Dendrophenol
| Internal ID | a1ead77a-b51d-4c3f-af65-c0c474902dfb |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 4-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-2,6-dimethoxyphenol |
| SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)CCC2=CC(=C(C=C2)O)OC |
| SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)CCC2=CC(=C(C=C2)O)OC |
| InChI | InChI=1S/C17H20O5/c1-20-14-8-11(6-7-13(14)18)4-5-12-9-15(21-2)17(19)16(10-12)22-3/h6-10,18-19H,4-5H2,1-3H3 |
| InChI Key | YTRAYUIKLRABOQ-UHFFFAOYSA-N |
| Popularity | 41 references in papers |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13107373 g/mol |
| Topological Polar Surface Area (TPSA) | 68.20 Ų |
| XlogP | 2.70 |
| 108853-14-1 |
| Moscatilin |
| 4,4'-Dihydroxy-3,3',5-trimethoxybibenzyl |
| 4-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-2,6-dimethoxyphenol |
| Phenol, 4-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-2,6-dimethoxy- |
| Phenol, 4-(2-(4-hydroxy-3-methoxyphenyl)ethyl)-2,6-dimethoxy- |
| Aloifol II |
| CHEMBL374047 |
| SCHEMBL18563068 |
| DTXSID80148752 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.02% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.89% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.15% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.11% | 86.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.50% | 99.17% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.85% | 94.00% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 86.08% | 95.17% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.04% | 99.15% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.46% | 90.00% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 84.02% | 90.24% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 83.66% | 90.20% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.62% | 92.62% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.03% | 86.92% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.52% | 94.45% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.22% | 98.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.61% | 95.89% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 80.34% | 92.68% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 176096 |
| NPASS | NPC193544 |
| ChEMBL | CHEMBL374047 |
| LOTUS | LTS0214903 |
| wikiData | Q72484885 |