Flavone
Internal ID | db559728-6506-4b81-a5a7-044f4e512c89 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones |
IUPAC Name | 2-phenylchromen-4-one |
SMILES (Canonical) | C1=CC=C(C=C1)C2=CC(=O)C3=CC=CC=C3O2 |
SMILES (Isomeric) | C1=CC=C(C=C1)C2=CC(=O)C3=CC=CC=C3O2 |
InChI | InChI=1S/C15H10O2/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-10H |
InChI Key | VHBFFQKBGNRLFZ-UHFFFAOYSA-N |
Popularity | 13,141 references in papers |
Molecular Formula | C15H10O2 |
Molecular Weight | 222.24 g/mol |
Exact Mass | 222.068079557 g/mol |
Topological Polar Surface Area (TPSA) | 26.30 Ų |
XlogP | 3.60 |
Atomic LogP (AlogP) | 3.46 |
H-Bond Acceptor | 2 |
H-Bond Donor | 0 |
Rotatable Bonds | 1 |
525-82-6 |
2-Phenyl-4H-chromen-4-one |
2-Phenylchromone |
2-Phenyl-4-chromone |
Asmacoril |
2-phenylchromen-4-one |
Chromocor |
Cromaril |
2-Phenyl-4H-1-benzopyran-4-one |
2-Phenyl-4-benzopyron |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 1.0000 | 100.00% |
Caco-2 | + | 0.7413 | 74.13% |
Blood Brain Barrier | - | 0.5250 | 52.50% |
Human oral bioavailability | + | 0.7714 | 77.14% |
Subcellular localzation | Mitochondria | 0.5940 | 59.40% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9548 | 95.48% |
OATP1B3 inhibitior | + | 0.9907 | 99.07% |
MATE1 inhibitior | - | 0.9600 | 96.00% |
OCT2 inhibitior | - | 1.0000 | 100.00% |
BSEP inhibitior | - | 0.4722 | 47.22% |
P-glycoprotein inhibitior | - | 0.7353 | 73.53% |
P-glycoprotein substrate | - | 0.9629 | 96.29% |
CYP3A4 substrate | - | 0.6034 | 60.34% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.7979 | 79.79% |
CYP3A4 inhibition | + | 0.6321 | 63.21% |
CYP2C9 inhibition | - | 0.5201 | 52.01% |
CYP2C19 inhibition | + | 0.8993 | 89.93% |
CYP2D6 inhibition | - | 0.9372 | 93.72% |
CYP1A2 inhibition | + | 0.9644 | 96.44% |
CYP2C8 inhibition | - | 0.7240 | 72.40% |
CYP inhibitory promiscuity | + | 0.5396 | 53.96% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9213 | 92.13% |
Carcinogenicity (trinary) | Warning | 0.4507 | 45.07% |
Eye corrosion | - | 0.9343 | 93.43% |
Eye irritation | + | 0.9299 | 92.99% |
Skin irritation | + | 0.7329 | 73.29% |
Skin corrosion | - | 0.9859 | 98.59% |
Ames mutagenesis | - | 0.5800 | 58.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.7082 | 70.82% |
Micronuclear | + | 0.6959 | 69.59% |
Hepatotoxicity | + | 0.6625 | 66.25% |
skin sensitisation | - | 0.7363 | 73.63% |
Respiratory toxicity | + | 0.6111 | 61.11% |
Reproductive toxicity | + | 0.5667 | 56.67% |
Mitochondrial toxicity | - | 0.8375 | 83.75% |
Nephrotoxicity | - | 0.5791 | 57.91% |
Acute Oral Toxicity (c) | III | 0.5110 | 51.10% |
Estrogen receptor binding | + | 0.8906 | 89.06% |
Androgen receptor binding | + | 0.8695 | 86.95% |
Thyroid receptor binding | + | 0.6251 | 62.51% |
Glucocorticoid receptor binding | + | 0.8581 | 85.81% |
Aromatase binding | + | 0.9532 | 95.32% |
PPAR gamma | + | 0.8530 | 85.30% |
Honey bee toxicity | - | 0.8435 | 84.35% |
Biodegradation | - | 0.8000 | 80.00% |
Crustacea aquatic toxicity | + | 0.6700 | 67.00% |
Fish aquatic toxicity | + | 0.7260 | 72.60% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
8912.5 nM |
Potency |
via CMAUP
|
CHEMBL256 | P0DMS8 | Adenosine A3 receptor |
16900 nM 16900 nM |
Ki Ki |
PMID: 8691424
PMID: 8576921 |
CHEMBL1871 | P10275 | Androgen Receptor |
5900 nM 5900 nM |
IC50 IC50 |
PMID: 19592245
PMID: 19592245 |
CHEMBL5393 | Q9UNQ0 | ATP-binding cassette sub-family G member 2 |
17000 nM 26000 nM |
IC50 IC50 |
PMID: 21354800
PMID: 21354800 |
CHEMBL261 | P00915 | Carbonic anhydrase I |
1880 nM 1890 nM |
Ki Ki |
PMID: 22487176
PMID: 22487176 |
CHEMBL205 | P00918 | Carbonic anhydrase II |
8710 nM 8800 nM |
Ki Ki |
PMID: 22487176
PMID: 22487176 |
CHEMBL3594 | Q16790 | Carbonic anhydrase IX |
4130 nM 4220 nM |
Ki Ki |
PMID: 22487176
PMID: 22487176 |
CHEMBL3242 | O43570 | Carbonic anhydrase XII |
7220 nM 7330 nM |
Ki Ki |
PMID: 22487176
PMID: 22487176 |
CHEMBL4096 | P04637 | Cellular tumor antigen p53 |
5 nM 5 nM |
Potency Potency |
via CMAUP
via Super-PRED |
CHEMBL1978 | P11511 | Cytochrome P450 19A1 |
10000 nM 8000 nM 8 nM |
IC50 IC50 IC50 |
PMID: 24345481
PMID: 26301554 via Super-PRED |
CHEMBL4878 | Q16678 | Cytochrome P450 1B1 |
600 nM |
IC50 |
via Super-PRED
|
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
12589.3 nM 12589.3 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV |
170 nM |
IC50 |
via Super-PRED
|
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein |
5623.4 nM |
Potency |
via CMAUP
|
CHEMBL3105 | P09874 | Poly [ADP-ribose] polymerase-1 |
1380.38 nM 1400 nM |
IC50 IC50 |
PMID: 23574272
PMID: 23574272 |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A |
3162.3 nM |
Potency |
via CMAUP
|
CHEMBL1293232 | Q16637 | Survival motor neuron protein |
14125.4 nM |
Potency |
via CMAUP
|
CHEMBL6164 | O95271 | Tankyrase-1 |
323.59 nM 320 nM 320 nM 323.59 nM |
IC50 IC50 IC50 IC50 |
PMID: 23574272
PMID: 23574272 via Super-PRED PMID: 24116873 |
CHEMBL6154 | Q9H2K2 | Tankyrase-2 |
147.91 nM 140 nM 140 nM |
IC50 IC50 IC50 |
PMID: 23574272
PMID: 23574272 via Super-PRED |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.24% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.32% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 92.95% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.46% | 89.00% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 87.92% | 94.23% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.99% | 85.14% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.81% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.82% | 86.33% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.46% | 94.62% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 84.44% | 92.08% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 82.43% | 96.37% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.64% | 95.50% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.68% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 10680 |
NPASS | NPC32298 |
ChEMBL | CHEMBL275638 |
LOTUS | LTS0083403 |
wikiData | Q2742033 |