Cherianoine
Internal ID | d0c64ea9-a218-4ce0-a226-91b1ced05a3d |
Taxonomy | Organoheterocyclic compounds > Isoquinolines and derivatives > Isoquinolones and derivatives |
IUPAC Name | 7-hydroxy-6,8-dimethoxy-2-methylisoquinolin-1-one |
SMILES (Canonical) | CN1C=CC2=CC(=C(C(=C2C1=O)OC)O)OC |
SMILES (Isomeric) | CN1C=CC2=CC(=C(C(=C2C1=O)OC)O)OC |
InChI | InChI=1S/C12H13NO4/c1-13-5-4-7-6-8(16-2)10(14)11(17-3)9(7)12(13)15/h4-6,14H,1-3H3 |
InChI Key | OJLLODMRNXRZIT-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C12H13NO4 |
Molecular Weight | 235.24 g/mol |
Exact Mass | 235.08445790 g/mol |
Topological Polar Surface Area (TPSA) | 59.00 Ų |
XlogP | 1.10 |
There are no found synonyms. |
![2D Structure of Cherianoine 2D Structure of Cherianoine](https://plantaedb.com/storage/docs/compounds/2023/07/cherianoine.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.06% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.29% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.02% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.40% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.57% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 89.48% | 98.95% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 88.88% | 94.42% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.65% | 90.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.33% | 99.15% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 85.23% | 80.78% |
CHEMBL2535 | P11166 | Glucose transporter | 82.02% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 5315819 |
NPASS | NPC116349 |
LOTUS | LTS0215879 |
wikiData | Q105193145 |