Quercetin pentamethyl ether
Internal ID | b76d1496-42e3-4a4b-9e80-0153bfa0db0e |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 7-O-methylated flavonoids |
IUPAC Name | 2-(3,4-dimethoxyphenyl)-3,5,7-trimethoxychromen-4-one |
SMILES (Canonical) | COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(O2)C=C(C=C3OC)OC)OC)OC |
SMILES (Isomeric) | COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(O2)C=C(C=C3OC)OC)OC)OC |
InChI | InChI=1S/C20H20O7/c1-22-12-9-15(25-4)17-16(10-12)27-19(20(26-5)18(17)21)11-6-7-13(23-2)14(8-11)24-3/h6-10H,1-5H3 |
InChI Key | ALGDHWVALRSLBT-UHFFFAOYSA-N |
Popularity | 78 references in papers |
Molecular Formula | C20H20O7 |
Molecular Weight | 372.40 g/mol |
Exact Mass | 372.12090297 g/mol |
Topological Polar Surface Area (TPSA) | 72.40 Ų |
XlogP | 3.20 |
Atomic LogP (AlogP) | 3.50 |
H-Bond Acceptor | 7 |
H-Bond Donor | 0 |
Rotatable Bonds | 6 |
1247-97-8 |
Pentamethylquercetin |
Pentamethoxyquercetin |
Penta-O-methylquercitin |
Quercetin-3,5,7,3',4'-pentamethyl ether |
3,5,7,3',4'-pentamethoxyflavone |
2-(3,4-dimethoxyphenyl)-3,5,7-trimethoxychromen-4-one |
NSC-115922 |
3,3',4',5,7-Pentamethoxyflavone |
4H-1-Benzopyran-4-one, 2-(3,4-dimethoxyphenyl)-3,5,7-trimethoxy- |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9901 | 99.01% |
Caco-2 | + | 0.8774 | 87.74% |
Blood Brain Barrier | - | 0.6500 | 65.00% |
Human oral bioavailability | + | 0.6000 | 60.00% |
Subcellular localzation | Mitochondria | 0.7006 | 70.06% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9632 | 96.32% |
OATP1B3 inhibitior | + | 0.9919 | 99.19% |
MATE1 inhibitior | - | 0.9600 | 96.00% |
OCT2 inhibitior | - | 0.9750 | 97.50% |
BSEP inhibitior | + | 0.7791 | 77.91% |
P-glycoprotein inhibitior | + | 0.9484 | 94.84% |
P-glycoprotein substrate | - | 0.8547 | 85.47% |
CYP3A4 substrate | + | 0.5220 | 52.20% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.7654 | 76.54% |
CYP3A4 inhibition | + | 0.6138 | 61.38% |
CYP2C9 inhibition | - | 0.7985 | 79.85% |
CYP2C19 inhibition | + | 0.7445 | 74.45% |
CYP2D6 inhibition | - | 0.9546 | 95.46% |
CYP1A2 inhibition | + | 0.9694 | 96.94% |
CYP2C8 inhibition | + | 0.7408 | 74.08% |
CYP inhibitory promiscuity | + | 0.8123 | 81.23% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9900 | 99.00% |
Carcinogenicity (trinary) | Non-required | 0.5636 | 56.36% |
Eye corrosion | - | 0.9682 | 96.82% |
Eye irritation | + | 0.6223 | 62.23% |
Skin irritation | - | 0.7565 | 75.65% |
Skin corrosion | - | 0.9845 | 98.45% |
Ames mutagenesis | + | 0.5800 | 58.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7448 | 74.48% |
Micronuclear | + | 0.7759 | 77.59% |
Hepatotoxicity | + | 0.6085 | 60.85% |
skin sensitisation | - | 0.9439 | 94.39% |
Respiratory toxicity | - | 0.6111 | 61.11% |
Reproductive toxicity | + | 0.8111 | 81.11% |
Mitochondrial toxicity | - | 0.5375 | 53.75% |
Nephrotoxicity | - | 0.6981 | 69.81% |
Acute Oral Toxicity (c) | II | 0.6245 | 62.45% |
Estrogen receptor binding | + | 0.8941 | 89.41% |
Androgen receptor binding | + | 0.8064 | 80.64% |
Thyroid receptor binding | + | 0.6255 | 62.55% |
Glucocorticoid receptor binding | + | 0.8051 | 80.51% |
Aromatase binding | + | 0.6099 | 60.99% |
PPAR gamma | + | 0.7997 | 79.97% |
Honey bee toxicity | - | 0.8747 | 87.47% |
Biodegradation | - | 0.8250 | 82.50% |
Crustacea aquatic toxicity | + | 0.6400 | 64.00% |
Fish aquatic toxicity | + | 0.9192 | 91.92% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
19952.6 nM |
Potency |
via CMAUP
|
CHEMBL5393 | Q9UNQ0 | ATP-binding cassette sub-family G member 2 |
1880 nM 822 nM 822 nM |
IC50 IC50 IC50 |
PMID: 23851114
PMID: 23851114 via Super-PRED |
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
1258.9 nM 1258.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
31622.8 nM 35481.3 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL4040 | P28482 | MAP kinase ERK2 |
39810.7 nM 1000 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 |
26350 nM |
IC50 |
PMID: 23851114
|
CHEMBL4302 | P08183 | P-glycoprotein 1 |
23400 nM |
IC50 |
PMID: 23851114
|
CHEMBL1075138 | Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 |
10000 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.35% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.04% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.06% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.83% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.96% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 87.34% | 98.95% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.96% | 96.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.45% | 94.45% |
CHEMBL1907 | P15144 | Aminopeptidase N | 85.24% | 93.31% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.15% | 91.11% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 83.42% | 94.03% |
CHEMBL2717 | Q9HCR9 | Phosphodiesterase 11A | 82.26% | 85.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.96% | 96.09% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 81.85% | 95.78% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.29% | 93.99% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.35% | 94.73% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.23% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 97332 |
NPASS | NPC310259 |
ChEMBL | CHEMBL19032 |
LOTUS | LTS0234816 |
wikiData | Q83021718 |