Annocherine B
Internal ID | 1f8d7be8-4e9a-4564-a2b2-a1a1b3806c0d |
Taxonomy | Organoheterocyclic compounds > Isoquinolines and derivatives > Benzylisoquinolines |
IUPAC Name | 1-[(S)-(4-hydroxyphenyl)-methoxymethyl]-6-methoxyisoquinolin-7-ol |
SMILES (Canonical) | COC1=C(C=C2C(=C1)C=CN=C2C(C3=CC=C(C=C3)O)OC)O |
SMILES (Isomeric) | COC1=C(C=C2C(=C1)C=CN=C2[C@H](C3=CC=C(C=C3)O)OC)O |
InChI | InChI=1S/C18H17NO4/c1-22-16-9-12-7-8-19-17(14(12)10-15(16)21)18(23-2)11-3-5-13(20)6-4-11/h3-10,18,20-21H,1-2H3/t18-/m0/s1 |
InChI Key | UGPTYMLHEHFVJS-SFHVURJKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H17NO4 |
Molecular Weight | 311.30 g/mol |
Exact Mass | 311.11575802 g/mol |
Topological Polar Surface Area (TPSA) | 71.80 Ų |
XlogP | 2.70 |
CHEBI:174974 |
1-[(S)-(4-hydroxyphenyl)-methoxymethyl]-6-methoxyisoquinolin-7-ol |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 96.23% | 93.10% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.94% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.20% | 91.49% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.84% | 85.14% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.54% | 99.15% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 92.60% | 89.62% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.35% | 96.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.30% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.60% | 99.17% |
CHEMBL2535 | P11166 | Glucose transporter | 90.74% | 98.75% |
CHEMBL5747 | Q92793 | CREB-binding protein | 90.36% | 95.12% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.11% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.28% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.11% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 84.37% | 98.95% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.86% | 100.00% |
CHEMBL5014 | O43353 | Serine/threonine-protein kinase RIPK2 | 83.65% | 86.79% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.75% | 95.56% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.55% | 92.94% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.46% | 93.65% |
CHEMBL1907 | P15144 | Aminopeptidase N | 80.41% | 93.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 5319094 |
NPASS | NPC117423 |
LOTUS | LTS0271469 |
wikiData | Q105272497 |