methyl (3R,21S,22S)-16-ethenyl-11-ethyl-12,17,21,26-tetramethyl-4-oxo-22-[3-oxo-3-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enoxy]propyl]-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1(23),2(6),5(26),7,9,11,13,15,17,19-decaene-3-carboxylate
Internal ID | 156bdd6c-2cd1-4fe5-abc6-be02d1765271 |
Taxonomy | Organoheterocyclic compounds > Tetrapyrroles and derivatives > Chlorins |
IUPAC Name | methyl (3R,21S,22S)-16-ethenyl-11-ethyl-12,17,21,26-tetramethyl-4-oxo-22-[3-oxo-3-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enoxy]propyl]-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1(23),2(6),5(26),7,9,11,13,15,17,19-decaene-3-carboxylate |
SMILES (Canonical) | CCC1=C(C2=CC3=C(C(=C(N3)C=C4C(C(C(=N4)C5=C6C(=C(C(=N6)C=C1N2)C)C(=O)C5C(=O)OC)CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C)C)C=C)C |
SMILES (Isomeric) | CCC1=C(C2=CC3=C(C(=C(N3)C=C4[C@H]([C@@H](C(=N4)C5=C6C(=C(C(=N6)C=C1N2)C)C(=O)[C@@H]5C(=O)OC)CCC(=O)OC/C=C(\C)/CCC[C@H](C)CCC[C@H](C)CCCC(C)C)C)C)C=C)C |
InChI | InChI=1S/C55H74N4O5/c1-13-39-35(8)42-28-44-37(10)41(24-25-48(60)64-27-26-34(7)23-17-22-33(6)21-16-20-32(5)19-15-18-31(3)4)52(58-44)50-51(55(62)63-12)54(61)49-38(11)45(59-53(49)50)30-47-40(14-2)36(9)43(57-47)29-46(39)56-42/h13,26,28-33,37,41,51,56-57H,1,14-25,27H2,2-12H3/b34-26+,42-28?,43-29?,44-28?,45-30?,46-29?,47-30?,52-50?/t32-,33-,37+,41+,51-/m1/s1 |
InChI Key | DQVGVYRSVYCJRR-AXRVZGOCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C55H74N4O5 |
Molecular Weight | 871.20 g/mol |
Exact Mass | 870.56592147 g/mol |
Topological Polar Surface Area (TPSA) | 127.00 Ų |
XlogP | 14.20 |
There are no found synonyms. |
![2D Structure of methyl (3R,21S,22S)-16-ethenyl-11-ethyl-12,17,21,26-tetramethyl-4-oxo-22-[3-oxo-3-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enoxy]propyl]-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1(23),2(6),5(26),7,9,11,13,15,17,19-decaene-3-carboxylate 2D Structure of methyl (3R,21S,22S)-16-ethenyl-11-ethyl-12,17,21,26-tetramethyl-4-oxo-22-[3-oxo-3-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enoxy]propyl]-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1(23),2(6),5(26),7,9,11,13,15,17,19-decaene-3-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/e68b5af0-8524-11ee-8540-0bf8a8719a0e.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.36% | 98.95% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 96.66% | 98.59% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 96.29% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.19% | 99.17% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.49% | 85.14% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 94.39% | 94.75% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.81% | 96.09% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 92.90% | 93.03% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 92.64% | 96.90% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.01% | 94.45% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.25% | 99.23% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.59% | 94.73% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.22% | 96.47% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.86% | 86.33% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 86.00% | 95.71% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.85% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.14% | 95.56% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.66% | 97.21% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.37% | 93.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.24% | 96.00% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 84.16% | 91.24% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 83.55% | 97.53% |
CHEMBL1907 | P15144 | Aminopeptidase N | 82.82% | 93.31% |
CHEMBL2885 | P07451 | Carbonic anhydrase III | 82.12% | 87.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 5459387 |
LOTUS | LTS0200273 |
wikiData | Q104252257 |