Spiraeoside
Internal ID | 900ec02d-df05-4070-b3c9-18f0de9a05fd |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides |
IUPAC Name | 3,5,7-trihydroxy-2-[3-hydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one |
SMILES (Canonical) | C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O)OC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O |
InChI | InChI=1S/C21H20O12/c22-6-13-15(26)17(28)19(30)21(33-13)32-11-2-1-7(3-9(11)24)20-18(29)16(27)14-10(25)4-8(23)5-12(14)31-20/h1-5,13,15,17,19,21-26,28-30H,6H2/t13-,15-,17+,19-,21-/m1/s1 |
InChI Key | OIUBYZLTFSLSBY-HMGRVEAOSA-N |
Popularity | 132 references in papers |
Molecular Formula | C21H20O12 |
Molecular Weight | 464.40 g/mol |
Exact Mass | 464.09547607 g/mol |
Topological Polar Surface Area (TPSA) | 207.00 Ų |
XlogP | 0.40 |
20229-56-5 |
Spiraein |
Spiraeosid |
Quercetin 4'-O-glucoside |
Spiraein (Acacia) |
Spireoside |
Quercetin 4'-glucoside |
Quercetin-4'-glucoside |
EINECS 243-614-6 |
UNII-K2B74751XI |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL2608 | P10253 | Lysosomal alpha-glucosidase |
35481.3 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.70% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.17% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 95.72% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.32% | 94.00% |
CHEMBL3194 | P02766 | Transthyretin | 93.76% | 90.71% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 92.77% | 95.64% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 92.65% | 95.78% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.95% | 86.33% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.67% | 91.49% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.78% | 86.92% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.69% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.56% | 94.73% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.81% | 94.45% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.08% | 99.15% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.07% | 96.09% |
CHEMBL2424 | Q04760 | Glyoxalase I | 83.78% | 91.67% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.31% | 97.09% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.97% | 96.21% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.29% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.11% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.75% | 90.71% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 80.01% | 83.57% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 5320844 |
NPASS | NPC21100 |
ChEMBL | CHEMBL402947 |
LOTUS | LTS0068360 |
wikiData | Q7577713 |