D-Tetrahydropalmatine
Internal ID | 2fea6c1d-6d71-44a5-b53d-be2ecdfdd19c |
Taxonomy | Alkaloids and derivatives > Protoberberine alkaloids and derivatives |
IUPAC Name | (13aR)-2,3,9,10-tetramethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline |
SMILES (Canonical) | COC1=C(C2=C(CC3C4=CC(=C(C=C4CCN3C2)OC)OC)C=C1)OC |
SMILES (Isomeric) | COC1=C(C2=C(C[C@@H]3C4=CC(=C(C=C4CCN3C2)OC)OC)C=C1)OC |
InChI | InChI=1S/C21H25NO4/c1-23-18-6-5-13-9-17-15-11-20(25-3)19(24-2)10-14(15)7-8-22(17)12-16(13)21(18)26-4/h5-6,10-11,17H,7-9,12H2,1-4H3/t17-/m1/s1 |
InChI Key | AEQDJSLRWYMAQI-QGZVFWFLSA-N |
Popularity | 368 references in papers |
Molecular Formula | C21H25NO4 |
Molecular Weight | 355.40 g/mol |
Exact Mass | 355.17835828 g/mol |
Topological Polar Surface Area (TPSA) | 40.20 Ų |
XlogP | 3.20 |
Atomic LogP (AlogP) | 3.38 |
H-Bond Acceptor | 5 |
H-Bond Donor | 0 |
Rotatable Bonds | 4 |
3520-14-7 |
(+)-Tetrahydropalmatine |
(+)-(R)-Tetrahydropalmatine |
(+)-Corydalis B |
Tetrahydropalmatine, (+)- |
Corydalis alkaloid B |
tetrahydropalmatine |
Tetrahydropalmatin |
(+)-2,3,9,10-Tetramethoxyberbine |
corydalis B |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9392 | 93.92% |
Caco-2 | + | 0.9145 | 91.45% |
Blood Brain Barrier | + | 0.6750 | 67.50% |
Human oral bioavailability | - | 0.8143 | 81.43% |
Subcellular localzation | Mitochondria | 0.6881 | 68.81% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9485 | 94.85% |
OATP1B3 inhibitior | + | 0.9480 | 94.80% |
MATE1 inhibitior | - | 0.9600 | 96.00% |
OCT2 inhibitior | + | 0.6250 | 62.50% |
BSEP inhibitior | + | 0.6039 | 60.39% |
P-glycoprotein inhibitior | + | 0.6925 | 69.25% |
P-glycoprotein substrate | + | 0.5476 | 54.76% |
CYP3A4 substrate | + | 0.5952 | 59.52% |
CYP2C9 substrate | + | 0.7753 | 77.53% |
CYP2D6 substrate | + | 0.8760 | 87.60% |
CYP3A4 inhibition | - | 0.7126 | 71.26% |
CYP2C9 inhibition | - | 0.9313 | 93.13% |
CYP2C19 inhibition | - | 0.6613 | 66.13% |
CYP2D6 inhibition | + | 0.7363 | 73.63% |
CYP1A2 inhibition | - | 0.6375 | 63.75% |
CYP2C8 inhibition | - | 0.6710 | 67.10% |
CYP inhibitory promiscuity | - | 0.7873 | 78.73% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9800 | 98.00% |
Carcinogenicity (trinary) | Non-required | 0.6277 | 62.77% |
Eye corrosion | - | 0.9896 | 98.96% |
Eye irritation | - | 0.9719 | 97.19% |
Skin irritation | - | 0.7735 | 77.35% |
Skin corrosion | - | 0.9468 | 94.68% |
Ames mutagenesis | - | 0.6000 | 60.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.9074 | 90.74% |
Micronuclear | - | 0.5700 | 57.00% |
Hepatotoxicity | - | 0.7000 | 70.00% |
skin sensitisation | - | 0.9013 | 90.13% |
Respiratory toxicity | + | 0.8556 | 85.56% |
Reproductive toxicity | + | 0.8000 | 80.00% |
Mitochondrial toxicity | + | 0.8250 | 82.50% |
Nephrotoxicity | - | 0.6563 | 65.63% |
Acute Oral Toxicity (c) | III | 0.4578 | 45.78% |
Estrogen receptor binding | + | 0.6884 | 68.84% |
Androgen receptor binding | - | 0.4813 | 48.13% |
Thyroid receptor binding | + | 0.6218 | 62.18% |
Glucocorticoid receptor binding | + | 0.5908 | 59.08% |
Aromatase binding | - | 0.8005 | 80.05% |
PPAR gamma | - | 0.6837 | 68.37% |
Honey bee toxicity | - | 0.8753 | 87.53% |
Biodegradation | - | 0.9250 | 92.50% |
Crustacea aquatic toxicity | + | 0.7300 | 73.00% |
Fish aquatic toxicity | - | 0.3746 | 37.46% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL4081 | P13726 | Coagulation factor III |
22.78 nM 14.98 nM |
IC50 IC50 |
via Super-PRED
via Super-PRED |
CHEMBL2056 | P21728 | Dopamine D1 receptor |
153 nM |
Ki |
via Super-PRED
|
CHEMBL217 | P14416 | Dopamine D2 receptor |
450 nM |
IC50 |
via Super-PRED
|
CHEMBL1850 | P21918 | Dopamine D5 receptor |
305 nM |
Ki |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.20% | 96.09% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 96.08% | 93.40% |
CHEMBL5747 | Q92793 | CREB-binding protein | 94.59% | 95.12% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.95% | 86.33% |
CHEMBL2535 | P11166 | Glucose transporter | 91.17% | 98.75% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 90.11% | 92.98% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.22% | 92.94% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 88.63% | 89.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.41% | 95.89% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.68% | 93.99% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.65% | 94.45% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.23% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.07% | 95.56% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 85.33% | 82.38% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 83.90% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 83.69% | 98.95% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 83.36% | 88.48% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 81.44% | 96.86% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 80.53% | 89.05% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 969488 |
NPASS | NPC106295 |
LOTUS | LTS0175021 |
wikiData | Q27268022 |