p-Hydroxyphenethyl trans-ferulate
Internal ID | e14c56fc-5bfa-4322-94ae-baba260886a9 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
IUPAC Name | 2-(4-hydroxyphenyl)ethyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
SMILES (Canonical) | COC1=C(C=CC(=C1)C=CC(=O)OCCC2=CC=C(C=C2)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)/C=C/C(=O)OCCC2=CC=C(C=C2)O)O |
InChI | InChI=1S/C18H18O5/c1-22-17-12-14(4-8-16(17)20)5-9-18(21)23-11-10-13-2-6-15(19)7-3-13/h2-9,12,19-20H,10-11H2,1H3/b9-5+ |
InChI Key | JMSFLLZUCIXALN-WEVVVXLNSA-N |
Popularity | 18 references in papers |
Molecular Formula | C18H18O5 |
Molecular Weight | 314.30 g/mol |
Exact Mass | 314.11542367 g/mol |
Topological Polar Surface Area (TPSA) | 76.00 Ų |
XlogP | 3.40 |
Atomic LogP (AlogP) | 2.91 |
H-Bond Acceptor | 5 |
H-Bond Donor | 2 |
Rotatable Bonds | 6 |
84873-15-4 |
2-(4-hydroxyphenyl)ethyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
CHEMBL481245 |
Hydroxyphenethylferulate |
D03NBX |
p-Hydroxyphenethyltrans-ferulate |
SCHEMBL12298709 |
4-Hydroxyphenethyl trans-ferulate |
DTXSID10348425 |
CHEBI:175029 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9780 | 97.80% |
Caco-2 | + | 0.5720 | 57.20% |
Blood Brain Barrier | - | 0.5250 | 52.50% |
Human oral bioavailability | - | 0.8286 | 82.86% |
Subcellular localzation | Mitochondria | 0.9192 | 91.92% |
OATP2B1 inhibitior | - | 0.8536 | 85.36% |
OATP1B1 inhibitior | + | 0.9204 | 92.04% |
OATP1B3 inhibitior | + | 0.9475 | 94.75% |
MATE1 inhibitior | - | 0.5600 | 56.00% |
OCT2 inhibitior | - | 0.9250 | 92.50% |
BSEP inhibitior | + | 0.9538 | 95.38% |
P-glycoprotein inhibitior | - | 0.7556 | 75.56% |
P-glycoprotein substrate | - | 0.8183 | 81.83% |
CYP3A4 substrate | + | 0.5290 | 52.90% |
CYP2C9 substrate | - | 0.7914 | 79.14% |
CYP2D6 substrate | - | 0.8167 | 81.67% |
CYP3A4 inhibition | - | 0.7704 | 77.04% |
CYP2C9 inhibition | + | 0.8113 | 81.13% |
CYP2C19 inhibition | + | 0.8019 | 80.19% |
CYP2D6 inhibition | - | 0.8723 | 87.23% |
CYP1A2 inhibition | + | 0.8225 | 82.25% |
CYP2C8 inhibition | + | 0.9192 | 91.92% |
CYP inhibitory promiscuity | + | 0.5342 | 53.42% |
UGT catelyzed | + | 0.9000 | 90.00% |
Carcinogenicity (binary) | - | 0.8071 | 80.71% |
Carcinogenicity (trinary) | Non-required | 0.7150 | 71.50% |
Eye corrosion | - | 0.9878 | 98.78% |
Eye irritation | + | 0.5935 | 59.35% |
Skin irritation | - | 0.8358 | 83.58% |
Skin corrosion | - | 0.9773 | 97.73% |
Ames mutagenesis | - | 0.8900 | 89.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.3744 | 37.44% |
Micronuclear | - | 0.6490 | 64.90% |
Hepatotoxicity | - | 0.7500 | 75.00% |
skin sensitisation | - | 0.8642 | 86.42% |
Respiratory toxicity | - | 0.7778 | 77.78% |
Reproductive toxicity | + | 0.5889 | 58.89% |
Mitochondrial toxicity | - | 0.8125 | 81.25% |
Nephrotoxicity | - | 0.8815 | 88.15% |
Acute Oral Toxicity (c) | III | 0.7550 | 75.50% |
Estrogen receptor binding | + | 0.9364 | 93.64% |
Androgen receptor binding | + | 0.9027 | 90.27% |
Thyroid receptor binding | + | 0.5330 | 53.30% |
Glucocorticoid receptor binding | + | 0.7800 | 78.00% |
Aromatase binding | + | 0.7925 | 79.25% |
PPAR gamma | + | 0.6036 | 60.36% |
Honey bee toxicity | - | 0.8495 | 84.95% |
Biodegradation | - | 0.6500 | 65.00% |
Crustacea aquatic toxicity | - | 0.5300 | 53.00% |
Fish aquatic toxicity | + | 0.9595 | 95.95% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3729 | P22748 | Carbonic anhydrase IV |
44000 nM |
Ki |
PMID: 26498394
|
CHEMBL3594 | Q16790 | Carbonic anhydrase IX |
810 nM 810 nM |
Ki Ki |
via Super-PRED
PMID: 26498394 |
CHEMBL4789 | P35218 | Carbonic anhydrase VA |
810 nM 810 nM |
Ki Ki |
via Super-PRED
PMID: 26498394 |
CHEMBL3969 | Q9Y2D0 | Carbonic anhydrase VB |
670 nM 670 nM |
Ki Ki |
PMID: 26498394
via Super-PRED |
CHEMBL3025 | P23280 | Carbonic anhydrase VI |
770 nM 770 nM |
Ki Ki |
PMID: 26498394
via Super-PRED |
CHEMBL2326 | P43166 | Carbonic anhydrase VII |
620 nM 620 nM |
Ki Ki |
PMID: 26498394
via Super-PRED |
CHEMBL3242 | O43570 | Carbonic anhydrase XII |
8470 nM |
Ki |
PMID: 26498394
|
CHEMBL3510 | Q9ULX7 | Carbonic anhydrase XIV |
720 nM 720 nM |
Ki Ki |
PMID: 26498394
via Super-PRED |
CHEMBL3717 | P08581 | Hepatocyte growth factor receptor |
12900 nM |
IC50 |
PMID: 27258622
|
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor |
47600 nM |
IC50 |
PMID: 16643021
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.80% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.25% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.73% | 91.11% |
CHEMBL3194 | P02766 | Transthyretin | 95.72% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.20% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.81% | 96.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.86% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.32% | 95.56% |
CHEMBL2535 | P11166 | Glucose transporter | 87.25% | 98.75% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.33% | 90.00% |
CHEMBL2581 | P07339 | Cathepsin D | 85.88% | 98.95% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.65% | 96.95% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.10% | 91.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.35% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 637308 |
NPASS | NPC213552 |
ChEMBL | CHEMBL481245 |
LOTUS | LTS0072364 |
wikiData | Q105327828 |