Nicotine
Internal ID | 42b00310-59b7-4ba1-8f01-0e508339886b |
Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Pyrrolidinylpyridines |
IUPAC Name | 3-[(2S)-1-methylpyrrolidin-2-yl]pyridine |
SMILES (Canonical) | CN1CCCC1C2=CN=CC=C2 |
SMILES (Isomeric) | CN1CCC[C@H]1C2=CN=CC=C2 |
InChI | InChI=1S/C10H14N2/c1-12-7-3-5-10(12)9-4-2-6-11-8-9/h2,4,6,8,10H,3,5,7H2,1H3/t10-/m0/s1 |
InChI Key | SNICXCGAKADSCV-JTQLQIEISA-N |
Popularity | 58,392 references in papers |
Molecular Formula | C10H14N2 |
Molecular Weight | 162.23 g/mol |
Exact Mass | 162.115698455 g/mol |
Topological Polar Surface Area (TPSA) | 16.10 Ų |
XlogP | 1.20 |
Atomic LogP (AlogP) | 1.85 |
H-Bond Acceptor | 2 |
H-Bond Donor | 0 |
Rotatable Bonds | 1 |
L-Nicotine |
54-11-5 |
(-)-Nicotine |
(S)-Nicotine |
(S)-3-(1-methylpyrrolidin-2-yl)pyridine |
Habitrol |
Nicotrol |
(S)-(-)-Nicotine |
Nicoderm |
3-[(2S)-1-methylpyrrolidin-2-yl]pyridine |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9761 | 97.61% |
Caco-2 | + | 0.9426 | 94.26% |
Blood Brain Barrier | + | 1.0000 | 100.00% |
Human oral bioavailability | - | 0.8143 | 81.43% |
Subcellular localzation | Mitochondria | 0.4196 | 41.96% |
OATP2B1 inhibitior | - | 0.8636 | 86.36% |
OATP1B1 inhibitior | + | 0.9603 | 96.03% |
OATP1B3 inhibitior | + | 0.9475 | 94.75% |
MATE1 inhibitior | - | 1.0000 | 100.00% |
OCT2 inhibitior | - | 0.5500 | 55.00% |
BSEP inhibitior | - | 0.8806 | 88.06% |
P-glycoprotein inhibitior | - | 0.9957 | 99.57% |
P-glycoprotein substrate | - | 0.7747 | 77.47% |
CYP3A4 substrate | - | 0.5825 | 58.25% |
CYP2C9 substrate | + | 1.0000 | 100.00% |
CYP2D6 substrate | + | 0.6763 | 67.63% |
CYP3A4 inhibition | - | 0.8308 | 83.08% |
CYP2C9 inhibition | - | 0.8433 | 84.33% |
CYP2C19 inhibition | - | 0.8543 | 85.43% |
CYP2D6 inhibition | - | 0.8838 | 88.38% |
CYP1A2 inhibition | - | 0.6347 | 63.47% |
CYP2C8 inhibition | - | 0.8418 | 84.18% |
CYP inhibitory promiscuity | - | 0.7589 | 75.89% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9700 | 97.00% |
Carcinogenicity (trinary) | Non-required | 0.7042 | 70.42% |
Eye corrosion | - | 0.9886 | 98.86% |
Eye irritation | - | 0.8658 | 86.58% |
Skin irritation | + | 0.8032 | 80.32% |
Skin corrosion | - | 0.5826 | 58.26% |
Ames mutagenesis | - | 0.9800 | 98.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.5145 | 51.45% |
Micronuclear | - | 0.6700 | 67.00% |
Hepatotoxicity | + | 0.8770 | 87.70% |
skin sensitisation | - | 0.9436 | 94.36% |
Respiratory toxicity | + | 0.9778 | 97.78% |
Reproductive toxicity | + | 0.7000 | 70.00% |
Mitochondrial toxicity | + | 0.9250 | 92.50% |
Nephrotoxicity | - | 0.8018 | 80.18% |
Acute Oral Toxicity (c) | II | 0.7410 | 74.10% |
Estrogen receptor binding | - | 0.9297 | 92.97% |
Androgen receptor binding | - | 0.9392 | 93.92% |
Thyroid receptor binding | - | 0.8383 | 83.83% |
Glucocorticoid receptor binding | - | 0.6638 | 66.38% |
Aromatase binding | - | 0.8745 | 87.45% |
PPAR gamma | - | 0.8154 | 81.54% |
Honey bee toxicity | - | 0.9726 | 97.26% |
Biodegradation | - | 0.7750 | 77.50% |
Crustacea aquatic toxicity | + | 0.8400 | 84.00% |
Fish aquatic toxicity | + | 0.6563 | 65.63% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
28183.8 nM 15848.9 nM 39810.7 nM |
Potency Potency Potency |
via CMAUP
via CMAUP via CMAUP |
CHEMBL5282 | P11509 | Cytochrome P450 2A6 |
579428.7 nM |
IC50 |
PMID: 19110342
|
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
22387.2 nM 22387.2 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1882 | P43681 | Neuronal acetylcholine receptor protein alpha-4 subunit |
6600 nM 4700 nM |
EC50 EC50 |
PMID: 19552432
PMID: 19232492 |
CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit |
21000 nM 7600 nM |
IC50 IC50 |
PMID: 11312774
PMID: 23561269 |
CHEMBL3068 | P32297 | Neuronal acetylcholine receptor subunit alpha-3 |
45 nM 45 nM |
IC50 IC50 |
via Super-PRED
PMID: 11312774 |
CHEMBL2109233 | P17787 | Neuronal acetylcholine receptor; alpha3/alpha6/beta2/beta3 |
84.8 nM |
IC50 |
via Super-PRED
|
CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 |
0.045 nM |
Ki |
via Super-PRED
|
CHEMBL1293235 | P02545 | Prelamin-A/C |
4.5 nM |
Potency |
via Super-PRED
|
CHEMBL6007 | O75762 | Transient receptor potential cation channel subfamily A member 1 |
17000 nM |
EC50 |
PMID: 20356305
|
CHEMBL1075138 | Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 |
141.3 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.88% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.14% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 91.83% | 98.95% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 91.60% | 99.18% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.16% | 95.89% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 86.63% | 93.65% |
CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 84.56% | 92.86% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 84.53% | 97.05% |
CHEMBL3920 | Q04759 | Protein kinase C theta | 83.36% | 97.69% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 82.98% | 96.00% |
CHEMBL1938212 | Q9UPP1 | Histone lysine demethylase PHF8 | 81.90% | 98.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.19% | 97.09% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 80.77% | 96.25% |
CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 80.61% | 91.43% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.