Pseudobaptigenin
Internal ID | 853f7e2a-6297-4d08-a05b-9acca992aeff |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflav-2-enes > Isoflavones |
IUPAC Name | 3-(1,3-benzodioxol-5-yl)-7-hydroxychromen-4-one |
SMILES (Canonical) | C1OC2=C(O1)C=C(C=C2)C3=COC4=C(C3=O)C=CC(=C4)O |
SMILES (Isomeric) | C1OC2=C(O1)C=C(C=C2)C3=COC4=C(C3=O)C=CC(=C4)O |
InChI | InChI=1S/C16H10O5/c17-10-2-3-11-14(6-10)19-7-12(16(11)18)9-1-4-13-15(5-9)21-8-20-13/h1-7,17H,8H2 |
InChI Key | KNJNBKINYHZUGC-UHFFFAOYSA-N |
Popularity | 36 references in papers |
Molecular Formula | C16H10O5 |
Molecular Weight | 282.25 g/mol |
Exact Mass | 282.05282342 g/mol |
Topological Polar Surface Area (TPSA) | 65.00 Ų |
XlogP | 2.60 |
Atomic LogP (AlogP) | 2.89 |
H-Bond Acceptor | 5 |
H-Bond Donor | 1 |
Rotatable Bonds | 1 |
Psi-baptigenin |
90-29-9 |
.psi.-Baptigenin |
NSC-100796 |
7-Hydroxy-3',4'-methylenedioxyisoflavone |
UNII-78RRL4HLL9 |
78RRL4HLL9 |
PSEUDOBABTIGEN |
CHEBI:8602 |
pseudobaptisin aglycone |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9862 | 98.62% |
Caco-2 | + | 0.6269 | 62.69% |
Blood Brain Barrier | - | 0.7250 | 72.50% |
Human oral bioavailability | - | 0.5286 | 52.86% |
Subcellular localzation | Mitochondria | 0.8090 | 80.90% |
OATP2B1 inhibitior | - | 0.7224 | 72.24% |
OATP1B1 inhibitior | + | 0.9363 | 93.63% |
OATP1B3 inhibitior | + | 0.9114 | 91.14% |
MATE1 inhibitior | - | 0.7200 | 72.00% |
OCT2 inhibitior | - | 1.0000 | 100.00% |
BSEP inhibitior | - | 0.6915 | 69.15% |
P-glycoprotein inhibitior | - | 0.5883 | 58.83% |
P-glycoprotein substrate | - | 0.8991 | 89.91% |
CYP3A4 substrate | + | 0.5221 | 52.21% |
CYP2C9 substrate | - | 0.8137 | 81.37% |
CYP2D6 substrate | - | 0.8267 | 82.67% |
CYP3A4 inhibition | + | 0.6703 | 67.03% |
CYP2C9 inhibition | + | 0.6056 | 60.56% |
CYP2C19 inhibition | - | 0.5853 | 58.53% |
CYP2D6 inhibition | - | 0.6764 | 67.64% |
CYP1A2 inhibition | + | 0.6250 | 62.50% |
CYP2C8 inhibition | - | 0.5964 | 59.64% |
CYP inhibitory promiscuity | + | 0.5599 | 55.99% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 1.0000 | 100.00% |
Carcinogenicity (trinary) | Non-required | 0.5294 | 52.94% |
Eye corrosion | - | 0.9880 | 98.80% |
Eye irritation | + | 0.7278 | 72.78% |
Skin irritation | - | 0.5477 | 54.77% |
Skin corrosion | - | 0.9646 | 96.46% |
Ames mutagenesis | - | 0.7000 | 70.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.8207 | 82.07% |
Micronuclear | + | 0.8874 | 88.74% |
Hepatotoxicity | + | 0.6125 | 61.25% |
skin sensitisation | - | 0.7912 | 79.12% |
Respiratory toxicity | + | 0.6222 | 62.22% |
Reproductive toxicity | + | 0.6778 | 67.78% |
Mitochondrial toxicity | + | 0.5375 | 53.75% |
Nephrotoxicity | + | 0.6262 | 62.62% |
Acute Oral Toxicity (c) | II | 0.4162 | 41.62% |
Estrogen receptor binding | + | 0.9531 | 95.31% |
Androgen receptor binding | + | 0.9550 | 95.50% |
Thyroid receptor binding | + | 0.6657 | 66.57% |
Glucocorticoid receptor binding | + | 0.8174 | 81.74% |
Aromatase binding | + | 0.9061 | 90.61% |
PPAR gamma | + | 0.8836 | 88.36% |
Honey bee toxicity | - | 0.8533 | 85.33% |
Biodegradation | - | 0.8250 | 82.50% |
Crustacea aquatic toxicity | - | 0.5900 | 59.00% |
Fish aquatic toxicity | + | 0.9440 | 94.40% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL239 | Q07869 | Peroxisome proliferator-activated receptor alpha |
8900 nM 8900 nM 8900 nM |
EC50 EC50 EC50 |
PMID: 26616289
PMID: 23265844 PMID: 19807106 |
CHEMBL3979 | Q03181 | Peroxisome proliferator-activated receptor delta |
22340 nM |
EC50 |
PMID: 23265844
|
CHEMBL235 | P37231 | Peroxisome proliferator-activated receptor gamma |
26940 nM 26940 nM 26940 nM |
EC50 EC50 EC50 |
PMID: 19807106
PMID: 26616289 PMID: 23265844 |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.79% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.94% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.11% | 89.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 94.21% | 96.77% |
CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 91.70% | 93.24% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 91.27% | 98.35% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.08% | 95.56% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 89.07% | 94.80% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.06% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.60% | 86.33% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 86.79% | 88.48% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.27% | 99.15% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 84.64% | 96.12% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 83.48% | 95.53% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 83.35% | 95.78% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.30% | 99.23% |
CHEMBL2717 | Q9HCR9 | Phosphodiesterase 11A | 82.46% | 85.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.40% | 94.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.35% | 93.40% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 81.86% | 80.78% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 81.59% | 80.96% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.21% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 5281805 |
NPASS | NPC35544 |
ChEMBL | CHEMBL486176 |
LOTUS | LTS0178079 |
wikiData | Q7254529 |