(2R)-2-[[(1R,2S,6S)-5-hydroxy-2-(hydroxymethyl)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol
| Internal ID | 6952cbec-42fd-4e57-82a2-27e409def4ea |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
| IUPAC Name | (2R)-2-[[(1R,2S,6S)-5-hydroxy-2-(hydroxymethyl)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES (Canonical) | C1=COC(C2C1C(C3C2(O3)CO)O)OC4C(C(C(C(O4)CO)O)O)O |
| SMILES (Isomeric) | C1=COC([C@@H]2[C@H]1C(C3[C@@]2(O3)CO)O)O[C@@H]4C(C(C(C(O4)CO)O)O)O |
| InChI | InChI=1S/C15H22O10/c16-3-6-9(19)10(20)11(21)14(23-6)24-13-7-5(1-2-22-13)8(18)12-15(7,4-17)25-12/h1-2,5-14,16-21H,3-4H2/t5-,6?,7-,8?,9?,10?,11?,12?,13?,14+,15+/m0/s1 |
| InChI Key | LHDWRKICQLTVDL-IONKOTTMSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H22O10 |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.12129689 g/mol |
| Topological Polar Surface Area (TPSA) | 162.00 Ų |
| XlogP | -3.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.93% | 91.11% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 94.04% | 96.61% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.47% | 96.09% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 87.06% | 86.92% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 83.54% | 95.93% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.52% | 94.00% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 81.65% | 83.57% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.50% | 97.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.91% | 92.94% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 80.28% | 92.32% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 138107792 |
| LOTUS | LTS0137228 |
| wikiData | Q104249946 |