA) | 311.00 Ų |
XlogP | 0.40 |
beta-D-Glucopyranose, 1,2,6-tris(3,4,5-trihydroxybenzoate) |
1,2,6-Trigalloyl-beta-D-glucopyranose |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.70% | 91.11% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 96.90% | 95.64% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 94.98% | 83.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.58% | 96.09% |
CHEMBL3194 | P02766 | Transthyretin | 91.76% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.63% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.35% | 94.73% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 89.23% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.93% | 86.33% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.44% | 92.50% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 86.17% | 89.34% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.99% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.89% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 83.83% | 98.95% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.94% | 90.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.27% | 96.95% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.02% | 97.21% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 81.71% | 95.17% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 80.33% | 80.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 3357644 |
LOTUS | LTS0063924 |
wikiData | Q105153461 |