Methyl 6-hydroxy-7-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate
Internal ID | eca08457-3ac7-404a-816f-c050c8c51164 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | methyl 6-hydroxy-7-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
SMILES (Canonical) | CC1C(CC2C1C(OC=C2C(=O)OC)OC3C(C(C(C(O3)CO)O)O)O)O |
SMILES (Isomeric) | CC1C(CC2C1C(OC=C2C(=O)OC)OC3C(C(C(C(O3)CO)O)O)O)O |
InChI | InChI=1S/C17H26O10/c1-6-9(19)3-7-8(15(23)24-2)5-25-16(11(6)7)27-17-14(22)13(21)12(20)10(4-18)26-17/h5-7,9-14,16-22H,3-4H2,1-2H3 |
InChI Key | AMBQHHVBBHTQBF-UHFFFAOYSA-N |
Popularity | 142 references in papers |
Molecular Formula | C17H26O10 |
Molecular Weight | 390.40 g/mol |
Exact Mass | 390.15259702 g/mol |
Topological Polar Surface Area (TPSA) | 155.00 Ų |
XlogP | -1.40 |
methyl 6-hydroxy-7-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
MFCD00075645 |
BCP14142 |
AKOS015902773 |
Loganoside;7-Hydroxy-6-desoxyverbenalin |
SY057950 |
![2D Structure of Methyl 6-hydroxy-7-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate 2D Structure of Methyl 6-hydroxy-7-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/ae823010-85ef-11ee-8cb4-2d113ab05cc4.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.84% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.16% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.35% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.91% | 97.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.59% | 94.73% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.85% | 86.92% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.35% | 90.00% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 87.94% | 83.82% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 87.38% | 95.83% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.78% | 96.61% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.76% | 99.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.20% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 83.23% | 98.95% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.87% | 96.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.94% | 97.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 601562 |
LOTUS | LTS0032881 |
wikiData | Q103816238 |